Merge tag '2023.11.0' into art/bump-2023.11.0
This commit is contained in:
commit
1f359d68b7
300 changed files with 9329 additions and 3335 deletions
|
|
@ -74,6 +74,7 @@ export function userDetailed(id = 'someuserid', username = 'miskist', host = 'mi
|
|||
onlineStatus: 'unknown',
|
||||
avatarUrl: 'https://github.com/misskey-dev/misskey/blob/master/packages/frontend/assets/about-icon.png?raw=true',
|
||||
avatarBlurhash: 'eQFRshof5NWBRi},juayfPju53WB?0ofs;s*a{ofjuay^SoMEJR%ay',
|
||||
avatarDecorations: [],
|
||||
emojis: [],
|
||||
bannerBlurhash: 'eQA^IW^-MH8w9tE8I=S^o{$*R4RikXtSxutRozjEnNR.RQadoyozog',
|
||||
bannerColor: '#000000',
|
||||
|
|
|
|||
BIN
packages/frontend/assets/tutorial/ai.webp
Normal file
BIN
packages/frontend/assets/tutorial/ai.webp
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 12 KiB |
BIN
packages/frontend/assets/tutorial/natto_failed.webp
Normal file
BIN
packages/frontend/assets/tutorial/natto_failed.webp
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 13 KiB |
BIN
packages/frontend/assets/tutorial/timeline_tab.png
Normal file
BIN
packages/frontend/assets/tutorial/timeline_tab.png
Normal file
Binary file not shown.
|
After Width: | Height: | Size: 2.8 KiB |
|
|
@ -10,7 +10,7 @@
|
|||
"build-storybook": "pnpm build-storybook-pre && storybook build",
|
||||
"chromatic": "chromatic",
|
||||
"test": "vitest --run",
|
||||
"test-and-coverage": "vitest --run --coverage",
|
||||
"test-and-coverage": "vitest --run --coverage --globals",
|
||||
"typecheck": "vue-tsc --noEmit",
|
||||
"eslint": "eslint --quiet \"src/**/*.{ts,vue}\"",
|
||||
"lint": "pnpm typecheck && pnpm eslint"
|
||||
|
|
@ -20,16 +20,17 @@
|
|||
"@github/webauthn-json": "2.1.1",
|
||||
"@rollup/plugin-alias": "5.0.1",
|
||||
"@rollup/plugin-json": "6.0.1",
|
||||
"@rollup/plugin-replace": "5.0.4",
|
||||
"@rollup/plugin-replace": "5.0.5",
|
||||
"@rollup/pluginutils": "5.0.5",
|
||||
"@syuilo/aiscript": "0.16.0",
|
||||
"@tabler/icons-webfont": "2.37.0",
|
||||
"@vitejs/plugin-vue": "4.4.0",
|
||||
"@vue-macros/reactivity-transform": "0.3.23",
|
||||
"@vue/compiler-sfc": "3.3.5",
|
||||
"@vue/compiler-sfc": "3.3.7",
|
||||
"astring": "1.8.6",
|
||||
"autosize": "6.0.1",
|
||||
"broadcast-channel": "5.5.0",
|
||||
"aiscript-vscode": "github:aiscript-dev/aiscript-vscode#v0.0.5",
|
||||
"broadcast-channel": "6.0.0",
|
||||
"browser-image-resizer": "github:misskey-dev/browser-image-resizer#v2.2.1-misskey.3",
|
||||
"buraha": "0.0.1",
|
||||
"canvas-confetti": "1.6.1",
|
||||
|
|
@ -38,7 +39,7 @@
|
|||
"chartjs-chart-matrix": "2.0.1",
|
||||
"chartjs-plugin-gradient": "0.6.1",
|
||||
"chartjs-plugin-zoom": "2.0.1",
|
||||
"chromatic": "7.4.0",
|
||||
"chromatic": "7.6.0",
|
||||
"compare-versions": "6.1.0",
|
||||
"cropperjs": "2.0.0-beta.4",
|
||||
"date-fns": "2.30.0",
|
||||
|
|
@ -54,15 +55,15 @@
|
|||
"mfm-js": "0.23.3",
|
||||
"misskey-js": "workspace:*",
|
||||
"photoswipe": "5.4.2",
|
||||
"prismjs": "1.29.0",
|
||||
"punycode": "2.3.0",
|
||||
"punycode": "2.3.1",
|
||||
"querystring": "0.2.1",
|
||||
"rollup": "4.1.4",
|
||||
"rollup": "4.2.0",
|
||||
"sanitize-html": "2.11.0",
|
||||
"sass": "1.69.4",
|
||||
"shiki": "^0.14.5",
|
||||
"sass": "1.69.5",
|
||||
"strict-event-emitter-types": "2.0.0",
|
||||
"textarea-caret": "3.1.0",
|
||||
"three": "0.157.0",
|
||||
"three": "0.158.0",
|
||||
"throttle-debounce": "5.0.0",
|
||||
"tinycolor2": "1.6.0",
|
||||
"tsc-alias": "1.8.8",
|
||||
|
|
@ -70,38 +71,37 @@
|
|||
"twemoji-parser": "14.0.0",
|
||||
"typescript": "5.2.2",
|
||||
"uuid": "9.0.1",
|
||||
"v-code-diff": "1.7.1",
|
||||
"v-code-diff": "1.7.2",
|
||||
"vanilla-tilt": "1.8.1",
|
||||
"vite": "4.5.0",
|
||||
"vue": "3.3.5",
|
||||
"vue-prism-editor": "2.0.0-alpha.2",
|
||||
"vue": "3.3.7",
|
||||
"vuedraggable": "next"
|
||||
},
|
||||
"devDependencies": {
|
||||
"@storybook/addon-actions": "7.5.1",
|
||||
"@storybook/addon-essentials": "7.5.1",
|
||||
"@storybook/addon-interactions": "7.5.1",
|
||||
"@storybook/addon-links": "7.5.1",
|
||||
"@storybook/addon-storysource": "7.5.1",
|
||||
"@storybook/addons": "7.5.1",
|
||||
"@storybook/blocks": "7.5.1",
|
||||
"@storybook/core-events": "7.5.1",
|
||||
"@storybook/addon-actions": "7.5.2",
|
||||
"@storybook/addon-essentials": "7.5.2",
|
||||
"@storybook/addon-interactions": "7.5.2",
|
||||
"@storybook/addon-links": "7.5.2",
|
||||
"@storybook/addon-storysource": "7.5.2",
|
||||
"@storybook/addons": "7.5.2",
|
||||
"@storybook/blocks": "7.5.2",
|
||||
"@storybook/core-events": "7.5.2",
|
||||
"@storybook/jest": "0.2.3",
|
||||
"@storybook/manager-api": "7.5.1",
|
||||
"@storybook/preview-api": "7.5.1",
|
||||
"@storybook/react": "7.5.1",
|
||||
"@storybook/react-vite": "7.5.1",
|
||||
"@storybook/manager-api": "7.5.2",
|
||||
"@storybook/preview-api": "7.5.2",
|
||||
"@storybook/react": "7.5.2",
|
||||
"@storybook/react-vite": "7.5.2",
|
||||
"@storybook/testing-library": "0.2.2",
|
||||
"@storybook/theming": "7.5.1",
|
||||
"@storybook/types": "7.5.1",
|
||||
"@storybook/vue3": "7.5.1",
|
||||
"@storybook/vue3-vite": "7.5.1",
|
||||
"@testing-library/vue": "7.0.0",
|
||||
"@storybook/theming": "7.5.2",
|
||||
"@storybook/types": "7.5.2",
|
||||
"@storybook/vue3": "7.5.2",
|
||||
"@storybook/vue3-vite": "7.5.2",
|
||||
"@testing-library/vue": "8.0.0",
|
||||
"@types/escape-regexp": "0.0.2",
|
||||
"@types/estree": "1.0.3",
|
||||
"@types/estree": "1.0.4",
|
||||
"@types/matter-js": "0.19.2",
|
||||
"@types/micromatch": "4.0.4",
|
||||
"@types/node": "20.8.7",
|
||||
"@types/node": "20.8.10",
|
||||
"@types/punycode": "2.1.1",
|
||||
"@types/sanitize-html": "2.9.3",
|
||||
"@types/throttle-debounce": "5.0.1",
|
||||
|
|
@ -109,33 +109,33 @@
|
|||
"@types/uuid": "9.0.6",
|
||||
"@types/websocket": "1.0.8",
|
||||
"@types/ws": "8.5.8",
|
||||
"@typescript-eslint/eslint-plugin": "6.8.0",
|
||||
"@typescript-eslint/parser": "6.8.0",
|
||||
"@typescript-eslint/eslint-plugin": "6.9.1",
|
||||
"@typescript-eslint/parser": "6.9.1",
|
||||
"@vitest/coverage-v8": "0.34.6",
|
||||
"@vue/runtime-core": "3.3.5",
|
||||
"acorn": "8.10.0",
|
||||
"@vue/runtime-core": "3.3.7",
|
||||
"acorn": "8.11.2",
|
||||
"cross-env": "7.0.3",
|
||||
"cypress": "13.3.2",
|
||||
"eslint": "8.51.0",
|
||||
"eslint-plugin-import": "2.28.1",
|
||||
"eslint-plugin-vue": "9.17.0",
|
||||
"cypress": "13.4.0",
|
||||
"eslint": "8.52.0",
|
||||
"eslint-plugin-import": "2.29.0",
|
||||
"eslint-plugin-vue": "9.18.1",
|
||||
"fast-glob": "3.3.1",
|
||||
"happy-dom": "10.0.3",
|
||||
"micromatch": "4.0.5",
|
||||
"msw": "1.3.2",
|
||||
"msw-storybook-addon": "1.9.0",
|
||||
"msw-storybook-addon": "1.10.0",
|
||||
"nodemon": "3.0.1",
|
||||
"prettier": "3.0.3",
|
||||
"react": "18.2.0",
|
||||
"react-dom": "18.2.0",
|
||||
"start-server-and-test": "2.0.1",
|
||||
"storybook": "7.5.1",
|
||||
"storybook": "7.5.2",
|
||||
"storybook-addon-misskey-theme": "github:misskey-dev/storybook-addon-misskey-theme",
|
||||
"summaly": "github:misskey-dev/summaly",
|
||||
"vite-plugin-turbosnap": "1.0.3",
|
||||
"vitest": "0.34.6",
|
||||
"vitest-fetch-mock": "0.2.2",
|
||||
"vue-eslint-parser": "9.3.2",
|
||||
"vue-tsc": "1.8.19"
|
||||
"vue-tsc": "1.8.22"
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -175,7 +175,7 @@ export async function common(createVue: () => App<Element>) {
|
|||
defaultStore.set('darkMode', isDeviceDarkmode());
|
||||
}
|
||||
|
||||
window.matchMedia('(prefers-color-scheme: dark)').addListener(mql => {
|
||||
window.matchMedia('(prefers-color-scheme: dark)').addEventListener('change', (mql) => {
|
||||
if (ColdDeviceStorage.get('syncDeviceDarkMode')) {
|
||||
defaultStore.set('darkMode', mql.matches);
|
||||
}
|
||||
|
|
|
|||
|
|
@ -8,7 +8,7 @@ import { common } from './common.js';
|
|||
import { version, ui, lang, updateLocale } from '@/config.js';
|
||||
import { i18n, updateI18n } from '@/i18n.js';
|
||||
import { confirm, alert, post, popup, toast } from '@/os.js';
|
||||
import { useStream } from '@/stream.js';
|
||||
import { useStream, isReloading } from '@/stream.js';
|
||||
import * as sound from '@/scripts/sound.js';
|
||||
import { $i, refreshAccount, login, updateAccount, signout } from '@/account.js';
|
||||
import { defaultStore, ColdDeviceStorage } from '@/store.js';
|
||||
|
|
@ -39,6 +39,7 @@ export async function mainBoot() {
|
|||
|
||||
let reloadDialogShowing = false;
|
||||
stream.on('_disconnected_', async () => {
|
||||
if (isReloading) return;
|
||||
if (defaultStore.state.serverDisconnectedBehavior === 'reload') {
|
||||
location.reload();
|
||||
} else if (defaultStore.state.serverDisconnectedBehavior === 'dialog') {
|
||||
|
|
@ -225,11 +226,18 @@ export async function mainBoot() {
|
|||
});
|
||||
|
||||
main.on('readAllNotifications', () => {
|
||||
updateAccount({ hasUnreadNotification: false });
|
||||
updateAccount({
|
||||
hasUnreadNotification: false,
|
||||
unreadNotificationsCount: 0,
|
||||
});
|
||||
});
|
||||
|
||||
main.on('unreadNotification', () => {
|
||||
updateAccount({ hasUnreadNotification: true });
|
||||
const unreadNotificationsCount = ($i?.unreadNotificationsCount ?? 0) + 1;
|
||||
updateAccount({
|
||||
hasUnreadNotification: true,
|
||||
unreadNotificationsCount,
|
||||
});
|
||||
});
|
||||
|
||||
main.on('unreadMention', () => {
|
||||
|
|
|
|||
|
|
@ -5,21 +5,90 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<!-- eslint-disable vue/no-v-html -->
|
||||
<template>
|
||||
<code v-if="inline" :class="`language-${prismLang}`" style="overflow-wrap: anywhere;" v-html="html"></code>
|
||||
<pre v-else :class="`language-${prismLang}`"><code :class="`language-${prismLang}`" v-html="html"></code></pre>
|
||||
<div :class="['codeBlockRoot', { 'codeEditor': codeEditor }]" v-html="html"></div>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed } from 'vue';
|
||||
import Prism from 'prismjs';
|
||||
import 'prismjs/themes/prism-okaidia.css';
|
||||
import { ref, computed, watch } from 'vue';
|
||||
import { BUNDLED_LANGUAGES } from 'shiki';
|
||||
import type { Lang as ShikiLang } from 'shiki';
|
||||
import { getHighlighter } from '@/scripts/code-highlighter.js';
|
||||
|
||||
const props = defineProps<{
|
||||
code: string;
|
||||
lang?: string;
|
||||
inline?: boolean;
|
||||
codeEditor?: boolean;
|
||||
}>();
|
||||
|
||||
const prismLang = computed(() => Prism.languages[props.lang] ? props.lang : 'js');
|
||||
const html = computed(() => Prism.highlight(props.code, Prism.languages[prismLang.value], prismLang.value));
|
||||
const highlighter = await getHighlighter();
|
||||
|
||||
const codeLang = ref<ShikiLang | 'aiscript'>('js');
|
||||
const html = computed(() => highlighter.codeToHtml(props.code, {
|
||||
lang: codeLang.value,
|
||||
theme: 'dark-plus',
|
||||
}));
|
||||
|
||||
async function fetchLanguage(to: string): Promise<void> {
|
||||
const language = to as ShikiLang;
|
||||
|
||||
// Check for the loaded languages, and load the language if it's not loaded yet.
|
||||
if (!highlighter.getLoadedLanguages().includes(language)) {
|
||||
// Check if the language is supported by Shiki
|
||||
const bundles = BUNDLED_LANGUAGES.filter((bundle) => {
|
||||
// Languages are specified by their id, they can also have aliases (i. e. "js" and "javascript")
|
||||
return bundle.id === language || bundle.aliases?.includes(language);
|
||||
});
|
||||
if (bundles.length > 0) {
|
||||
await highlighter.loadLanguage(language);
|
||||
codeLang.value = language;
|
||||
} else {
|
||||
codeLang.value = 'js';
|
||||
}
|
||||
} else {
|
||||
codeLang.value = language;
|
||||
}
|
||||
}
|
||||
|
||||
watch(() => props.lang, (to) => {
|
||||
if (codeLang.value === to || !to) return;
|
||||
return new Promise((resolve) => {
|
||||
fetchLanguage(to).then(() => resolve);
|
||||
});
|
||||
}, { immediate: true, });
|
||||
</script>
|
||||
|
||||
<style scoped lang="scss">
|
||||
.codeBlockRoot :deep(.shiki) {
|
||||
padding: 1em;
|
||||
margin: .5em 0;
|
||||
overflow: auto;
|
||||
border-radius: .3em;
|
||||
|
||||
& pre,
|
||||
& code {
|
||||
font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
|
||||
}
|
||||
}
|
||||
|
||||
.codeBlockRoot.codeEditor {
|
||||
min-width: 100%;
|
||||
height: 100%;
|
||||
|
||||
& :deep(.shiki) {
|
||||
padding: 12px;
|
||||
margin: 0;
|
||||
border-radius: 6px;
|
||||
min-height: 130px;
|
||||
pointer-events: none;
|
||||
min-width: calc(100% - 24px);
|
||||
height: 100%;
|
||||
display: inline-block;
|
||||
line-height: 1.5em;
|
||||
font-size: 1em;
|
||||
overflow: visible;
|
||||
text-rendering: inherit;
|
||||
text-transform: inherit;
|
||||
white-space: pre;
|
||||
}
|
||||
}
|
||||
</style>
|
||||
|
|
|
|||
|
|
@ -4,11 +4,18 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<XCode :code="code" :lang="lang" :inline="inline"/>
|
||||
<Suspense>
|
||||
<template #fallback>
|
||||
<MkLoading v-if="!inline ?? true" />
|
||||
</template>
|
||||
<code v-if="inline" :class="$style.codeInlineRoot">{{ code }}</code>
|
||||
<XCode v-else :code="code" :lang="lang"/>
|
||||
</Suspense>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { defineAsyncComponent } from 'vue';
|
||||
import MkLoading from '@/components/global/MkLoading.vue';
|
||||
|
||||
defineProps<{
|
||||
code: string;
|
||||
|
|
@ -18,3 +25,15 @@ defineProps<{
|
|||
|
||||
const XCode = defineAsyncComponent(() => import('@/components/MkCode.core.vue'));
|
||||
</script>
|
||||
|
||||
<style module lang="scss">
|
||||
.codeInlineRoot {
|
||||
display: inline-block;
|
||||
font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
|
||||
overflow-wrap: anywhere;
|
||||
color: #D4D4D4;
|
||||
background: #1E1E1E;
|
||||
padding: .1em;
|
||||
border-radius: .3em;
|
||||
}
|
||||
</style>
|
||||
|
|
|
|||
166
packages/frontend/src/components/MkCodeEditor.vue
Normal file
166
packages/frontend/src/components/MkCodeEditor.vue
Normal file
|
|
@ -0,0 +1,166 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div :class="[$style.codeEditorRoot, { [$style.disabled]: disabled, [$style.focused]: focused }]">
|
||||
<div :class="$style.codeEditorScroller">
|
||||
<textarea
|
||||
ref="inputEl"
|
||||
v-model="vModel"
|
||||
:class="[$style.textarea]"
|
||||
:disabled="disabled"
|
||||
:required="required"
|
||||
:readonly="readonly"
|
||||
autocomplete="off"
|
||||
wrap="off"
|
||||
spellcheck="false"
|
||||
@focus="focused = true"
|
||||
@blur="focused = false"
|
||||
@keydown="onKeydown($event)"
|
||||
@input="onInput"
|
||||
></textarea>
|
||||
<XCode :class="$style.codeEditorHighlighter" :codeEditor="true" :code="v" :lang="lang"/>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { ref, watch, toRefs, shallowRef, nextTick } from 'vue';
|
||||
import XCode from '@/components/MkCode.core.vue';
|
||||
|
||||
const props = withDefaults(defineProps<{
|
||||
modelValue: string | null;
|
||||
lang: string;
|
||||
required?: boolean;
|
||||
readonly?: boolean;
|
||||
disabled?: boolean;
|
||||
}>(), {
|
||||
lang: 'js',
|
||||
});
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'change', _ev: KeyboardEvent): void;
|
||||
(ev: 'keydown', _ev: KeyboardEvent): void;
|
||||
(ev: 'enter'): void;
|
||||
(ev: 'update:modelValue', value: string): void;
|
||||
}>();
|
||||
|
||||
const { modelValue } = toRefs(props);
|
||||
const vModel = ref<string>(modelValue.value ?? '');
|
||||
const v = ref<string>(modelValue.value ?? '');
|
||||
const focused = ref(false);
|
||||
const changed = ref(false);
|
||||
const inputEl = shallowRef<HTMLTextAreaElement>();
|
||||
|
||||
const onInput = (ev) => {
|
||||
v.value = ev.target?.value ?? v.value;
|
||||
changed.value = true;
|
||||
emit('change', ev);
|
||||
};
|
||||
|
||||
const onKeydown = (ev: KeyboardEvent) => {
|
||||
if (ev.isComposing || ev.key === 'Process' || ev.keyCode === 229) return;
|
||||
|
||||
emit('keydown', ev);
|
||||
|
||||
if (ev.code === 'Enter') {
|
||||
const pos = inputEl.value?.selectionStart ?? 0;
|
||||
const posEnd = inputEl.value?.selectionEnd ?? vModel.value.length;
|
||||
if (pos === posEnd) {
|
||||
const lines = vModel.value.slice(0, pos).split('\n');
|
||||
const currentLine = lines[lines.length - 1];
|
||||
const currentLineSpaces = currentLine.match(/^\s+/);
|
||||
const posDelta = currentLineSpaces ? currentLineSpaces[0].length : 0;
|
||||
ev.preventDefault();
|
||||
vModel.value = vModel.value.slice(0, pos) + '\n' + (currentLineSpaces ? currentLineSpaces[0] : '') + vModel.value.slice(pos);
|
||||
v.value = vModel.value;
|
||||
nextTick(() => {
|
||||
inputEl.value?.setSelectionRange(pos + 1 + posDelta, pos + 1 + posDelta);
|
||||
});
|
||||
}
|
||||
emit('enter');
|
||||
}
|
||||
|
||||
if (ev.key === 'Tab') {
|
||||
const pos = inputEl.value?.selectionStart ?? 0;
|
||||
const posEnd = inputEl.value?.selectionEnd ?? vModel.value.length;
|
||||
vModel.value = vModel.value.slice(0, pos) + '\t' + vModel.value.slice(posEnd);
|
||||
v.value = vModel.value;
|
||||
nextTick(() => {
|
||||
inputEl.value?.setSelectionRange(pos + 1, pos + 1);
|
||||
});
|
||||
ev.preventDefault();
|
||||
}
|
||||
};
|
||||
|
||||
const updated = () => {
|
||||
changed.value = false;
|
||||
emit('update:modelValue', v.value);
|
||||
};
|
||||
|
||||
watch(modelValue, newValue => {
|
||||
v.value = newValue ?? '';
|
||||
});
|
||||
|
||||
watch(v, () => {
|
||||
updated();
|
||||
});
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.codeEditorRoot {
|
||||
min-width: 100%;
|
||||
max-width: 100%;
|
||||
overflow-x: auto;
|
||||
overflow-y: hidden;
|
||||
box-sizing: border-box;
|
||||
margin: 0;
|
||||
padding: 0;
|
||||
color: var(--fg);
|
||||
border: solid 1px var(--panel);
|
||||
transition: border-color 0.1s ease-out;
|
||||
font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
|
||||
&:hover {
|
||||
border-color: var(--inputBorderHover) !important;
|
||||
}
|
||||
}
|
||||
|
||||
.focused.codeEditorRoot {
|
||||
border-color: var(--accent) !important;
|
||||
border-radius: 6px;
|
||||
}
|
||||
|
||||
.codeEditorScroller {
|
||||
position: relative;
|
||||
display: inline-block;
|
||||
min-width: 100%;
|
||||
height: 100%;
|
||||
}
|
||||
|
||||
.textarea {
|
||||
position: absolute;
|
||||
top: 0;
|
||||
left: 0;
|
||||
right: 0;
|
||||
bottom: 0;
|
||||
display: inline-block;
|
||||
appearance: none;
|
||||
resize: none;
|
||||
text-align: left;
|
||||
color: transparent;
|
||||
caret-color: rgb(225, 228, 232);
|
||||
background-color: transparent;
|
||||
border: 0;
|
||||
outline: 0;
|
||||
padding: 12px;
|
||||
line-height: 1.5em;
|
||||
font-size: 1em;
|
||||
font-family: Consolas, Monaco, Andale Mono, Ubuntu Mono, monospace;
|
||||
}
|
||||
|
||||
.textarea::selection {
|
||||
color: #fff;
|
||||
}
|
||||
</style>
|
||||
|
|
@ -42,6 +42,7 @@ export default defineComponent({
|
|||
|
||||
setup(props, { slots, expose }) {
|
||||
const $style = useCssModule(); // カスタムレンダラなので使っても大丈夫
|
||||
|
||||
function getDateText(time: string) {
|
||||
const date = new Date(time).getDate();
|
||||
const month = new Date(time).getMonth() + 1;
|
||||
|
|
@ -121,6 +122,7 @@ export default defineComponent({
|
|||
el.style.top = `${el.offsetTop}px`;
|
||||
el.style.left = `${el.offsetLeft}px`;
|
||||
}
|
||||
|
||||
function onLeaveCanceled(el: HTMLElement) {
|
||||
el.style.top = '';
|
||||
el.style.left = '';
|
||||
|
|
|
|||
|
|
@ -160,6 +160,7 @@ async function ok() {
|
|||
function cancel() {
|
||||
done(true);
|
||||
}
|
||||
|
||||
/*
|
||||
function onBgClick() {
|
||||
if (props.cancelableByBgClick) cancel();
|
||||
|
|
|
|||
|
|
@ -47,6 +47,7 @@ import { i18n } from '@/i18n.js';
|
|||
import { $i } from '@/account.js';
|
||||
import { useRouter } from '@/router.js';
|
||||
import { getDriveFileMenu } from '@/scripts/get-drive-file-menu.js';
|
||||
import { deviceKind } from '@/scripts/device-kind.js';
|
||||
|
||||
const router = useRouter();
|
||||
|
||||
|
|
@ -74,7 +75,11 @@ function onClick(ev: MouseEvent) {
|
|||
if (props.selectMode) {
|
||||
emit('chosen', props.file);
|
||||
} else {
|
||||
router.push(`/my/drive/file/${props.file.id}`);
|
||||
if (deviceKind === 'desktop') {
|
||||
router.push(`/my/drive/file/${props.file.id}`);
|
||||
} else {
|
||||
os.popupMenu(getDriveFileMenu(props.file, props.folder), (ev.currentTarget ?? ev.target ?? undefined) as HTMLElement | undefined);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -505,6 +505,7 @@ function appendFile(file: Misskey.entities.DriveFile) {
|
|||
function appendFolder(folderToAppend: Misskey.entities.DriveFolder) {
|
||||
addFolder(folderToAppend);
|
||||
}
|
||||
|
||||
/*
|
||||
function prependFile(file: Misskey.entities.DriveFile) {
|
||||
addFile(file, true);
|
||||
|
|
|
|||
|
|
@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<div class="omfetrab" :class="['s' + size, 'w' + width, 'h' + height, { asDrawer, asWindow }]" :style="{ maxHeight: maxHeight ? maxHeight + 'px' : undefined }">
|
||||
<input ref="searchEl" :value="q" class="search" data-prevent-emoji-insert :class="{ filled: q != null && q != '' }" :placeholder="i18n.ts.search" type="search" @input="input()" @paste.stop="paste" @keydown.stop.prevent.enter="onEnter">
|
||||
<input ref="searchEl" :value="q" class="search" data-prevent-emoji-insert :class="{ filled: q != null && q != '' }" :placeholder="i18n.ts.search" type="search" autocapitalize="off" @input="input()" @paste.stop="paste" @keydown.stop.prevent.enter="onEnter">
|
||||
<!-- FirefoxのTabフォーカスが想定外の挙動となるためtabindex="-1"を追加 https://github.com/misskey-dev/misskey/issues/10744 -->
|
||||
<div ref="emojisEl" class="emojis" tabindex="-1">
|
||||
<section class="result">
|
||||
|
|
|
|||
|
|
@ -84,6 +84,7 @@ onMounted(() => {
|
|||
return getParentBg(el.parentElement);
|
||||
}
|
||||
}
|
||||
|
||||
const rawBg = getParentBg(el.value);
|
||||
const _bg = tinycolor(rawBg.startsWith('var(') ? getComputedStyle(document.documentElement).getPropertyValue(rawBg.slice(4, -1)) : rawBg);
|
||||
_bg.setAlpha(0.85);
|
||||
|
|
|
|||
|
|
@ -21,7 +21,9 @@ const props = defineProps<{
|
|||
const query = ref(props.q);
|
||||
|
||||
const search = () => {
|
||||
window.open(`https://www.google.com/search?q=${query.value}`, '_blank');
|
||||
const sp = new URLSearchParams();
|
||||
sp.append('q', query.value);
|
||||
window.open(`https://www.google.com/search?${sp.toString()}`, '_blank');
|
||||
};
|
||||
</script>
|
||||
|
||||
|
|
|
|||
|
|
@ -7,7 +7,8 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div :class="[$style.root, { [$style.warn]: warn }]">
|
||||
<i v-if="warn" class="ti ti-alert-triangle" :class="$style.i"></i>
|
||||
<i v-else class="ti ti-info-circle" :class="$style.i"></i>
|
||||
<slot></slot>
|
||||
<div><slot></slot></div>
|
||||
<button v-if="closable" :class="$style.button" class="_button" @click="close()"><i class="ti ti-x"></i></button>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
|
|
@ -16,11 +17,23 @@ import { } from 'vue';
|
|||
|
||||
const props = defineProps<{
|
||||
warn?: boolean;
|
||||
closable?: boolean;
|
||||
}>();
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'close'): void;
|
||||
}>();
|
||||
|
||||
function close() {
|
||||
// こいつの中では非表示動作は行わない
|
||||
emit('close');
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.root {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
padding: 12px 14px;
|
||||
font-size: 90%;
|
||||
background: var(--infoBg);
|
||||
|
|
@ -37,4 +50,9 @@ const props = defineProps<{
|
|||
.i {
|
||||
margin-right: 4px;
|
||||
}
|
||||
|
||||
.button {
|
||||
margin-left: auto;
|
||||
padding: 4px;
|
||||
}
|
||||
</style>
|
||||
|
|
|
|||
|
|
@ -20,6 +20,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
:placeholder="placeholder"
|
||||
:pattern="pattern"
|
||||
:autocomplete="autocomplete"
|
||||
:autocapitalize="autocapitalize"
|
||||
:spellcheck="spellcheck"
|
||||
:step="step"
|
||||
:list="id"
|
||||
|
|
@ -58,6 +59,7 @@ const props = defineProps<{
|
|||
placeholder?: string;
|
||||
autofocus?: boolean;
|
||||
autocomplete?: string;
|
||||
autocapitalize?: string;
|
||||
spellcheck?: boolean;
|
||||
step?: any;
|
||||
datalist?: string[];
|
||||
|
|
|
|||
|
|
@ -7,16 +7,18 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkModal ref="modal" v-slot="{ type, maxHeight }" :preferType="preferedModalType" :anchor="anchor" :transparentBg="true" :src="src" @click="modal.close()" @closed="emit('closed')">
|
||||
<div class="szkkfdyq _popup _shadow" :class="{ asDrawer: type === 'drawer' }" :style="{ maxHeight: maxHeight ? maxHeight + 'px' : '' }">
|
||||
<div class="main">
|
||||
<template v-for="item in items">
|
||||
<template v-for="item in items" :key="item.text">
|
||||
<button v-if="item.action" v-click-anime class="_button item" @click="$event => { item.action($event); close(); }">
|
||||
<i class="icon" :class="item.icon"></i>
|
||||
<div class="text">{{ item.text }}</div>
|
||||
<span v-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
|
||||
<span v-if="item.indicate && item.indicateValue" class="_indicateCounter indicatorWithValue">{{ item.indicateValue }}</span>
|
||||
<span v-else-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
|
||||
</button>
|
||||
<MkA v-else v-click-anime :to="item.to" class="item" @click.passive="close()">
|
||||
<i class="icon" :class="item.icon"></i>
|
||||
<div class="text">{{ item.text }}</div>
|
||||
<span v-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
|
||||
<span v-if="item.indicate && item.indicateValue" class="_indicateCounter indicatorWithValue">{{ item.indicateValue }}</span>
|
||||
<span v-else-if="item.indicate" class="indicator"><i class="_indicatorCircle"></i></span>
|
||||
</MkA>
|
||||
</template>
|
||||
</div>
|
||||
|
|
@ -27,7 +29,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<script lang="ts" setup>
|
||||
import { } from 'vue';
|
||||
import MkModal from '@/components/MkModal.vue';
|
||||
import { navbarItemDef } from '@/navbar';
|
||||
import { navbarItemDef } from '@/navbar.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
import { deviceKind } from '@/scripts/device-kind.js';
|
||||
|
||||
|
|
@ -57,6 +59,7 @@ const items = Object.keys(navbarItemDef).filter(k => !menu.includes(k)).map(k =>
|
|||
to: def.to,
|
||||
action: def.action,
|
||||
indicate: def.indicated,
|
||||
indicateValue: def.indicateValue,
|
||||
}));
|
||||
|
||||
function close() {
|
||||
|
|
@ -116,6 +119,17 @@ function close() {
|
|||
line-height: 1.5em;
|
||||
}
|
||||
|
||||
> .indicatorWithValue {
|
||||
position: absolute;
|
||||
top: 32px;
|
||||
left: 16px;
|
||||
|
||||
@media (max-width: 500px) {
|
||||
top: 16px;
|
||||
left: 8px;
|
||||
}
|
||||
}
|
||||
|
||||
> .indicator {
|
||||
position: absolute;
|
||||
top: 32px;
|
||||
|
|
|
|||
|
|
@ -34,7 +34,6 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<script lang="ts" setup>
|
||||
import { onMounted, shallowRef, watch } from 'vue';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { soundConfigStore } from '@/scripts/sound.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
|
||||
const props = withDefaults(defineProps<{
|
||||
|
|
|
|||
|
|
@ -145,11 +145,13 @@ const onGlobalMousedown = (event: MouseEvent) => {
|
|||
};
|
||||
|
||||
let childCloseTimer: null | number = null;
|
||||
|
||||
function onItemMouseEnter(item) {
|
||||
childCloseTimer = window.setTimeout(() => {
|
||||
closeChild();
|
||||
}, 300);
|
||||
}
|
||||
|
||||
function onItemMouseLeave(item) {
|
||||
if (childCloseTimer) window.clearTimeout(childCloseTimer);
|
||||
}
|
||||
|
|
|
|||
|
|
@ -43,29 +43,38 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
<div v-if="renoteCollapsed" :class="$style.collapsedRenoteTarget">
|
||||
<MkAvatar :class="$style.collapsedRenoteTargetAvatar" :user="appearNote.user" link preview/>
|
||||
<Mfm :text="getNoteSummary(appearNote)" :plain="true" :nowrap="true" :author="appearNote.user" :class="$style.collapsedRenoteTargetText" @click="renoteCollapsed = false"/>
|
||||
<Mfm :text="getNoteSummary(appearNote)" :plain="true" :nowrap="true" :author="appearNote.user" :nyaize="'account'" :class="$style.collapsedRenoteTargetText" @click="renoteCollapsed = false"/>
|
||||
</div>
|
||||
<article v-else :class="$style.article" @contextmenu.stop="onContextmenu">
|
||||
<div v-if="appearNote.channel" :class="$style.colorBar" :style="{ background: appearNote.channel.color }"></div>
|
||||
<MkAvatar :class="$style.avatar" :user="appearNote.user" link preview/>
|
||||
<MkAvatar :class="$style.avatar" :user="appearNote.user" :link="!mock" :preview="!mock"/>
|
||||
<div :class="$style.main">
|
||||
<MkNoteHeader :note="appearNote" :mini="true"/>
|
||||
<MkInstanceTicker v-if="showTicker" :instance="appearNote.user.instance"/>
|
||||
<div style="container-type: inline-size;">
|
||||
<p v-if="appearNote.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :i="$i"/>
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="appearNote" style="margin: 4px 0;"/>
|
||||
</p>
|
||||
<div v-show="appearNote.cw == null || showContent" :class="[{ [$style.contentCollapsed]: collapsed }]">
|
||||
<div :class="$style.text">
|
||||
<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<MkA v-if="appearNote.replyId" :class="$style.replyIcon" :to="`/notes/${appearNote.replyId}`"><i class="ti ti-arrow-back-up"></i></MkA>
|
||||
<Mfm v-if="appearNote.text" :text="appearNote.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm
|
||||
v-if="appearNote.text"
|
||||
:parsedNodes="parsed"
|
||||
:text="appearNote.text"
|
||||
:author="appearNote.user"
|
||||
:nyaize="'account'"
|
||||
:emojiUrls="appearNote.emojis"
|
||||
:enableEmojiMenu="true"
|
||||
:enableEmojiMenuReaction="true"
|
||||
/>
|
||||
<div v-if="translating || translation" :class="$style.translation">
|
||||
<MkLoading v-if="translating" mini/>
|
||||
<div v-else>
|
||||
<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
|
@ -84,7 +93,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
<MkA v-if="appearNote.channel && !inChannel" :class="$style.channel" :to="`/channels/${appearNote.channel.id}`"><i class="ti ti-device-tv"></i> {{ appearNote.channel.name }}</MkA>
|
||||
</div>
|
||||
<MkReactionsViewer :note="appearNote" :maxNumber="16">
|
||||
<MkReactionsViewer :note="appearNote" :maxNumber="16" @mockUpdateMyReaction="emitUpdReaction">
|
||||
<template #more>
|
||||
<div :class="$style.reactionOmitted">{{ i18n.ts.more }}</div>
|
||||
</template>
|
||||
|
|
@ -136,7 +145,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed, inject, onMounted, ref, shallowRef, Ref, defineAsyncComponent } from 'vue';
|
||||
import { computed, inject, onMounted, ref, shallowRef, Ref, defineAsyncComponent, watch, provide } from 'vue';
|
||||
import * as mfm from 'mfm-js';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import MkNoteSub from '@/components/MkNoteSub.vue';
|
||||
|
|
@ -159,7 +168,7 @@ import { reactionPicker } from '@/scripts/reaction-picker.js';
|
|||
import { extractUrlFromMfm } from '@/scripts/extract-url-from-mfm.js';
|
||||
import { $i } from '@/account.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { getAbuseNoteMenu, getCopyNoteLinkMenu, getNoteClipMenu, getNoteMenu } from '@/scripts/get-note-menu.js';
|
||||
import { getAbuseNoteMenu, getCopyNoteLinkMenu, getNoteClipMenu, getNoteMenu, getRenoteMenu } from '@/scripts/get-note-menu.js';
|
||||
import { useNoteCapture } from '@/scripts/use-note-capture.js';
|
||||
import { deepClone } from '@/scripts/clone.js';
|
||||
import { useTooltip } from '@/scripts/use-tooltip.js';
|
||||
|
|
@ -170,9 +179,19 @@ import MkRippleEffect from '@/components/MkRippleEffect.vue';
|
|||
import { showMovedDialog } from '@/scripts/show-moved-dialog.js';
|
||||
import { shouldCollapsed } from '@/scripts/collapsed.js';
|
||||
|
||||
const props = defineProps<{
|
||||
const props = withDefaults(defineProps<{
|
||||
note: Misskey.entities.Note;
|
||||
pinned?: boolean;
|
||||
mock?: boolean;
|
||||
}>(), {
|
||||
mock: false,
|
||||
});
|
||||
|
||||
provide('mock', props.mock);
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'reaction', emoji: string): void;
|
||||
(ev: 'removeReaction', emoji: string): void;
|
||||
}>();
|
||||
|
||||
const inChannel = inject('inChannel', null);
|
||||
|
|
@ -183,9 +202,11 @@ let note = $ref(deepClone(props.note));
|
|||
// plugin
|
||||
if (noteViewInterruptors.length > 0) {
|
||||
onMounted(async () => {
|
||||
let result = deepClone(note);
|
||||
let result:Misskey.entities.Note | null = deepClone(note);
|
||||
for (const interruptor of noteViewInterruptors) {
|
||||
result = await interruptor.handler(result);
|
||||
|
||||
if (result === null) return isDeleted.value = true;
|
||||
}
|
||||
note = result;
|
||||
});
|
||||
|
|
@ -207,8 +228,9 @@ const clipButton = shallowRef<HTMLElement>();
|
|||
let appearNote = $computed(() => isRenote ? note.renote as Misskey.entities.Note : note);
|
||||
const isMyRenote = $i && ($i.id === note.userId);
|
||||
const showContent = ref(false);
|
||||
const urls = appearNote.text ? extractUrlFromMfm(mfm.parse(appearNote.text)) : null;
|
||||
const isLong = shouldCollapsed(appearNote);
|
||||
const parsed = appearNote.text ? mfm.parse(appearNote.text) : null;
|
||||
const urls = parsed ? extractUrlFromMfm(parsed) : null;
|
||||
const isLong = shouldCollapsed(appearNote, urls ?? []);
|
||||
const collapsed = ref(appearNote.cw == null && isLong);
|
||||
const isDeleted = ref(false);
|
||||
const muted = ref($i ? checkWordMute(appearNote, $i, $i.mutedWords) : false);
|
||||
|
|
@ -229,126 +251,61 @@ const keymap = {
|
|||
's': () => showContent.value !== showContent.value,
|
||||
};
|
||||
|
||||
useNoteCapture({
|
||||
rootEl: el,
|
||||
note: $$(appearNote),
|
||||
pureNote: $$(note),
|
||||
isDeletedRef: isDeleted,
|
||||
});
|
||||
|
||||
useTooltip(renoteButton, async (showing) => {
|
||||
const renotes = await os.api('notes/renotes', {
|
||||
provide('react', (reaction: string) => {
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: appearNote.id,
|
||||
limit: 11,
|
||||
reaction: reaction,
|
||||
});
|
||||
|
||||
const users = renotes.map(x => x.user);
|
||||
|
||||
if (users.length < 1) return;
|
||||
|
||||
os.popup(MkUsersTooltip, {
|
||||
showing,
|
||||
users,
|
||||
count: appearNote.renoteCount,
|
||||
targetElement: renoteButton.value,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
|
||||
type Visibility = 'public' | 'home' | 'followers' | 'specified';
|
||||
if (props.mock) {
|
||||
watch(() => props.note, (to) => {
|
||||
note = deepClone(to);
|
||||
}, { deep: true });
|
||||
} else {
|
||||
useNoteCapture({
|
||||
rootEl: el,
|
||||
note: $$(appearNote),
|
||||
pureNote: $$(note),
|
||||
isDeletedRef: isDeleted,
|
||||
});
|
||||
}
|
||||
|
||||
// defaultStore.state.visibilityがstringなためstringも受け付けている
|
||||
function smallerVisibility(a: Visibility | string, b: Visibility | string): Visibility {
|
||||
if (a === 'specified' || b === 'specified') return 'specified';
|
||||
if (a === 'followers' || b === 'followers') return 'followers';
|
||||
if (a === 'home' || b === 'home') return 'home';
|
||||
// if (a === 'public' || b === 'public')
|
||||
return 'public';
|
||||
if (!props.mock) {
|
||||
useTooltip(renoteButton, async (showing) => {
|
||||
const renotes = await os.api('notes/renotes', {
|
||||
noteId: appearNote.id,
|
||||
limit: 11,
|
||||
});
|
||||
|
||||
const users = renotes.map(x => x.user);
|
||||
|
||||
if (users.length < 1) return;
|
||||
|
||||
os.popup(MkUsersTooltip, {
|
||||
showing,
|
||||
users,
|
||||
count: appearNote.renoteCount,
|
||||
targetElement: renoteButton.value,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
}
|
||||
|
||||
function renote(viaKeyboard = false) {
|
||||
pleaseLogin();
|
||||
showMovedDialog();
|
||||
|
||||
let items = [] as MenuItem[];
|
||||
|
||||
if (appearNote.channel) {
|
||||
items = items.concat([{
|
||||
text: i18n.ts.inChannelRenote,
|
||||
icon: 'ti ti-repeat',
|
||||
action: () => {
|
||||
const el = renoteButton.value as HTMLElement | null | undefined;
|
||||
if (el) {
|
||||
const rect = el.getBoundingClientRect();
|
||||
const x = rect.left + (el.offsetWidth / 2);
|
||||
const y = rect.top + (el.offsetHeight / 2);
|
||||
os.popup(MkRippleEffect, { x, y }, {}, 'end');
|
||||
}
|
||||
|
||||
os.api('notes/create', {
|
||||
renoteId: appearNote.id,
|
||||
channelId: appearNote.channelId,
|
||||
}).then(() => {
|
||||
os.toast(i18n.ts.renoted);
|
||||
});
|
||||
},
|
||||
}, {
|
||||
text: i18n.ts.inChannelQuote,
|
||||
icon: 'ti ti-quote',
|
||||
action: () => {
|
||||
os.post({
|
||||
renote: appearNote,
|
||||
channel: appearNote.channel,
|
||||
});
|
||||
},
|
||||
}, null]);
|
||||
}
|
||||
|
||||
items = items.concat([{
|
||||
text: i18n.ts.renote,
|
||||
icon: 'ti ti-repeat',
|
||||
action: () => {
|
||||
const el = renoteButton.value as HTMLElement | null | undefined;
|
||||
if (el) {
|
||||
const rect = el.getBoundingClientRect();
|
||||
const x = rect.left + (el.offsetWidth / 2);
|
||||
const y = rect.top + (el.offsetHeight / 2);
|
||||
os.popup(MkRippleEffect, { x, y }, {}, 'end');
|
||||
}
|
||||
|
||||
const configuredVisibility = defaultStore.state.rememberNoteVisibility ? defaultStore.state.visibility : defaultStore.state.defaultNoteVisibility;
|
||||
const localOnly = defaultStore.state.rememberNoteVisibility ? defaultStore.state.localOnly : defaultStore.state.defaultNoteLocalOnly;
|
||||
|
||||
let visibility = appearNote.visibility;
|
||||
visibility = smallerVisibility(visibility, configuredVisibility);
|
||||
if (appearNote.channel?.isSensitive) {
|
||||
visibility = smallerVisibility(visibility, 'home');
|
||||
}
|
||||
|
||||
os.api('notes/create', {
|
||||
localOnly,
|
||||
visibility,
|
||||
renoteId: appearNote.id,
|
||||
}).then(() => {
|
||||
os.toast(i18n.ts.renoted);
|
||||
});
|
||||
},
|
||||
}, {
|
||||
text: i18n.ts.quote,
|
||||
icon: 'ti ti-quote',
|
||||
action: () => {
|
||||
os.post({
|
||||
renote: appearNote,
|
||||
});
|
||||
},
|
||||
}]);
|
||||
|
||||
os.popupMenu(items, renoteButton.value, {
|
||||
const { menu } = getRenoteMenu({ note: note, renoteButton, mock: props.mock });
|
||||
os.popupMenu(menu, renoteButton.value, {
|
||||
viaKeyboard,
|
||||
});
|
||||
}).then(focus);
|
||||
}
|
||||
|
||||
function reply(viaKeyboard = false): void {
|
||||
pleaseLogin();
|
||||
if (props.mock) {
|
||||
return;
|
||||
}
|
||||
os.post({
|
||||
reply: appearNote,
|
||||
channel: appearNote.channel,
|
||||
|
|
@ -362,6 +319,10 @@ function react(viaKeyboard = false): void {
|
|||
pleaseLogin();
|
||||
showMovedDialog();
|
||||
if (appearNote.reactionAcceptance === 'likeOnly') {
|
||||
if (props.mock) {
|
||||
return;
|
||||
}
|
||||
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: appearNote.id,
|
||||
reaction: '❤️',
|
||||
|
|
@ -376,6 +337,11 @@ function react(viaKeyboard = false): void {
|
|||
} else {
|
||||
blur();
|
||||
reactionPicker.show(reactButton.value, reaction => {
|
||||
if (props.mock) {
|
||||
emit('reaction', reaction);
|
||||
return;
|
||||
}
|
||||
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: appearNote.id,
|
||||
reaction: reaction,
|
||||
|
|
@ -392,12 +358,22 @@ function react(viaKeyboard = false): void {
|
|||
function undoReact(note): void {
|
||||
const oldReaction = note.myReaction;
|
||||
if (!oldReaction) return;
|
||||
|
||||
if (props.mock) {
|
||||
emit('removeReaction', oldReaction);
|
||||
return;
|
||||
}
|
||||
|
||||
os.api('notes/reactions/delete', {
|
||||
noteId: note.id,
|
||||
});
|
||||
}
|
||||
|
||||
function onContextmenu(ev: MouseEvent): void {
|
||||
if (props.mock) {
|
||||
return;
|
||||
}
|
||||
|
||||
const isLink = (el: HTMLElement) => {
|
||||
if (el.tagName === 'A') return true;
|
||||
// 再生速度の選択などのために、Audio要素のコンテキストメニューはブラウザデフォルトとする。
|
||||
|
|
@ -419,6 +395,10 @@ function onContextmenu(ev: MouseEvent): void {
|
|||
}
|
||||
|
||||
function menu(viaKeyboard = false): void {
|
||||
if (props.mock) {
|
||||
return;
|
||||
}
|
||||
|
||||
const { menu, cleanup } = getNoteMenu({ note: note, translating, translation, menuButton, isDeleted, currentClip: currentClip?.value });
|
||||
os.popupMenu(menu, menuButton.value, {
|
||||
viaKeyboard,
|
||||
|
|
@ -426,10 +406,18 @@ function menu(viaKeyboard = false): void {
|
|||
}
|
||||
|
||||
async function clip() {
|
||||
if (props.mock) {
|
||||
return;
|
||||
}
|
||||
|
||||
os.popupMenu(await getNoteClipMenu({ note: note, isDeleted, currentClip: currentClip?.value }), clipButton.value).then(focus);
|
||||
}
|
||||
|
||||
function showRenoteMenu(viaKeyboard = false): void {
|
||||
if (props.mock) {
|
||||
return;
|
||||
}
|
||||
|
||||
function getUnrenote(): MenuItem {
|
||||
return {
|
||||
text: i18n.ts.unrenote,
|
||||
|
|
@ -487,6 +475,14 @@ function readPromo() {
|
|||
});
|
||||
isDeleted.value = true;
|
||||
}
|
||||
|
||||
function emitUpdReaction(emoji: string, delta: number) {
|
||||
if (delta < 0) {
|
||||
emit('removeReaction', emoji);
|
||||
} else if (delta > 0) {
|
||||
emit('reaction', emoji);
|
||||
}
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
|
|
@ -67,19 +67,28 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</header>
|
||||
<div :class="$style.noteContent">
|
||||
<p v-if="appearNote.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :i="$i"/>
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="appearNote"/>
|
||||
</p>
|
||||
<div v-show="appearNote.cw == null || showContent">
|
||||
<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<MkA v-if="appearNote.replyId" :class="$style.noteReplyTarget" :to="`/notes/${appearNote.replyId}`"><i class="ti ti-arrow-back-up"></i></MkA>
|
||||
<Mfm v-if="appearNote.text" :text="appearNote.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm
|
||||
v-if="appearNote.text"
|
||||
:parsedNodes="parsed"
|
||||
:text="appearNote.text"
|
||||
:author="appearNote.user"
|
||||
:nyaize="'account'"
|
||||
:emojiUrls="appearNote.emojis"
|
||||
:enableEmojiMenu="true"
|
||||
:enableEmojiMenuReaction="true"
|
||||
/>
|
||||
<a v-if="appearNote.renote != null" :class="$style.rn">RN:</a>
|
||||
<div v-if="translating || translation" :class="$style.translation">
|
||||
<MkLoading v-if="translating" mini/>
|
||||
<div v-else>
|
||||
<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
|
||||
</div>
|
||||
</div>
|
||||
<div v-if="appearNote.files.length > 0">
|
||||
|
|
@ -184,7 +193,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed, inject, onMounted, ref, shallowRef } from 'vue';
|
||||
import { computed, inject, onMounted, provide, ref, shallowRef } from 'vue';
|
||||
import * as mfm from 'mfm-js';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import MkNoteSub from '@/components/MkNoteSub.vue';
|
||||
|
|
@ -206,7 +215,7 @@ import { reactionPicker } from '@/scripts/reaction-picker.js';
|
|||
import { extractUrlFromMfm } from '@/scripts/extract-url-from-mfm.js';
|
||||
import { $i } from '@/account.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { getNoteClipMenu, getNoteMenu } from '@/scripts/get-note-menu.js';
|
||||
import { getNoteClipMenu, getNoteMenu, getRenoteMenu } from '@/scripts/get-note-menu.js';
|
||||
import { useNoteCapture } from '@/scripts/use-note-capture.js';
|
||||
import { deepClone } from '@/scripts/clone.js';
|
||||
import { useTooltip } from '@/scripts/use-tooltip.js';
|
||||
|
|
@ -230,9 +239,11 @@ let note = $ref(deepClone(props.note));
|
|||
// plugin
|
||||
if (noteViewInterruptors.length > 0) {
|
||||
onMounted(async () => {
|
||||
let result = deepClone(note);
|
||||
let result:Misskey.entities.Note | null = deepClone(note);
|
||||
for (const interruptor of noteViewInterruptors) {
|
||||
result = await interruptor.handler(result);
|
||||
|
||||
if (result === null) return isDeleted.value = true;
|
||||
}
|
||||
note = result;
|
||||
});
|
||||
|
|
@ -258,7 +269,8 @@ const isDeleted = ref(false);
|
|||
const muted = ref($i ? checkWordMute(appearNote, $i, $i.mutedWords) : false);
|
||||
const translation = ref(null);
|
||||
const translating = ref(false);
|
||||
const urls = appearNote.text ? extractUrlFromMfm(mfm.parse(appearNote.text)) : null;
|
||||
const parsed = appearNote.text ? mfm.parse(appearNote.text) : null;
|
||||
const urls = parsed ? extractUrlFromMfm(parsed) : null;
|
||||
const showTicker = (defaultStore.state.instanceTicker === 'always') || (defaultStore.state.instanceTicker === 'remote' && appearNote.user.instance);
|
||||
const conversation = ref<Misskey.entities.Note[]>([]);
|
||||
const replies = ref<Misskey.entities.Note[]>([]);
|
||||
|
|
@ -273,6 +285,13 @@ const keymap = {
|
|||
's': () => showContent.value !== showContent.value,
|
||||
};
|
||||
|
||||
provide('react', (reaction: string) => {
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: appearNote.id,
|
||||
reaction: reaction,
|
||||
});
|
||||
});
|
||||
|
||||
let tab = $ref('replies');
|
||||
let reactionTabType = $ref(null);
|
||||
|
||||
|
|
@ -322,71 +341,10 @@ function renote(viaKeyboard = false) {
|
|||
pleaseLogin();
|
||||
showMovedDialog();
|
||||
|
||||
let items = [] as MenuItem[];
|
||||
|
||||
if (appearNote.channel) {
|
||||
items = items.concat([{
|
||||
text: i18n.ts.inChannelRenote,
|
||||
icon: 'ti ti-repeat',
|
||||
action: () => {
|
||||
const el = renoteButton.value as HTMLElement | null | undefined;
|
||||
if (el) {
|
||||
const rect = el.getBoundingClientRect();
|
||||
const x = rect.left + (el.offsetWidth / 2);
|
||||
const y = rect.top + (el.offsetHeight / 2);
|
||||
os.popup(MkRippleEffect, { x, y }, {}, 'end');
|
||||
}
|
||||
|
||||
os.api('notes/create', {
|
||||
renoteId: appearNote.id,
|
||||
channelId: appearNote.channelId,
|
||||
}).then(() => {
|
||||
os.toast(i18n.ts.renoted);
|
||||
});
|
||||
},
|
||||
}, {
|
||||
text: i18n.ts.inChannelQuote,
|
||||
icon: 'ti ti-quote',
|
||||
action: () => {
|
||||
os.post({
|
||||
renote: appearNote,
|
||||
channel: appearNote.channel,
|
||||
});
|
||||
},
|
||||
}, null]);
|
||||
}
|
||||
|
||||
items = items.concat([{
|
||||
text: i18n.ts.renote,
|
||||
icon: 'ti ti-repeat',
|
||||
action: () => {
|
||||
const el = renoteButton.value as HTMLElement | null | undefined;
|
||||
if (el) {
|
||||
const rect = el.getBoundingClientRect();
|
||||
const x = rect.left + (el.offsetWidth / 2);
|
||||
const y = rect.top + (el.offsetHeight / 2);
|
||||
os.popup(MkRippleEffect, { x, y }, {}, 'end');
|
||||
}
|
||||
|
||||
os.api('notes/create', {
|
||||
renoteId: appearNote.id,
|
||||
}).then(() => {
|
||||
os.toast(i18n.ts.renoted);
|
||||
});
|
||||
},
|
||||
}, {
|
||||
text: i18n.ts.quote,
|
||||
icon: 'ti ti-quote',
|
||||
action: () => {
|
||||
os.post({
|
||||
renote: appearNote,
|
||||
});
|
||||
},
|
||||
}]);
|
||||
|
||||
os.popupMenu(items, renoteButton.value, {
|
||||
const { menu } = getRenoteMenu({ note: note, renoteButton });
|
||||
os.popupMenu(menu, renoteButton.value, {
|
||||
viaKeyboard,
|
||||
});
|
||||
}).then(focus);
|
||||
}
|
||||
|
||||
function reply(viaKeyboard = false): void {
|
||||
|
|
@ -497,6 +455,7 @@ function blur() {
|
|||
}
|
||||
|
||||
const repliesLoaded = ref(false);
|
||||
|
||||
function loadReplies() {
|
||||
repliesLoaded.value = true;
|
||||
os.api('notes/children', {
|
||||
|
|
@ -508,6 +467,7 @@ function loadReplies() {
|
|||
}
|
||||
|
||||
const conversationLoaded = ref(false);
|
||||
|
||||
function loadConversation() {
|
||||
conversationLoaded.value = true;
|
||||
os.api('notes/conversation', {
|
||||
|
|
|
|||
|
|
@ -5,7 +5,10 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<header :class="$style.root">
|
||||
<MkA v-user-preview="note.user.id" :class="$style.name" :to="userPage(note.user)">
|
||||
<div v-if="mock" :class="$style.name">
|
||||
<MkUserName :user="note.user"/>
|
||||
</div>
|
||||
<MkA v-else v-user-preview="note.user.id" :class="$style.name" :to="userPage(note.user)">
|
||||
<MkUserName :user="note.user"/>
|
||||
</MkA>
|
||||
<div v-if="note.user.isBot" :class="$style.isBot">bot</div>
|
||||
|
|
@ -14,7 +17,10 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<img v-for="role in note.user.badgeRoles" :key="role.id" v-tooltip="role.name" :class="$style.badgeRole" :src="role.iconUrl"/>
|
||||
</div>
|
||||
<div :class="$style.info">
|
||||
<MkA :to="notePage(note)">
|
||||
<div v-if="mock">
|
||||
<MkTime :time="note.createdAt" colored/>
|
||||
</div>
|
||||
<MkA v-else :to="notePage(note)">
|
||||
<MkTime :time="note.createdAt" colored/>
|
||||
</MkA>
|
||||
<span v-if="note.visibility !== 'public'" style="margin-left: 0.5em;" :title="i18n.ts._visibility[note.visibility]">
|
||||
|
|
@ -29,7 +35,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { } from 'vue';
|
||||
import { inject } from 'vue';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { notePage } from '@/filters/note.js';
|
||||
|
|
@ -38,6 +44,8 @@ import { userPage } from '@/filters/user.js';
|
|||
defineProps<{
|
||||
note: Misskey.entities.Note;
|
||||
}>();
|
||||
|
||||
const mock = inject<boolean>('mock', false);
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
|
|
@ -5,14 +5,14 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<div :class="$style.root">
|
||||
<MkAvatar :class="$style.avatar" :user="$i" link preview/>
|
||||
<MkAvatar :class="$style.avatar" :user="user" link preview/>
|
||||
<div :class="$style.main">
|
||||
<div :class="$style.header">
|
||||
<MkUserName :user="$i" :nowrap="true"/>
|
||||
<MkUserName :user="user" :nowrap="true"/>
|
||||
</div>
|
||||
<div>
|
||||
<div>
|
||||
<Mfm :text="text.trim()" :author="$i" :i="$i"/>
|
||||
<Mfm :text="text.trim()" :author="user" :nyaize="'account'" :i="user"/>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
|
@ -21,10 +21,11 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<script lang="ts" setup>
|
||||
import { } from 'vue';
|
||||
import { $i } from '@/account.js';
|
||||
import * as Misskey from 'misskey-js';
|
||||
|
||||
const props = defineProps<{
|
||||
text: string;
|
||||
user: Misskey.entities.User;
|
||||
}>();
|
||||
</script>
|
||||
|
||||
|
|
|
|||
|
|
@ -10,7 +10,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkNoteHeader :class="$style.header" :note="note" :mini="true"/>
|
||||
<div>
|
||||
<p v-if="note.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :i="$i" :emojiUrls="note.emojis"/>
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'" :emojiUrls="note.emojis"/>
|
||||
<MkCwButton v-model="showContent" :note="note"/>
|
||||
</p>
|
||||
<div v-show="note.cw == null || showContent">
|
||||
|
|
|
|||
|
|
@ -12,7 +12,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkNoteHeader :class="$style.header" :note="note" :mini="true"/>
|
||||
<div>
|
||||
<p v-if="note.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :i="$i"/>
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="note"/>
|
||||
</p>
|
||||
<div v-show="note.cw == null || showContent">
|
||||
|
|
|
|||
|
|
@ -4,14 +4,16 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<div ref="elRef" :class="$style.root">
|
||||
<div :class="$style.root">
|
||||
<div :class="$style.head">
|
||||
<MkAvatar v-if="notification.type === 'pollEnded'" :class="$style.icon" :user="notification.note.user" link preview/>
|
||||
<MkAvatar v-else-if="notification.type === 'note'" :class="$style.icon" :user="notification.note.user" link preview/>
|
||||
<MkAvatar v-else-if="notification.type === 'achievementEarned'" :class="$style.icon" :user="$i" link preview/>
|
||||
<div v-else-if="notification.type === 'reaction:grouped'" :class="[$style.icon, $style.icon_reactionGroup]"><i class="ti ti-plus" style="line-height: 1;"></i></div>
|
||||
<div v-else-if="notification.type === 'renote:grouped'" :class="[$style.icon, $style.icon_renoteGroup]"><i class="ti ti-repeat" style="line-height: 1;"></i></div>
|
||||
<img v-else-if="notification.type === 'test'" :class="$style.icon" :src="infoImageUrl"/>
|
||||
<MkAvatar v-else-if="notification.user" :class="$style.icon" :user="notification.user" link preview/>
|
||||
<img v-else-if="notification.icon" :class="$style.icon" :src="notification.icon" alt=""/>
|
||||
<img v-else-if="notification.icon" :class="[$style.icon, $style.icon_app]" :src="notification.icon" alt=""/>
|
||||
<div
|
||||
:class="[$style.subIcon, {
|
||||
[$style.t_follow]: notification.type === 'follow',
|
||||
|
|
@ -37,9 +39,8 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<!-- notification.reaction が null になることはまずないが、ここでoptional chaining使うと一部ブラウザで刺さるので念の為 -->
|
||||
<MkReactionIcon
|
||||
v-else-if="notification.type === 'reaction'"
|
||||
ref="reactionRef"
|
||||
:withTooltip="true"
|
||||
:reaction="notification.reaction ? notification.reaction.replace(/^:(\w+):$/, ':$1@.:') : notification.reaction"
|
||||
:customEmojis="notification.note.emojis"
|
||||
:noStyle="true"
|
||||
style="width: 100%; height: 100%;"
|
||||
/>
|
||||
|
|
@ -52,16 +53,18 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-else-if="notification.type === 'achievementEarned'">{{ i18n.ts._notification.achievementEarned }}</span>
|
||||
<span v-else-if="notification.type === 'test'">{{ i18n.ts._notification.testNotification }}</span>
|
||||
<MkA v-else-if="notification.user" v-user-preview="notification.user.id" :class="$style.headerName" :to="userPage(notification.user)"><MkUserName :user="notification.user"/></MkA>
|
||||
<span v-else-if="notification.type === 'reaction:grouped'">{{ i18n.t('_notification.reactedBySomeUsers', { n: notification.reactions.length }) }}</span>
|
||||
<span v-else-if="notification.type === 'renote:grouped'">{{ i18n.t('_notification.renotedBySomeUsers', { n: notification.users.length }) }}</span>
|
||||
<span v-else>{{ notification.header }}</span>
|
||||
<MkTime v-if="withTime" :time="notification.createdAt" :class="$style.headerTime"/>
|
||||
</header>
|
||||
<div>
|
||||
<MkA v-if="notification.type === 'reaction'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note)">
|
||||
<MkA v-if="notification.type === 'reaction' || notification.type === 'reaction:grouped'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note)">
|
||||
<i class="ti ti-quote" :class="$style.quote"></i>
|
||||
<Mfm :text="getNoteSummary(notification.note)" :plain="true" :nowrap="true" :author="notification.note.user"/>
|
||||
<i class="ti ti-quote" :class="$style.quote"></i>
|
||||
</MkA>
|
||||
<MkA v-else-if="notification.type === 'renote'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note.renote)">
|
||||
<MkA v-else-if="notification.type === 'renote' || notification.type === 'renote:grouped'" :class="$style.text" :to="notePage(notification.note)" :title="getNoteSummary(notification.note.renote)">
|
||||
<i class="ti ti-quote" :class="$style.quote"></i>
|
||||
<Mfm :text="getNoteSummary(notification.note.renote)" :plain="true" :nowrap="true" :author="notification.note.renote.user"/>
|
||||
<i class="ti ti-quote" :class="$style.quote"></i>
|
||||
|
|
@ -102,6 +105,25 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-else-if="notification.type === 'app'" :class="$style.text">
|
||||
<Mfm :text="notification.body" :nowrap="false"/>
|
||||
</span>
|
||||
|
||||
<div v-if="notification.type === 'reaction:grouped'">
|
||||
<div v-for="reaction of notification.reactions" :class="$style.reactionsItem">
|
||||
<MkAvatar :class="$style.reactionsItemAvatar" :user="reaction.user" link preview/>
|
||||
<div :class="$style.reactionsItemReaction">
|
||||
<MkReactionIcon
|
||||
:withTooltip="true"
|
||||
:reaction="reaction.reaction ? reaction.reaction.replace(/^:(\w+):$/, ':$1@.:') : reaction.reaction"
|
||||
:noStyle="true"
|
||||
style="width: 100%; height: 100%;"
|
||||
/>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
<div v-else-if="notification.type === 'renote:grouped'">
|
||||
<div v-for="user of notification.users" :class="$style.reactionsItem">
|
||||
<MkAvatar :class="$style.reactionsItemAvatar" :user="user" link preview/>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
|
@ -112,14 +134,12 @@ import { ref, shallowRef } from 'vue';
|
|||
import * as Misskey from 'misskey-js';
|
||||
import MkReactionIcon from '@/components/MkReactionIcon.vue';
|
||||
import MkFollowButton from '@/components/MkFollowButton.vue';
|
||||
import XReactionTooltip from '@/components/MkReactionTooltip.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import { getNoteSummary } from '@/scripts/get-note-summary.js';
|
||||
import { notePage } from '@/filters/note.js';
|
||||
import { userPage } from '@/filters/user.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import * as os from '@/os.js';
|
||||
import { useTooltip } from '@/scripts/use-tooltip.js';
|
||||
import { $i } from '@/account.js';
|
||||
import { infoImageUrl } from '@/instance.js';
|
||||
|
||||
|
|
@ -132,9 +152,6 @@ const props = withDefaults(defineProps<{
|
|||
full: false,
|
||||
});
|
||||
|
||||
const elRef = shallowRef<HTMLElement>(null);
|
||||
const reactionRef = ref(null);
|
||||
|
||||
const followRequestDone = ref(false);
|
||||
|
||||
const acceptFollowRequest = () => {
|
||||
|
|
@ -146,15 +163,6 @@ const rejectFollowRequest = () => {
|
|||
followRequestDone.value = true;
|
||||
os.api('following/requests/reject', { userId: props.notification.user.id });
|
||||
};
|
||||
|
||||
useTooltip(reactionRef, (showing) => {
|
||||
os.popup(XReactionTooltip, {
|
||||
showing,
|
||||
reaction: props.notification.reaction ? props.notification.reaction.replace(/^:(\w+):$/, ':$1@.:') : props.notification.reaction,
|
||||
emojis: props.notification.note.emojis,
|
||||
targetElement: reactionRef.value.$el,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
@ -181,6 +189,29 @@ useTooltip(reactionRef, (showing) => {
|
|||
display: block;
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
}
|
||||
|
||||
.icon_reactionGroup,
|
||||
.icon_renoteGroup {
|
||||
display: grid;
|
||||
align-items: center;
|
||||
justify-items: center;
|
||||
width: 80%;
|
||||
height: 80%;
|
||||
font-size: 15px;
|
||||
border-radius: 100%;
|
||||
color: #fff;
|
||||
}
|
||||
|
||||
.icon_reactionGroup {
|
||||
background: #e99a0b;
|
||||
}
|
||||
|
||||
.icon_renoteGroup {
|
||||
background: #36d298;
|
||||
}
|
||||
|
||||
.icon_app {
|
||||
border-radius: 6px;
|
||||
}
|
||||
|
||||
|
|
@ -305,6 +336,36 @@ useTooltip(reactionRef, (showing) => {
|
|||
flex: 1;
|
||||
}
|
||||
|
||||
.reactionsItem {
|
||||
display: inline-block;
|
||||
position: relative;
|
||||
width: 38px;
|
||||
height: 38px;
|
||||
margin-top: 8px;
|
||||
margin-right: 8px;
|
||||
}
|
||||
|
||||
.reactionsItemAvatar {
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
}
|
||||
|
||||
.reactionsItemReaction {
|
||||
position: absolute;
|
||||
z-index: 1;
|
||||
bottom: -2px;
|
||||
right: -2px;
|
||||
width: 20px;
|
||||
height: 20px;
|
||||
box-sizing: border-box;
|
||||
border-radius: 100%;
|
||||
background: var(--panel);
|
||||
box-shadow: 0 0 0 3px var(--panel);
|
||||
font-size: 11px;
|
||||
text-align: center;
|
||||
color: #fff;
|
||||
}
|
||||
|
||||
@container (max-width: 600px) {
|
||||
.root {
|
||||
padding: 16px;
|
||||
|
|
|
|||
|
|
@ -4,25 +4,27 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<MkPagination ref="pagingComponent" :pagination="pagination">
|
||||
<template #empty>
|
||||
<div class="_fullinfo">
|
||||
<img :src="infoImageUrl" class="_ghost"/>
|
||||
<div>{{ i18n.ts.noNotifications }}</div>
|
||||
</div>
|
||||
</template>
|
||||
<MkPullToRefresh :refresher="() => reload()">
|
||||
<MkPagination ref="pagingComponent" :pagination="pagination">
|
||||
<template #empty>
|
||||
<div class="_fullinfo">
|
||||
<img :src="infoImageUrl" class="_ghost"/>
|
||||
<div>{{ i18n.ts.noNotifications }}</div>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<template #default="{ items: notifications }">
|
||||
<MkDateSeparatedList v-slot="{ item: notification }" :class="$style.list" :items="notifications" :noGap="true">
|
||||
<MkNote v-if="['reply', 'quote', 'mention'].includes(notification.type)" :key="notification.id" :note="notification.note"/>
|
||||
<XNotification v-else :key="notification.id" :notification="notification" :withTime="true" :full="true" class="_panel notification"/>
|
||||
</MkDateSeparatedList>
|
||||
</template>
|
||||
</MkPagination>
|
||||
<template #default="{ items: notifications }">
|
||||
<MkDateSeparatedList v-slot="{ item: notification }" :class="$style.list" :items="notifications" :noGap="true">
|
||||
<MkNote v-if="['reply', 'quote', 'mention'].includes(notification.type)" :key="notification.id" :note="notification.note"/>
|
||||
<XNotification v-else :key="notification.id" :notification="notification" :withTime="true" :full="true" class="_panel"/>
|
||||
</MkDateSeparatedList>
|
||||
</template>
|
||||
</MkPagination>
|
||||
</MkPullToRefresh>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { onUnmounted, onMounted, computed, shallowRef } from 'vue';
|
||||
import { onUnmounted, onDeactivated, onMounted, computed, shallowRef, onActivated } from 'vue';
|
||||
import MkPagination, { Paging } from '@/components/MkPagination.vue';
|
||||
import XNotification from '@/components/MkNotification.vue';
|
||||
import MkDateSeparatedList from '@/components/MkDateSeparatedList.vue';
|
||||
|
|
@ -32,6 +34,8 @@ import { $i } from '@/account.js';
|
|||
import { i18n } from '@/i18n.js';
|
||||
import { notificationTypes } from '@/const.js';
|
||||
import { infoImageUrl } from '@/instance.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
import MkPullToRefresh from '@/components/MkPullToRefresh.vue';
|
||||
|
||||
const props = defineProps<{
|
||||
excludeTypes?: typeof notificationTypes[number][];
|
||||
|
|
@ -39,7 +43,13 @@ const props = defineProps<{
|
|||
|
||||
const pagingComponent = shallowRef<InstanceType<typeof MkPagination>>();
|
||||
|
||||
const pagination: Paging = {
|
||||
const pagination: Paging = defaultStore.state.useGroupedNotifications ? {
|
||||
endpoint: 'i/notifications-grouped' as const,
|
||||
limit: 20,
|
||||
params: computed(() => ({
|
||||
excludeTypes: props.excludeTypes ?? undefined,
|
||||
})),
|
||||
} : {
|
||||
endpoint: 'i/notifications' as const,
|
||||
limit: 20,
|
||||
params: computed(() => ({
|
||||
|
|
@ -47,7 +57,7 @@ const pagination: Paging = {
|
|||
})),
|
||||
};
|
||||
|
||||
const onNotification = (notification) => {
|
||||
function onNotification(notification) {
|
||||
const isMuted = props.excludeTypes ? props.excludeTypes.includes(notification.type) : false;
|
||||
if (isMuted || document.visibilityState === 'visible') {
|
||||
useStream().send('readNotification');
|
||||
|
|
@ -56,7 +66,15 @@ const onNotification = (notification) => {
|
|||
if (!isMuted) {
|
||||
pagingComponent.value.prepend(notification);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
function reload() {
|
||||
return new Promise<void>((res) => {
|
||||
pagingComponent.value?.reload().then(() => {
|
||||
res();
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
let connection;
|
||||
|
||||
|
|
@ -65,9 +83,19 @@ onMounted(() => {
|
|||
connection.on('notification', onNotification);
|
||||
});
|
||||
|
||||
onActivated(() => {
|
||||
pagingComponent.value?.reload();
|
||||
connection = useStream().useChannel('main');
|
||||
connection.on('notification', onNotification);
|
||||
});
|
||||
|
||||
onUnmounted(() => {
|
||||
if (connection) connection.dispose();
|
||||
});
|
||||
|
||||
onDeactivated(() => {
|
||||
if (connection) connection.dispose();
|
||||
});
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
|
|
@ -166,6 +166,8 @@ defineExpose({
|
|||
|
||||
<style lang="scss" module>
|
||||
.root {
|
||||
overscroll-behavior: contain;
|
||||
|
||||
min-height: 100%;
|
||||
background: var(--bg);
|
||||
|
||||
|
|
|
|||
|
|
@ -87,6 +87,7 @@ function arrayToEntries(entities: MisskeyEntity[]): [string, MisskeyEntity][] {
|
|||
function concatMapWithArray(map: MisskeyEntityMap, entities: MisskeyEntity[]): MisskeyEntityMap {
|
||||
return new Map([...map, ...arrayToEntries(entities)]);
|
||||
}
|
||||
|
||||
</script>
|
||||
<script lang="ts" setup>
|
||||
import { infoImageUrl } from '@/instance.js';
|
||||
|
|
@ -101,6 +102,7 @@ const props = withDefaults(defineProps<{
|
|||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'queue', count: number): void;
|
||||
(ev: 'status', error: boolean): void;
|
||||
}>();
|
||||
|
||||
let rootEl = $shallowRef<HTMLElement>();
|
||||
|
|
@ -192,6 +194,11 @@ watch(queue, (a, b) => {
|
|||
emit('queue', queue.value.size);
|
||||
}, { deep: true });
|
||||
|
||||
watch(error, (n, o) => {
|
||||
if (n === o) return;
|
||||
emit('status', n);
|
||||
});
|
||||
|
||||
async function init(): Promise<void> {
|
||||
items.value = new Map();
|
||||
queue.value = new Map();
|
||||
|
|
|
|||
|
|
@ -74,7 +74,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<input v-show="withHashtags" ref="hashtagsInputEl" v-model="hashtags" :class="$style.hashtags" :placeholder="i18n.ts.hashtags" list="hashtags">
|
||||
<XPostFormAttaches v-model="files" @detach="detachFile" @changeSensitive="updateFileSensitive" @changeName="updateFileName" @replaceFile="replaceFile"/>
|
||||
<MkPollEditor v-if="poll" v-model="poll" @destroyed="poll = null"/>
|
||||
<MkNotePreview v-if="showPreview" :class="$style.preview" :text="text"/>
|
||||
<MkNotePreview v-if="showPreview" :class="$style.preview" :text="text" :user="postAccount ?? $i"/>
|
||||
<div v-if="showingOptions" style="padding: 8px 16px;">
|
||||
</div>
|
||||
<footer :class="$style.footer">
|
||||
|
|
@ -99,7 +99,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { inject, watch, nextTick, onMounted, defineAsyncComponent } from 'vue';
|
||||
import { inject, watch, nextTick, onMounted, defineAsyncComponent, provide } from 'vue';
|
||||
import * as mfm from 'mfm-js';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import insertTextAtCursor from 'insert-text-at-cursor';
|
||||
|
|
@ -144,15 +144,22 @@ const props = withDefaults(defineProps<{
|
|||
fixed?: boolean;
|
||||
autofocus?: boolean;
|
||||
freezeAfterPosted?: boolean;
|
||||
mock?: boolean;
|
||||
}>(), {
|
||||
initialVisibleUsers: () => [],
|
||||
autofocus: true,
|
||||
mock: false,
|
||||
});
|
||||
|
||||
provide('mock', props.mock);
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'posted'): void;
|
||||
(ev: 'cancel'): void;
|
||||
(ev: 'esc'): void;
|
||||
|
||||
// Mock用
|
||||
(ev: 'fileChangeSensitive', fileId: string, to: boolean): void;
|
||||
}>();
|
||||
|
||||
const textareaEl = $shallowRef<HTMLTextAreaElement | null>(null);
|
||||
|
|
@ -240,7 +247,7 @@ const maxTextLength = $computed((): number => {
|
|||
});
|
||||
|
||||
const canPost = $computed((): boolean => {
|
||||
return !posting && !posted &&
|
||||
return !props.mock && !posting && !posted &&
|
||||
(1 <= textLength || 1 <= files.length || !!poll || !!props.renote) &&
|
||||
(textLength <= maxTextLength) &&
|
||||
(!poll || poll.choices.length >= 2);
|
||||
|
|
@ -293,6 +300,10 @@ if (props.reply && props.reply.text != null) {
|
|||
}
|
||||
}
|
||||
|
||||
if ($i?.isSilenced && visibility === 'public') {
|
||||
visibility = 'home';
|
||||
}
|
||||
|
||||
if (props.channel) {
|
||||
visibility = 'public';
|
||||
localOnly = true; // TODO: チャンネルが連合するようになった折には消す
|
||||
|
|
@ -397,6 +408,8 @@ function focus() {
|
|||
}
|
||||
|
||||
function chooseFileFrom(ev) {
|
||||
if (props.mock) return;
|
||||
|
||||
selectFiles(ev.currentTarget ?? ev.target, i18n.ts.attachFile).then(files_ => {
|
||||
for (const file of files_) {
|
||||
files.push(file);
|
||||
|
|
@ -409,6 +422,9 @@ function detachFile(id) {
|
|||
}
|
||||
|
||||
function updateFileSensitive(file, sensitive) {
|
||||
if (props.mock) {
|
||||
emit('fileChangeSensitive', file.id, sensitive);
|
||||
}
|
||||
files[files.findIndex(x => x.id === file.id)].isSensitive = sensitive;
|
||||
}
|
||||
|
||||
|
|
@ -421,6 +437,8 @@ function replaceFile(file: Misskey.entities.DriveFile, newFile: Misskey.entities
|
|||
}
|
||||
|
||||
function upload(file: File, name?: string): void {
|
||||
if (props.mock) return;
|
||||
|
||||
uploadFile(file, defaultStore.state.uploadFolder, name).then(res => {
|
||||
files.push(res);
|
||||
});
|
||||
|
|
@ -435,6 +453,7 @@ function setVisibility() {
|
|||
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkVisibilityPicker.vue')), {
|
||||
currentVisibility: visibility,
|
||||
isSilenced: $i?.isSilenced,
|
||||
localOnly: localOnly,
|
||||
src: visibilityButton,
|
||||
}, {
|
||||
|
|
@ -546,6 +565,8 @@ function onCompositionEnd(ev: CompositionEvent) {
|
|||
}
|
||||
|
||||
async function onPaste(ev: ClipboardEvent) {
|
||||
if (props.mock) return;
|
||||
|
||||
for (const { item, i } of Array.from(ev.clipboardData.items, (item, i) => ({ item, i }))) {
|
||||
if (item.kind === 'file') {
|
||||
const file = item.getAsFile();
|
||||
|
|
@ -630,7 +651,7 @@ function onDrop(ev): void {
|
|||
}
|
||||
|
||||
function saveDraft() {
|
||||
if (props.instant) return;
|
||||
if (props.instant || props.mock) return;
|
||||
|
||||
const draftData = JSON.parse(miLocalStorage.getItem('drafts') ?? '{}');
|
||||
|
||||
|
|
@ -659,6 +680,14 @@ function deleteDraft() {
|
|||
}
|
||||
|
||||
async function post(ev?: MouseEvent) {
|
||||
if (useCw && (cw == null || cw.trim() === '')) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: i18n.ts.cwNotationRequired,
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
if (ev) {
|
||||
const el = ev.currentTarget ?? ev.target;
|
||||
const rect = el.getBoundingClientRect();
|
||||
|
|
@ -667,6 +696,8 @@ async function post(ev?: MouseEvent) {
|
|||
os.popup(MkRippleEffect, { x, y }, {}, 'end');
|
||||
}
|
||||
|
||||
if (props.mock) return;
|
||||
|
||||
const annoying =
|
||||
text.includes('$[x2') ||
|
||||
text.includes('$[x3') ||
|
||||
|
|
@ -832,6 +863,8 @@ function showActions(ev) {
|
|||
let postAccount = $ref<Misskey.entities.UserDetailed | null>(null);
|
||||
|
||||
function openAccountMenu(ev: MouseEvent) {
|
||||
if (props.mock) return;
|
||||
|
||||
openAccountMenu_({
|
||||
withExtraOperation: false,
|
||||
includeCurrentAccount: true,
|
||||
|
|
@ -862,7 +895,7 @@ onMounted(() => {
|
|||
|
||||
nextTick(() => {
|
||||
// 書きかけの投稿を復元
|
||||
if (!props.instant && !props.mention && !props.specified) {
|
||||
if (!props.instant && !props.mention && !props.specified && !props.mock) {
|
||||
const draft = JSON.parse(miLocalStorage.getItem('drafts') ?? '{}')[draftKey];
|
||||
if (draft) {
|
||||
text = draft.data.text;
|
||||
|
|
|
|||
|
|
@ -20,7 +20,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { defineAsyncComponent } from 'vue';
|
||||
import { defineAsyncComponent, inject } from 'vue';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import MkDriveFileThumbnail from '@/components/MkDriveFileThumbnail.vue';
|
||||
import * as os from '@/os.js';
|
||||
|
|
@ -33,6 +33,8 @@ const props = defineProps<{
|
|||
detachMediaFn?: (id: string) => void;
|
||||
}>();
|
||||
|
||||
const mock = inject<boolean>('mock', false);
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'update:modelValue', value: any[]): void;
|
||||
(ev: 'detach', id: string): void;
|
||||
|
|
@ -44,6 +46,8 @@ const emit = defineEmits<{
|
|||
let menuShowing = false;
|
||||
|
||||
function detachMedia(id: string) {
|
||||
if (mock) return;
|
||||
|
||||
if (props.detachMediaFn) {
|
||||
props.detachMediaFn(id);
|
||||
} else {
|
||||
|
|
@ -52,6 +56,11 @@ function detachMedia(id: string) {
|
|||
}
|
||||
|
||||
function toggleSensitive(file) {
|
||||
if (mock) {
|
||||
emit('changeSensitive', file, !file.isSensitive);
|
||||
return;
|
||||
}
|
||||
|
||||
os.api('drive/files/update', {
|
||||
fileId: file.id,
|
||||
isSensitive: !file.isSensitive,
|
||||
|
|
@ -59,7 +68,10 @@ function toggleSensitive(file) {
|
|||
emit('changeSensitive', file, !file.isSensitive);
|
||||
});
|
||||
}
|
||||
|
||||
async function rename(file) {
|
||||
if (mock) return;
|
||||
|
||||
const { canceled, result } = await os.inputText({
|
||||
title: i18n.ts.enterFileName,
|
||||
default: file.name,
|
||||
|
|
@ -76,6 +88,8 @@ async function rename(file) {
|
|||
}
|
||||
|
||||
async function describe(file) {
|
||||
if (mock) return;
|
||||
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkFileCaptionEditWindow.vue')), {
|
||||
default: file.comment !== null ? file.comment : '',
|
||||
file: file,
|
||||
|
|
@ -93,6 +107,8 @@ async function describe(file) {
|
|||
}
|
||||
|
||||
async function crop(file: Misskey.entities.DriveFile): Promise<void> {
|
||||
if (mock) return;
|
||||
|
||||
const newFile = await os.cropImage(file, { aspectRatio: NaN });
|
||||
emit('replaceFile', file, newFile);
|
||||
}
|
||||
|
|
|
|||
264
packages/frontend/src/components/MkPullToRefresh.vue
Normal file
264
packages/frontend/src/components/MkPullToRefresh.vue
Normal file
|
|
@ -0,0 +1,264 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div ref="rootEl">
|
||||
<div v-if="isPullStart" :class="$style.frame" :style="`--frame-min-height: ${pullDistance / (PULL_BRAKE_BASE + (pullDistance / PULL_BRAKE_FACTOR))}px;`">
|
||||
<div :class="$style.frameContent">
|
||||
<MkLoading v-if="isRefreshing" :class="$style.loader" :em="true"/>
|
||||
<i v-else class="ti ti-arrow-bar-to-down" :class="[$style.icon, { [$style.refresh]: isPullEnd }]"></i>
|
||||
<div :class="$style.text">
|
||||
<template v-if="isPullEnd">{{ i18n.ts.releaseToRefresh }}</template>
|
||||
<template v-else-if="isRefreshing">{{ i18n.ts.refreshing }}</template>
|
||||
<template v-else>{{ i18n.ts.pullDownToRefresh }}</template>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
<div :class="{ [$style.slotClip]: isPullStart }">
|
||||
<slot/>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { onMounted, onUnmounted, watch } from 'vue';
|
||||
import { deviceKind } from '@/scripts/device-kind.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { getScrollContainer } from '@/scripts/scroll.js';
|
||||
|
||||
const SCROLL_STOP = 10;
|
||||
const MAX_PULL_DISTANCE = Infinity;
|
||||
const FIRE_THRESHOLD = 230;
|
||||
const RELEASE_TRANSITION_DURATION = 200;
|
||||
const PULL_BRAKE_BASE = 1.5;
|
||||
const PULL_BRAKE_FACTOR = 170;
|
||||
|
||||
let isPullStart = $ref(false);
|
||||
let isPullEnd = $ref(false);
|
||||
let isRefreshing = $ref(false);
|
||||
let pullDistance = $ref(0);
|
||||
|
||||
let supportPointerDesktop = false;
|
||||
let startScreenY: number | null = null;
|
||||
|
||||
const rootEl = $shallowRef<HTMLDivElement>();
|
||||
let scrollEl: HTMLElement | null = null;
|
||||
|
||||
let disabled = false;
|
||||
|
||||
const props = withDefaults(defineProps<{
|
||||
refresher: () => Promise<void>;
|
||||
}>(), {
|
||||
refresher: () => Promise.resolve(),
|
||||
});
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'refresh'): void;
|
||||
}>();
|
||||
|
||||
function getScreenY(event) {
|
||||
if (supportPointerDesktop) {
|
||||
return event.screenY;
|
||||
}
|
||||
return event.touches[0].screenY;
|
||||
}
|
||||
|
||||
function moveStart(event) {
|
||||
if (!isPullStart && !isRefreshing && !disabled) {
|
||||
isPullStart = true;
|
||||
startScreenY = getScreenY(event);
|
||||
pullDistance = 0;
|
||||
}
|
||||
}
|
||||
|
||||
function moveBySystem(to: number): Promise<void> {
|
||||
return new Promise(r => {
|
||||
const startHeight = pullDistance;
|
||||
const overHeight = pullDistance - to;
|
||||
if (overHeight < 1) {
|
||||
r();
|
||||
return;
|
||||
}
|
||||
const startTime = Date.now();
|
||||
let intervalId = setInterval(() => {
|
||||
const time = Date.now() - startTime;
|
||||
if (time > RELEASE_TRANSITION_DURATION) {
|
||||
pullDistance = to;
|
||||
clearInterval(intervalId);
|
||||
r();
|
||||
return;
|
||||
}
|
||||
const nextHeight = startHeight - (overHeight / RELEASE_TRANSITION_DURATION) * time;
|
||||
if (pullDistance < nextHeight) return;
|
||||
pullDistance = nextHeight;
|
||||
}, 1);
|
||||
});
|
||||
}
|
||||
|
||||
async function fixOverContent() {
|
||||
if (pullDistance > FIRE_THRESHOLD) {
|
||||
await moveBySystem(FIRE_THRESHOLD);
|
||||
}
|
||||
}
|
||||
|
||||
async function closeContent() {
|
||||
if (pullDistance > 0) {
|
||||
await moveBySystem(0);
|
||||
}
|
||||
}
|
||||
|
||||
function moveEnd() {
|
||||
if (isPullStart && !isRefreshing) {
|
||||
startScreenY = null;
|
||||
if (isPullEnd) {
|
||||
isPullEnd = false;
|
||||
isRefreshing = true;
|
||||
fixOverContent().then(() => {
|
||||
emit('refresh');
|
||||
props.refresher().then(() => {
|
||||
refreshFinished();
|
||||
});
|
||||
});
|
||||
} else {
|
||||
closeContent().then(() => isPullStart = false);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
function moving(event: TouchEvent | PointerEvent) {
|
||||
if (!isPullStart || isRefreshing || disabled) return;
|
||||
|
||||
if ((scrollEl?.scrollTop ?? 0) > (supportPointerDesktop ? SCROLL_STOP : SCROLL_STOP + pullDistance)) {
|
||||
pullDistance = 0;
|
||||
isPullEnd = false;
|
||||
moveEnd();
|
||||
return;
|
||||
}
|
||||
|
||||
if (startScreenY === null) {
|
||||
startScreenY = getScreenY(event);
|
||||
}
|
||||
const moveScreenY = getScreenY(event);
|
||||
|
||||
const moveHeight = moveScreenY - startScreenY!;
|
||||
pullDistance = Math.min(Math.max(moveHeight, 0), MAX_PULL_DISTANCE);
|
||||
|
||||
if (pullDistance > 0) {
|
||||
if (event.cancelable) event.preventDefault();
|
||||
}
|
||||
|
||||
isPullEnd = pullDistance >= FIRE_THRESHOLD;
|
||||
}
|
||||
|
||||
/**
|
||||
* emit(refresh)が完了したことを知らせる関数
|
||||
*
|
||||
* タイムアウトがないのでこれを最終的に実行しないと出たままになる
|
||||
*/
|
||||
function refreshFinished() {
|
||||
closeContent().then(() => {
|
||||
isPullStart = false;
|
||||
isRefreshing = false;
|
||||
});
|
||||
}
|
||||
|
||||
function setDisabled(value) {
|
||||
disabled = value;
|
||||
}
|
||||
|
||||
function onScrollContainerScroll() {
|
||||
const scrollPos = scrollEl!.scrollTop;
|
||||
|
||||
// When at the top of the page, disable vertical overscroll so passive touch listeners can take over.
|
||||
if (scrollPos === 0) {
|
||||
scrollEl!.style.touchAction = 'pan-x pan-down pinch-zoom';
|
||||
registerEventListenersForReadyToPull();
|
||||
} else {
|
||||
scrollEl!.style.touchAction = 'auto';
|
||||
unregisterEventListenersForReadyToPull();
|
||||
}
|
||||
}
|
||||
|
||||
function registerEventListenersForReadyToPull() {
|
||||
if (rootEl == null) return;
|
||||
rootEl.addEventListener('touchstart', moveStart, { passive: true });
|
||||
rootEl.addEventListener('touchmove', moving, { passive: false }); // passive: falseにしないとpreventDefaultが使えない
|
||||
}
|
||||
|
||||
function unregisterEventListenersForReadyToPull() {
|
||||
if (rootEl == null) return;
|
||||
rootEl.removeEventListener('touchstart', moveStart);
|
||||
rootEl.removeEventListener('touchmove', moving);
|
||||
}
|
||||
|
||||
onMounted(() => {
|
||||
if (rootEl == null) return;
|
||||
|
||||
scrollEl = getScrollContainer(rootEl);
|
||||
if (scrollEl == null) return;
|
||||
|
||||
scrollEl.addEventListener('scroll', onScrollContainerScroll, { passive: true });
|
||||
|
||||
rootEl.addEventListener('touchend', moveEnd, { passive: true });
|
||||
|
||||
registerEventListenersForReadyToPull();
|
||||
});
|
||||
|
||||
onUnmounted(() => {
|
||||
if (scrollEl) scrollEl.removeEventListener('scroll', onScrollContainerScroll);
|
||||
|
||||
unregisterEventListenersForReadyToPull();
|
||||
});
|
||||
|
||||
defineExpose({
|
||||
setDisabled,
|
||||
});
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.frame {
|
||||
position: relative;
|
||||
overflow: clip;
|
||||
|
||||
width: 100%;
|
||||
min-height: var(--frame-min-height, 0px);
|
||||
|
||||
mask-image: linear-gradient(90deg, #000 0%, #000 80%, transparent);
|
||||
-webkit-mask-image: -webkit-linear-gradient(90deg, #000 0%, #000 80%, transparent);
|
||||
|
||||
pointer-events: none;
|
||||
}
|
||||
|
||||
.frameContent {
|
||||
position: absolute;
|
||||
bottom: 0;
|
||||
width: 100%;
|
||||
margin: 5px 0;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
align-items: center;
|
||||
font-size: 14px;
|
||||
|
||||
> .icon, > .loader {
|
||||
margin: 6px 0;
|
||||
}
|
||||
|
||||
> .icon {
|
||||
transition: transform .25s;
|
||||
|
||||
&.refresh {
|
||||
transform: rotate(180deg);
|
||||
}
|
||||
}
|
||||
|
||||
> .text {
|
||||
margin: 5px 0;
|
||||
}
|
||||
}
|
||||
|
||||
.slotClip {
|
||||
overflow-y: clip;
|
||||
}
|
||||
</style>
|
||||
|
|
@ -34,6 +34,7 @@ const props = withDefaults(defineProps<{
|
|||
textConverter?: (value: number) => string,
|
||||
showTicks?: boolean;
|
||||
easing?: boolean;
|
||||
continuousUpdate?: boolean;
|
||||
}>(), {
|
||||
step: 1,
|
||||
textConverter: (v) => v.toString(),
|
||||
|
|
@ -123,6 +124,10 @@ const onMousedown = (ev: MouseEvent | TouchEvent) => {
|
|||
const pointerX = ev.touches && ev.touches.length > 0 ? ev.touches[0].clientX : ev.clientX;
|
||||
const pointerPositionOnContainer = pointerX - (containerRect.left + (thumbWidth / 2));
|
||||
rawValue.value = Math.min(1, Math.max(0, pointerPositionOnContainer / (containerEl.value!.offsetWidth - thumbWidth)));
|
||||
|
||||
if (props.continuousUpdate) {
|
||||
emit('update:modelValue', finalValue.value);
|
||||
}
|
||||
};
|
||||
|
||||
let beforeValue = finalValue.value;
|
||||
|
|
|
|||
|
|
@ -4,16 +4,31 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<MkCustomEmoji v-if="reaction[0] === ':'" :name="reaction" :normal="true" :noStyle="noStyle" :url="emojiUrl"/>
|
||||
<MkEmoji v-else :emoji="reaction" :normal="true" :noStyle="noStyle"/>
|
||||
<MkCustomEmoji v-if="reaction[0] === ':'" ref="elRef" :name="reaction" :normal="true" :noStyle="noStyle" :url="emojiUrl"/>
|
||||
<MkEmoji v-else ref="elRef" :emoji="reaction" :normal="true" :noStyle="noStyle"/>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { } from 'vue';
|
||||
import { defineAsyncComponent, shallowRef } from 'vue';
|
||||
import { useTooltip } from '@/scripts/use-tooltip.js';
|
||||
import * as os from '@/os.js';
|
||||
|
||||
const props = defineProps<{
|
||||
reaction: string;
|
||||
noStyle?: boolean;
|
||||
emojiUrl?: string;
|
||||
withTooltip?: boolean;
|
||||
}>();
|
||||
|
||||
const elRef = shallowRef();
|
||||
|
||||
if (props.withTooltip) {
|
||||
useTooltip(elRef, (showing) => {
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkReactionTooltip.vue')), {
|
||||
showing,
|
||||
reaction: props.reaction.replace(/^:(\w+):$/, ':$1@.:'),
|
||||
targetElement: elRef.value.$el,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
}
|
||||
</script>
|
||||
|
|
|
|||
|
|
@ -15,7 +15,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkAvatar :class="$style.avatar" :user="u"/>
|
||||
<MkUserName :user="u" :nowrap="true"/>
|
||||
</div>
|
||||
<div v-if="users.length > 10" :class="$style.more">+{{ count - 10 }}</div>
|
||||
<div v-if="count > 10" :class="$style.more">+{{ count - 10 }}</div>
|
||||
</div>
|
||||
</div>
|
||||
</MkTooltip>
|
||||
|
|
|
|||
|
|
@ -17,7 +17,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed, onMounted, shallowRef, watch } from 'vue';
|
||||
import { computed, inject, onMounted, shallowRef, watch } from 'vue';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import XDetails from '@/components/MkReactionsViewer.details.vue';
|
||||
import MkReactionIcon from '@/components/MkReactionIcon.vue';
|
||||
|
|
@ -36,6 +36,12 @@ const props = defineProps<{
|
|||
note: Misskey.entities.Note;
|
||||
}>();
|
||||
|
||||
const mock = inject<boolean>('mock', false);
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'reactionToggled', emoji: string, newCount: number): void;
|
||||
}>();
|
||||
|
||||
const buttonEl = shallowRef<HTMLElement>();
|
||||
|
||||
const canToggle = computed(() => !props.reaction.match(/@\w/) && $i);
|
||||
|
|
@ -53,6 +59,11 @@ async function toggleReaction() {
|
|||
});
|
||||
if (confirm.canceled) return;
|
||||
|
||||
if (mock) {
|
||||
emit('reactionToggled', props.reaction, (props.count - 1));
|
||||
return;
|
||||
}
|
||||
|
||||
os.api('notes/reactions/delete', {
|
||||
noteId: props.note.id,
|
||||
}).then(() => {
|
||||
|
|
@ -64,6 +75,11 @@ async function toggleReaction() {
|
|||
}
|
||||
});
|
||||
} else {
|
||||
if (mock) {
|
||||
emit('reactionToggled', props.reaction, (props.count + 1));
|
||||
return;
|
||||
}
|
||||
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: props.note.id,
|
||||
reaction: props.reaction,
|
||||
|
|
@ -92,24 +108,26 @@ onMounted(() => {
|
|||
if (!props.isInitial) anime();
|
||||
});
|
||||
|
||||
useTooltip(buttonEl, async (showing) => {
|
||||
const reactions = await os.apiGet('notes/reactions', {
|
||||
noteId: props.note.id,
|
||||
type: props.reaction,
|
||||
limit: 11,
|
||||
_cacheKey_: props.count,
|
||||
});
|
||||
if (!mock) {
|
||||
useTooltip(buttonEl, async (showing) => {
|
||||
const reactions = await os.apiGet('notes/reactions', {
|
||||
noteId: props.note.id,
|
||||
type: props.reaction,
|
||||
limit: 10,
|
||||
_cacheKey_: props.count,
|
||||
});
|
||||
|
||||
const users = reactions.map(x => x.user);
|
||||
const users = reactions.map(x => x.user);
|
||||
|
||||
os.popup(XDetails, {
|
||||
showing,
|
||||
reaction: props.reaction,
|
||||
users,
|
||||
count: props.count,
|
||||
targetElement: buttonEl.value,
|
||||
}, {}, 'closed');
|
||||
}, 100);
|
||||
os.popup(XDetails, {
|
||||
showing,
|
||||
reaction: props.reaction,
|
||||
users,
|
||||
count: props.count,
|
||||
targetElement: buttonEl.value,
|
||||
}, {}, 'closed');
|
||||
}, 100);
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
|
|
@ -12,14 +12,14 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
:moveClass="defaultStore.state.animation ? $style.transition_x_move : ''"
|
||||
tag="div" :class="$style.root"
|
||||
>
|
||||
<XReaction v-for="[reaction, count] in reactions" :key="reaction" :reaction="reaction" :count="count" :isInitial="initialReactions.has(reaction)" :note="note"/>
|
||||
<XReaction v-for="[reaction, count] in reactions" :key="reaction" :reaction="reaction" :count="count" :isInitial="initialReactions.has(reaction)" :note="note" @reactionToggled="onMockToggleReaction"/>
|
||||
<slot v-if="hasMoreReactions" name="more"/>
|
||||
</TransitionGroup>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { watch } from 'vue';
|
||||
import { inject, watch } from 'vue';
|
||||
import XReaction from '@/components/MkReactionsViewer.reaction.vue';
|
||||
import { defaultStore } from '@/store.js';
|
||||
|
||||
|
|
@ -30,6 +30,12 @@ const props = withDefaults(defineProps<{
|
|||
maxNumber: Infinity,
|
||||
});
|
||||
|
||||
const mock = inject<boolean>('mock', false);
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'mockUpdateMyReaction', emoji: string, delta: number): void;
|
||||
}>();
|
||||
|
||||
const initialReactions = new Set(Object.keys(props.note.reactions));
|
||||
|
||||
let reactions = $ref<[string, number][]>([]);
|
||||
|
|
@ -39,6 +45,15 @@ if (props.note.myReaction && !Object.keys(reactions).includes(props.note.myReact
|
|||
reactions[props.note.myReaction] = props.note.reactions[props.note.myReaction];
|
||||
}
|
||||
|
||||
function onMockToggleReaction(emoji: string, count: number) {
|
||||
if (!mock) return;
|
||||
|
||||
const i = reactions.findIndex((item) => item[0] === emoji);
|
||||
if (i < 0) return;
|
||||
|
||||
emit('mockUpdateMyReaction', emoji, (count - reactions[i][1]));
|
||||
}
|
||||
|
||||
watch([() => props.note.reactions, () => props.maxNumber], ([newSource, maxNumber]) => {
|
||||
let newReactions: [string, number][] = [];
|
||||
hasMoreReactions = Object.keys(newSource).length > maxNumber;
|
||||
|
|
|
|||
|
|
@ -9,7 +9,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-if="note.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<span v-if="note.deletedAt" style="opacity: 0.5">({{ i18n.ts.deleted }})</span>
|
||||
<MkA v-if="note.replyId" :class="$style.reply" :to="`/notes/${note.replyId}`"><i class="ti ti-arrow-back-up"></i></MkA>
|
||||
<Mfm v-if="note.text" :text="note.text" :author="note.user" :i="$i" :emojiUrls="note.emojis"/>
|
||||
<Mfm v-if="note.text" :text="note.text" :author="note.user" :emojiUrls="note.emojis"/>
|
||||
<MkA v-if="note.renoteId" :class="$style.rp" :to="`/notes/${note.renoteId}`">RN: ...</MkA>
|
||||
</div>
|
||||
<details v-if="note.files.length > 0">
|
||||
|
|
@ -42,7 +42,7 @@ const props = defineProps<{
|
|||
note: Misskey.entities.Note;
|
||||
}>();
|
||||
|
||||
const isLong = shouldCollapsed(props.note);
|
||||
const isLong = shouldCollapsed(props.note, []);
|
||||
|
||||
const collapsed = $ref(isLong);
|
||||
</script>
|
||||
|
|
|
|||
|
|
@ -4,13 +4,16 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<MkNotes ref="tlComponent" :noGap="!defaultStore.state.showGapBetweenNotesInTimeline" :pagination="pagination" @queue="emit('queue', $event)"/>
|
||||
<MkPullToRefresh ref="prComponent" :refresher="() => reloadTimeline()">
|
||||
<MkNotes ref="tlComponent" :noGap="!defaultStore.state.showGapBetweenNotesInTimeline" :pagination="pagination" @queue="emit('queue', $event)" @status="prComponent.setDisabled($event)"/>
|
||||
</MkPullToRefresh>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed, provide, onUnmounted } from 'vue';
|
||||
import MkNotes from '@/components/MkNotes.vue';
|
||||
import { useStream } from '@/stream.js';
|
||||
import MkPullToRefresh from '@/components/MkPullToRefresh.vue';
|
||||
import { useStream, reloadStream } from '@/stream.js';
|
||||
import * as sound from '@/scripts/sound.js';
|
||||
import { $i } from '@/account.js';
|
||||
import { instance } from '@/instance.js';
|
||||
|
|
@ -39,6 +42,7 @@ const emit = defineEmits<{
|
|||
|
||||
provide('inChannel', computed(() => props.src === 'channel'));
|
||||
|
||||
const prComponent: InstanceType<typeof MkPullToRefresh> = $ref();
|
||||
const tlComponent: InstanceType<typeof MkNotes> = $ref();
|
||||
|
||||
let tlNotesCount = 0;
|
||||
|
|
@ -65,29 +69,73 @@ let connection;
|
|||
let connection2;
|
||||
|
||||
const stream = useStream();
|
||||
const connectChannel = () => {
|
||||
if (props.src === 'antenna') {
|
||||
connection = stream.useChannel('antenna', {
|
||||
antennaId: props.antenna,
|
||||
});
|
||||
} else if (props.src === 'home') {
|
||||
connection = stream.useChannel('homeTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
connection2 = stream.useChannel('main');
|
||||
} else if (props.src === 'local') {
|
||||
connection = stream.useChannel('localTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withReplies: props.withReplies,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
} else if (props.src === 'social') {
|
||||
connection = stream.useChannel('hybridTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withReplies: props.withReplies,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
} else if (props.src === 'global') {
|
||||
connection = stream.useChannel('globalTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
} else if (props.src === 'mentions') {
|
||||
connection = stream.useChannel('main');
|
||||
connection.on('mention', prepend);
|
||||
} else if (props.src === 'directs') {
|
||||
const onNote = note => {
|
||||
if (note.visibility === 'specified') {
|
||||
prepend(note);
|
||||
}
|
||||
};
|
||||
connection = stream.useChannel('main');
|
||||
connection.on('mention', onNote);
|
||||
} else if (props.src === 'list') {
|
||||
connection = stream.useChannel('userList', {
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
listId: props.list,
|
||||
});
|
||||
} else if (props.src === 'channel') {
|
||||
connection = stream.useChannel('channel', {
|
||||
channelId: props.channel,
|
||||
});
|
||||
} else if (props.src === 'role') {
|
||||
connection = stream.useChannel('roleTimeline', {
|
||||
roleId: props.role,
|
||||
});
|
||||
}
|
||||
if (props.src !== 'directs' || props.src !== 'mentions') connection.on('note', prepend);
|
||||
};
|
||||
|
||||
if (props.src === 'antenna') {
|
||||
endpoint = 'antennas/notes';
|
||||
query = {
|
||||
antennaId: props.antenna,
|
||||
};
|
||||
connection = stream.useChannel('antenna', {
|
||||
antennaId: props.antenna,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
} else if (props.src === 'home') {
|
||||
endpoint = 'notes/timeline';
|
||||
query = {
|
||||
withRenotes: props.withRenotes,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
};
|
||||
connection = stream.useChannel('homeTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
|
||||
connection2 = stream.useChannel('main');
|
||||
} else if (props.src === 'local') {
|
||||
endpoint = 'notes/local-timeline';
|
||||
query = {
|
||||
|
|
@ -95,12 +143,6 @@ if (props.src === 'antenna') {
|
|||
withReplies: props.withReplies,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
};
|
||||
connection = stream.useChannel('localTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withReplies: props.withReplies,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
} else if (props.src === 'social') {
|
||||
endpoint = 'notes/hybrid-timeline';
|
||||
query = {
|
||||
|
|
@ -108,68 +150,44 @@ if (props.src === 'antenna') {
|
|||
withReplies: props.withReplies,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
};
|
||||
connection = stream.useChannel('hybridTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withReplies: props.withReplies,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
} else if (props.src === 'global') {
|
||||
endpoint = 'notes/global-timeline';
|
||||
query = {
|
||||
withRenotes: props.withRenotes,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
};
|
||||
connection = stream.useChannel('globalTimeline', {
|
||||
withRenotes: props.withRenotes,
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
} else if (props.src === 'mentions') {
|
||||
endpoint = 'notes/mentions';
|
||||
connection = stream.useChannel('main');
|
||||
connection.on('mention', prepend);
|
||||
} else if (props.src === 'directs') {
|
||||
endpoint = 'notes/mentions';
|
||||
query = {
|
||||
visibility: 'specified',
|
||||
};
|
||||
const onNote = note => {
|
||||
if (note.visibility === 'specified') {
|
||||
prepend(note);
|
||||
}
|
||||
};
|
||||
connection = stream.useChannel('main');
|
||||
connection.on('mention', onNote);
|
||||
} else if (props.src === 'list') {
|
||||
endpoint = 'notes/user-list-timeline';
|
||||
query = {
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
listId: props.list,
|
||||
};
|
||||
connection = stream.useChannel('userList', {
|
||||
withFiles: props.onlyFiles ? true : undefined,
|
||||
listId: props.list,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
} else if (props.src === 'channel') {
|
||||
endpoint = 'channels/timeline';
|
||||
query = {
|
||||
channelId: props.channel,
|
||||
};
|
||||
connection = stream.useChannel('channel', {
|
||||
channelId: props.channel,
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
} else if (props.src === 'role') {
|
||||
endpoint = 'roles/notes';
|
||||
query = {
|
||||
roleId: props.role,
|
||||
};
|
||||
connection = stream.useChannel('roleTimeline', {
|
||||
roleId: props.role,
|
||||
}
|
||||
|
||||
if (!defaultStore.state.disableStreamingTimeline) {
|
||||
connectChannel();
|
||||
|
||||
onUnmounted(() => {
|
||||
connection.dispose();
|
||||
if (connection2) connection2.dispose();
|
||||
});
|
||||
connection.on('note', prepend);
|
||||
}
|
||||
|
||||
const pagination = {
|
||||
|
|
@ -178,15 +196,18 @@ const pagination = {
|
|||
params: query,
|
||||
};
|
||||
|
||||
onUnmounted(() => {
|
||||
connection.dispose();
|
||||
if (connection2) connection2.dispose();
|
||||
});
|
||||
function reloadTimeline() {
|
||||
return new Promise<void>((res) => {
|
||||
tlNotesCount = 0;
|
||||
|
||||
/* TODO
|
||||
const timetravel = (date?: Date) => {
|
||||
this.date = date;
|
||||
this.$refs.tl.reload();
|
||||
};
|
||||
*/
|
||||
tlComponent.pagingComponent?.reload().then(() => {
|
||||
reloadStream();
|
||||
res();
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
defineExpose({
|
||||
reloadTimeline,
|
||||
});
|
||||
</script>
|
||||
|
|
|
|||
117
packages/frontend/src/components/MkTutorialDialog.Note.vue
Normal file
117
packages/frontend/src/components/MkTutorialDialog.Note.vue
Normal file
|
|
@ -0,0 +1,117 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div v-if="phase === 'aboutNote'" class="_gaps">
|
||||
<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._note.description }}</div>
|
||||
<MkNote :class="$style.exampleNoteRoot" style="pointer-events: none;" :note="exampleNote" :mock="true"/>
|
||||
<div class="_gaps_s">
|
||||
<div><i class="ti ti-arrow-back-up"></i> <b>{{ i18n.ts.reply }}</b> … {{ i18n.ts._initialTutorial._note.reply }}</div>
|
||||
<div><i class="ti ti-repeat"></i> <b>{{ i18n.ts.renote }}</b> … {{ i18n.ts._initialTutorial._note.renote }}</div>
|
||||
<div><i class="ti ti-plus"></i> <b>{{ i18n.ts.reaction }}</b> … {{ i18n.ts._initialTutorial._note.reaction }}</div>
|
||||
<div><i class="ti ti-dots"></i> <b>{{ i18n.ts.menu }}</b> … {{ i18n.ts._initialTutorial._note.menu }}</div>
|
||||
</div>
|
||||
</div>
|
||||
<div v-else-if="phase === 'howToReact'" class="_gaps">
|
||||
<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._reaction.description }}</div>
|
||||
<div>{{ i18n.ts._initialTutorial._reaction.letsTryReacting }}</div>
|
||||
<MkNote :class="$style.exampleNoteRoot" :note="exampleNote" :mock="true" @reaction="addReaction" @removeReaction="removeReaction" @updateReaction="updateReaction"/>
|
||||
<div v-if="onceReacted"><b style="color: var(--accent);"><i class="ti ti-check"></i> {{ i18n.ts._initialTutorial.wellDone }}</b> {{ i18n.ts._initialTutorial._reaction.reactNotification }}<br>{{ i18n.ts._initialTutorial._reaction.reactDone }}</div>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<script setup lang="ts">
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { ref, reactive } from 'vue';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { globalEvents } from '@/events.js';
|
||||
import { $i } from '@/account.js';
|
||||
import MkNote from '@/components/MkNote.vue';
|
||||
|
||||
const props = defineProps<{
|
||||
phase: 'aboutNote' | 'howToReact';
|
||||
}>();
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'reacted'): void;
|
||||
}>();
|
||||
|
||||
const exampleNote = reactive<Misskey.entities.Note>({
|
||||
id: '0000000000',
|
||||
createdAt: '2019-04-14T17:30:49.181Z',
|
||||
userId: '0000000001',
|
||||
user: {
|
||||
id: '0000000001',
|
||||
name: '藍',
|
||||
username: 'ai',
|
||||
host: null,
|
||||
avatarDecorations: [],
|
||||
avatarUrl: '/client-assets/tutorial/ai.webp',
|
||||
avatarBlurhash: 'eiKmhHIByXxZ~qWXs:-pR*NbR*s:xuRjoL-oR*WCt6WWf6WVf6oeWB',
|
||||
isBot: false,
|
||||
isCat: true,
|
||||
emojis: {},
|
||||
onlineStatus: null,
|
||||
badgeRoles: [],
|
||||
},
|
||||
text: 'just setting up my msky',
|
||||
cw: null,
|
||||
visibility: 'public',
|
||||
localOnly: false,
|
||||
reactionAcceptance: null,
|
||||
renoteCount: 0,
|
||||
repliesCount: 1,
|
||||
reactions: {},
|
||||
reactionEmojis: {},
|
||||
fileIds: [],
|
||||
files: [],
|
||||
replyId: null,
|
||||
renoteId: null,
|
||||
});
|
||||
const onceReacted = ref<boolean>(false);
|
||||
|
||||
function addReaction(emoji) {
|
||||
onceReacted.value = true;
|
||||
emit('reacted');
|
||||
exampleNote.reactions[emoji] = 1;
|
||||
exampleNote.myReaction = emoji;
|
||||
doNotification(emoji);
|
||||
}
|
||||
|
||||
function doNotification(emoji: string): void {
|
||||
if (!$i || !emoji) return;
|
||||
|
||||
const notification: Misskey.entities.Notification = {
|
||||
id: Math.random().toString(),
|
||||
createdAt: new Date().toUTCString(),
|
||||
isRead: false,
|
||||
type: 'reaction',
|
||||
reaction: emoji,
|
||||
user: $i,
|
||||
userId: $i.id,
|
||||
note: exampleNote,
|
||||
};
|
||||
|
||||
globalEvents.emit('clientNotification', notification);
|
||||
}
|
||||
|
||||
function removeReaction(emoji) {
|
||||
delete exampleNote.reactions[emoji];
|
||||
exampleNote.myReaction = undefined;
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.exampleNoteRoot {
|
||||
border-radius: var(--radius);
|
||||
border: var(--panelBorder);
|
||||
background: var(--panel);
|
||||
}
|
||||
|
||||
.divider {
|
||||
height: 1px;
|
||||
background: var(--divider);
|
||||
}
|
||||
</style>
|
||||
135
packages/frontend/src/components/MkTutorialDialog.PostNote.vue
Normal file
135
packages/frontend/src/components/MkTutorialDialog.PostNote.vue
Normal file
|
|
@ -0,0 +1,135 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div class="_gaps">
|
||||
<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._postNote.description1 }}</div>
|
||||
<MkPostForm :class="$style.exampleRoot" :mock="true" :autofocus="false"/>
|
||||
<MkFormSection>
|
||||
<template #label>{{ i18n.ts.visibility }}</template>
|
||||
<div class="_gaps">
|
||||
<div>{{ i18n.ts._initialTutorial._postNote._visibility.description }}</div>
|
||||
<div><i class="ti ti-world"></i> <b>{{ i18n.ts._visibility.public }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.public }}</div>
|
||||
<div><i class="ti ti-home"></i> <b>{{ i18n.ts._visibility.home }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.home }}</div>
|
||||
<div><i class="ti ti-lock"></i> <b>{{ i18n.ts._visibility.followers }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.followers }}</div>
|
||||
<div class="_gaps_s">
|
||||
<div><i class="ti ti-mail"></i> <b>{{ i18n.ts._visibility.specified }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.direct }}</div>
|
||||
<MkInfo :warn="true">
|
||||
<b>{{ i18n.ts._initialTutorial._postNote._visibility.doNotSendConfidencialOnDirect1 }}</b> {{ i18n.ts._initialTutorial._postNote._visibility.doNotSendConfidencialOnDirect2 }}
|
||||
</MkInfo>
|
||||
</div>
|
||||
<div><i class="ti ti-rocket-off"></i> <b>{{ i18n.ts._visibility.disableFederation }}</b> … {{ i18n.ts._initialTutorial._postNote._visibility.localOnly }}</div>
|
||||
</div>
|
||||
</MkFormSection>
|
||||
<MkFormSection>
|
||||
<template #label>{{ i18n.ts._initialTutorial._postNote._cw.title }}</template>
|
||||
<div class="_gaps">
|
||||
<div>{{ i18n.ts._initialTutorial._postNote._cw.description }}</div>
|
||||
<MkNote :class="$style.exampleRoot" :note="exampleCWNote" :mock="true"/>
|
||||
<div>{{ i18n.ts._initialTutorial._postNote._cw.useCases }}</div>
|
||||
</div>
|
||||
</MkFormSection>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<script setup lang="ts">
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { reactive } from 'vue';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import MkNote from '@/components/MkNote.vue';
|
||||
import MkPostForm from '@/components/MkPostForm.vue';
|
||||
import MkFormSection from '@/components/form/section.vue';
|
||||
import MkInfo from '@/components/MkInfo.vue';
|
||||
|
||||
const exampleCWNote = reactive<Misskey.entities.Note>({
|
||||
id: '0000000000',
|
||||
createdAt: '2019-04-14T17:30:49.181Z',
|
||||
userId: '0000000001',
|
||||
user: {
|
||||
id: '0000000001',
|
||||
name: '藍',
|
||||
username: 'ai',
|
||||
host: null,
|
||||
avatarDecorations: [],
|
||||
avatarUrl: '/client-assets/tutorial/ai.webp',
|
||||
avatarBlurhash: 'eiKmhHIByXxZ~qWXs:-pR*NbR*s:xuRjoL-oR*WCt6WWf6WVf6oeWB',
|
||||
isBot: false,
|
||||
isCat: true,
|
||||
emojis: {},
|
||||
onlineStatus: null,
|
||||
badgeRoles: [],
|
||||
},
|
||||
text: i18n.ts._initialTutorial._postNote._cw._exampleNote.note,
|
||||
cw: i18n.ts._initialTutorial._postNote._cw._exampleNote.cw,
|
||||
visibility: 'public',
|
||||
localOnly: false,
|
||||
reactionAcceptance: null,
|
||||
renoteCount: 0,
|
||||
repliesCount: 1,
|
||||
reactions: {},
|
||||
reactionEmojis: {},
|
||||
fileIds: [],
|
||||
files: [],
|
||||
replyId: null,
|
||||
renoteId: null,
|
||||
});
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.exampleRoot {
|
||||
max-width: none!important;
|
||||
border-radius: var(--radius);
|
||||
border: var(--panelBorder);
|
||||
background: var(--panel);
|
||||
}
|
||||
|
||||
.divider {
|
||||
height: 1px;
|
||||
background: var(--divider);
|
||||
}
|
||||
|
||||
.image {
|
||||
max-width: 300px;
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.post {
|
||||
position: relative;
|
||||
display: block;
|
||||
width: 100%;
|
||||
height: 40px;
|
||||
color: var(--fgOnAccent);
|
||||
font-weight: bold;
|
||||
text-align: left;
|
||||
|
||||
&:before {
|
||||
content: "";
|
||||
display: block;
|
||||
width: calc(100% - 38px);
|
||||
height: 100%;
|
||||
margin: auto;
|
||||
position: absolute;
|
||||
top: 0;
|
||||
left: 0;
|
||||
right: 0;
|
||||
bottom: 0;
|
||||
border-radius: 999px;
|
||||
background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
.postIcon {
|
||||
position: relative;
|
||||
margin-left: 30px;
|
||||
margin-right: 8px;
|
||||
width: 32px;
|
||||
}
|
||||
|
||||
.postText {
|
||||
position: relative;
|
||||
line-height: 40px;
|
||||
}
|
||||
</style>
|
||||
145
packages/frontend/src/components/MkTutorialDialog.Sensitive.vue
Normal file
145
packages/frontend/src/components/MkTutorialDialog.Sensitive.vue
Normal file
|
|
@ -0,0 +1,145 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div class="_gaps">
|
||||
<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.description }}</div>
|
||||
<div>{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.tryThisFile }}</div>
|
||||
<MkInfo>{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.method }}</MkInfo>
|
||||
<MkPostForm
|
||||
:class="$style.exampleRoot"
|
||||
:mock="true"
|
||||
:autofocus="false"
|
||||
:initialNote="exampleNote"
|
||||
@fileChangeSensitive="doSucceeded"
|
||||
></MkPostForm>
|
||||
<div v-if="onceSucceeded"><b style="color: var(--accent);"><i class="ti ti-check"></i> {{ i18n.ts._initialTutorial.wellDone }}</b> {{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.sensitiveSucceeded }}</div>
|
||||
<MkFolder>
|
||||
<template #label>{{ i18n.ts.previewNoteText }}</template>
|
||||
<MkNote :mock="true" :note="exampleNote" :class="$style.exampleRoot"></MkNote>
|
||||
</MkFolder>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<script setup lang="ts">
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { ref, reactive } from 'vue';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import MkPostForm from '@/components/MkPostForm.vue';
|
||||
import MkFolder from '@/components/MkFolder.vue';
|
||||
import MkInfo from '@/components/MkInfo.vue';
|
||||
import MkNote from '@/components/MkNote.vue';
|
||||
import { $i } from '@/account.js';
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'succeeded'): void;
|
||||
}>();
|
||||
|
||||
const onceSucceeded = ref<boolean>(false);
|
||||
|
||||
function doSucceeded(fileId: string, to: boolean) {
|
||||
if (fileId === exampleNote.fileIds[0] && to) {
|
||||
onceSucceeded.value = true;
|
||||
emit('succeeded');
|
||||
}
|
||||
}
|
||||
|
||||
const exampleNote = reactive<Misskey.entities.Note>({
|
||||
id: '0000000000',
|
||||
createdAt: '2019-04-14T17:30:49.181Z',
|
||||
userId: '0000000001',
|
||||
user: $i!,
|
||||
text: i18n.ts._initialTutorial._howToMakeAttachmentsSensitive._exampleNote.note,
|
||||
cw: null,
|
||||
visibility: 'public',
|
||||
localOnly: false,
|
||||
reactionAcceptance: null,
|
||||
renoteCount: 0,
|
||||
repliesCount: 1,
|
||||
reactions: {},
|
||||
reactionEmojis: {},
|
||||
fileIds: ['0000000002'],
|
||||
files: [{
|
||||
id: '0000000002',
|
||||
createdAt: '2019-04-14T17:30:49.181Z',
|
||||
name: 'natto_failed.webp',
|
||||
type: 'image/webp',
|
||||
md5: 'c44286cf152d0740be0ce5ad45ea85c3',
|
||||
size: 827532,
|
||||
isSensitive: false,
|
||||
blurhash: 'LXNA3TD*XAIA%1%M%gt7.TofRioz',
|
||||
properties: {
|
||||
width: 256,
|
||||
height: 256,
|
||||
},
|
||||
url: '/client-assets/tutorial/natto_failed.webp',
|
||||
thumbnailUrl: '/client-assets/tutorial/natto_failed.webp',
|
||||
comment: null,
|
||||
folderId: null,
|
||||
folder: null,
|
||||
userId: null,
|
||||
user: null,
|
||||
}],
|
||||
replyId: null,
|
||||
renoteId: null,
|
||||
});
|
||||
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.exampleRoot {
|
||||
border-radius: var(--radius);
|
||||
border: var(--panelBorder);
|
||||
background: var(--panel);
|
||||
}
|
||||
|
||||
.divider {
|
||||
height: 1px;
|
||||
background: var(--divider);
|
||||
}
|
||||
|
||||
.image {
|
||||
max-width: 300px;
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.post {
|
||||
position: relative;
|
||||
display: block;
|
||||
width: 100%;
|
||||
height: 40px;
|
||||
color: var(--fgOnAccent);
|
||||
font-weight: bold;
|
||||
text-align: left;
|
||||
|
||||
&:before {
|
||||
content: "";
|
||||
display: block;
|
||||
width: calc(100% - 38px);
|
||||
height: 100%;
|
||||
margin: auto;
|
||||
position: absolute;
|
||||
top: 0;
|
||||
left: 0;
|
||||
right: 0;
|
||||
bottom: 0;
|
||||
border-radius: 999px;
|
||||
background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
.postIcon {
|
||||
position: relative;
|
||||
margin-left: 30px;
|
||||
margin-right: 8px;
|
||||
width: 32px;
|
||||
}
|
||||
|
||||
.postText {
|
||||
position: relative;
|
||||
line-height: 40px;
|
||||
}
|
||||
</style>
|
||||
|
|
@ -0,0 +1,87 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div class="_gaps">
|
||||
<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._timeline.description1 }}</div>
|
||||
<div class="_gaps_s">
|
||||
<div><i class="ti ti-home"></i> <b>{{ i18n.ts._timelines.home }}</b> … {{ i18n.ts._initialTutorial._timeline.home }}</div>
|
||||
<div><i class="ti ti-planet"></i> <b>{{ i18n.ts._timelines.local }}</b> … {{ i18n.ts._initialTutorial._timeline.local }}</div>
|
||||
<div><i class="ti ti-universe"></i> <b>{{ i18n.ts._timelines.social }}</b> … {{ i18n.ts._initialTutorial._timeline.social }}</div>
|
||||
<div><i class="ti ti-whirl"></i> <b>{{ i18n.ts._timelines.global }}</b> … {{ i18n.ts._initialTutorial._timeline.global }}</div>
|
||||
</div>
|
||||
<div class="_gaps_s">
|
||||
<div>{{ i18n.ts._initialTutorial._timeline.description2 }}</div>
|
||||
<img :class="$style.image" src="/client-assets/tutorial/timeline_tab.png"/>
|
||||
</div>
|
||||
<div :class="$style.divider"></div>
|
||||
<I18n :src="i18n.ts._initialTutorial._timeline.description3" tag="div" style="padding: 0 16px;">
|
||||
<template #link>
|
||||
<a href="https://misskey-hub.net/docs/features/timeline.html" target="_blank" class="_link">{{ i18n.ts.help }}</a>
|
||||
</template>
|
||||
</I18n>
|
||||
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<script setup lang="ts">
|
||||
import { i18n } from '@/i18n.js';
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.exampleNoteRoot {
|
||||
border-radius: var(--radius);
|
||||
border: var(--panelBorder);
|
||||
background: var(--panel);
|
||||
}
|
||||
|
||||
.divider {
|
||||
height: 1px;
|
||||
background: var(--divider);
|
||||
}
|
||||
|
||||
.image {
|
||||
max-width: 300px;
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.post {
|
||||
position: relative;
|
||||
display: block;
|
||||
width: 100%;
|
||||
height: 40px;
|
||||
color: var(--fgOnAccent);
|
||||
font-weight: bold;
|
||||
text-align: left;
|
||||
|
||||
&:before {
|
||||
content: "";
|
||||
display: block;
|
||||
width: calc(100% - 38px);
|
||||
height: 100%;
|
||||
margin: auto;
|
||||
position: absolute;
|
||||
top: 0;
|
||||
left: 0;
|
||||
right: 0;
|
||||
bottom: 0;
|
||||
border-radius: 999px;
|
||||
background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
.postIcon {
|
||||
position: relative;
|
||||
margin-left: 30px;
|
||||
margin-right: 8px;
|
||||
width: 32px;
|
||||
}
|
||||
|
||||
.postText {
|
||||
position: relative;
|
||||
line-height: 40px;
|
||||
}
|
||||
</style>
|
||||
260
packages/frontend/src/components/MkTutorialDialog.vue
Normal file
260
packages/frontend/src/components/MkTutorialDialog.vue
Normal file
|
|
@ -0,0 +1,260 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<MkModalWindow
|
||||
ref="dialog"
|
||||
:width="600"
|
||||
:height="650"
|
||||
@close="close(true)"
|
||||
@closed="emit('closed')"
|
||||
>
|
||||
<template v-if="page === 1" #header><i class="ti ti-pencil"></i> {{ i18n.ts._initialTutorial._note.title }}</template>
|
||||
<template v-else-if="page === 2" #header><i class="ti ti-mood-smile"></i> {{ i18n.ts._initialTutorial._reaction.title }}</template>
|
||||
<template v-else-if="page === 3" #header><i class="ti ti-home"></i> {{ i18n.ts._initialTutorial._timeline.title }}</template>
|
||||
<template v-else-if="page === 4" #header><i class="ti ti-pencil-plus"></i> {{ i18n.ts._initialTutorial._postNote.title }}</template>
|
||||
<template v-else-if="page === 5" #header><i class="ti ti-eye-exclamation"></i> {{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.title }}</template>
|
||||
<template v-else #header>{{ i18n.ts._initialTutorial.title }}</template>
|
||||
|
||||
<div style="overflow-x: clip;">
|
||||
<Transition
|
||||
mode="out-in"
|
||||
:enterActiveClass="$style.transition_x_enterActive"
|
||||
:leaveActiveClass="$style.transition_x_leaveActive"
|
||||
:enterFromClass="$style.transition_x_enterFrom"
|
||||
:leaveToClass="$style.transition_x_leaveTo"
|
||||
>
|
||||
<template v-if="page === 0">
|
||||
<div :class="$style.centerPage">
|
||||
<MkAnimBg style="position: absolute; top: 0;" :scale="1.5"/>
|
||||
<MkSpacer :marginMin="20" :marginMax="28">
|
||||
<div class="_gaps" style="text-align: center;">
|
||||
<i class="ti ti-confetti" style="display: block; margin: auto; font-size: 3em; color: var(--accent);"></i>
|
||||
<div style="font-size: 120%;">{{ i18n.ts._initialTutorial._landing.title }}</div>
|
||||
<div>{{ i18n.ts._initialTutorial._landing.description }}</div>
|
||||
<MkButton primary rounded gradate style="margin: 16px auto 0 auto;" @click="page++">{{ i18n.ts._initialTutorial.launchTutorial }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
<MkButton style="margin: 0 auto;" transparent rounded @click="close(true)">{{ i18n.ts.close }}</MkButton>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 1">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<XNote phase="aboutNote"/>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton v-if="initialPage !== 1" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 2">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<div class="_gaps">
|
||||
<XNote phase="howToReact" @reacted="isReactionTutorialPushed = true"/>
|
||||
<div v-if="!isReactionTutorialPushed">{{ i18n.ts._initialTutorial._reaction.reactToContinue }}</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton v-if="initialPage !== 2" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate :disabled="!isReactionTutorialPushed" @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 3">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<XTimeline/>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton v-if="initialPage !== 3" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 4">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<XPostNote/>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton v-if="initialPage !== 3" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 5">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<div class="_gaps">
|
||||
<XSensitive @succeeded="isSensitiveTutorialSucceeded = true"/>
|
||||
<div v-if="!isSensitiveTutorialSucceeded">{{ i18n.ts._initialTutorial._howToMakeAttachmentsSensitive.doItToContinue }}</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton v-if="initialPage !== 2" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate :disabled="!isSensitiveTutorialSucceeded" @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 6">
|
||||
<div :class="$style.centerPage">
|
||||
<MkAnimBg style="position: absolute; top: 0;" :scale="1.5"/>
|
||||
<MkSpacer :marginMin="20" :marginMax="28">
|
||||
<div class="_gaps" style="text-align: center;">
|
||||
<i class="ti ti-check" style="display: block; margin: auto; font-size: 3em; color: var(--accent);"></i>
|
||||
<div style="font-size: 120%;">{{ i18n.ts._initialTutorial._done.title }}</div>
|
||||
<I18n :src="i18n.ts._initialTutorial._done.description" tag="div" style="padding: 0 16px;">
|
||||
<template #link>
|
||||
<a href="https://misskey-hub.net/help.html" target="_blank" class="_link">{{ i18n.ts.help }}</a>
|
||||
</template>
|
||||
</I18n>
|
||||
<div>{{ i18n.t('_initialAccountSetting.haveFun', { name: instance.name ?? host }) }}</div>
|
||||
<div class="_buttonsCenter" style="margin-top: 16px;">
|
||||
<MkButton v-if="initialPage !== 4" rounded @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton rounded primary gradate @click="close(false)">{{ i18n.ts.close }}</MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</div>
|
||||
</template>
|
||||
</Transition>
|
||||
</div>
|
||||
</MkModalWindow>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { ref, shallowRef, watch } from 'vue';
|
||||
import MkModalWindow from '@/components/MkModalWindow.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import XNote from '@/components/MkTutorialDialog.Note.vue';
|
||||
import XTimeline from '@/components/MkTutorialDialog.Timeline.vue';
|
||||
import XPostNote from '@/components/MkTutorialDialog.PostNote.vue';
|
||||
import XSensitive from '@/components/MkTutorialDialog.Sensitive.vue';
|
||||
import MkAnimBg from '@/components/MkAnimBg.vue';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { instance } from '@/instance.js';
|
||||
import { host } from '@/config.js';
|
||||
import { claimAchievement } from '@/scripts/achievements.js';
|
||||
import * as os from '@/os.js';
|
||||
|
||||
const props = defineProps<{
|
||||
initialPage?: number;
|
||||
}>();
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'closed'): void;
|
||||
}>();
|
||||
|
||||
const dialog = shallowRef<InstanceType<typeof MkModalWindow>>();
|
||||
|
||||
// eslint-disable-next-line vue/no-setup-props-destructure
|
||||
const page = ref(props.initialPage ?? 0);
|
||||
|
||||
watch(page, (to) => {
|
||||
// チュートリアルの枚数を増やしたら必ず変更すること!!
|
||||
if (to === 6) {
|
||||
claimAchievement('tutorialCompleted');
|
||||
}
|
||||
});
|
||||
|
||||
const isReactionTutorialPushed = ref<boolean>(false);
|
||||
const isSensitiveTutorialSucceeded = ref<boolean>(false);
|
||||
|
||||
async function close(skip: boolean) {
|
||||
if (skip) {
|
||||
const { canceled } = await os.confirm({
|
||||
type: 'warning',
|
||||
text: i18n.ts._initialTutorial.skipAreYouSure,
|
||||
});
|
||||
if (canceled) return;
|
||||
}
|
||||
|
||||
dialog.value?.close();
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.transition_x_enterActive,
|
||||
.transition_x_leaveActive {
|
||||
transition: opacity 0.3s cubic-bezier(0,0,.35,1), transform 0.3s cubic-bezier(0,0,.35,1);
|
||||
}
|
||||
.transition_x_enterFrom {
|
||||
opacity: 0;
|
||||
transform: translateX(50px);
|
||||
}
|
||||
.transition_x_leaveTo {
|
||||
opacity: 0;
|
||||
transform: translateX(-50px);
|
||||
}
|
||||
|
||||
.progressBar {
|
||||
position: absolute;
|
||||
top: 0;
|
||||
left: 0;
|
||||
z-index: 10;
|
||||
width: 100%;
|
||||
height: 4px;
|
||||
}
|
||||
|
||||
.progressBarValue {
|
||||
height: 100%;
|
||||
background: linear-gradient(90deg, var(--buttonGradateA), var(--buttonGradateB));
|
||||
transition: all 0.5s cubic-bezier(0,.5,.5,1);
|
||||
}
|
||||
|
||||
.centerPage {
|
||||
display: flex;
|
||||
justify-content: center;
|
||||
align-items: center;
|
||||
height: 100cqh;
|
||||
padding-bottom: 30px;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.pageRoot {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
min-height: 100%;
|
||||
}
|
||||
|
||||
.pageMain {
|
||||
flex-grow: 1;
|
||||
line-height: 1.5;
|
||||
}
|
||||
|
||||
.pageFooter {
|
||||
position: sticky;
|
||||
bottom: 0;
|
||||
left: 0;
|
||||
flex-shrink: 0;
|
||||
padding: 12px;
|
||||
border-top: solid 0.5px var(--divider);
|
||||
-webkit-backdrop-filter: blur(15px);
|
||||
backdrop-filter: blur(15px);
|
||||
}
|
||||
</style>
|
||||
|
|
@ -14,7 +14,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-if="$i && $i.id !== user.id && user.isFollowed" :class="$style.followed">{{ i18n.ts.followsYou }}</span>
|
||||
<div :class="$style.description">
|
||||
<div v-if="user.description" :class="$style.mfm">
|
||||
<Mfm :text="user.description" :author="user" :i="$i"/>
|
||||
<Mfm :text="user.description" :author="user"/>
|
||||
</div>
|
||||
<span v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</span>
|
||||
</div>
|
||||
|
|
|
|||
|
|
@ -27,7 +27,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div :class="$style.username"><MkAcct :user="user"/></div>
|
||||
</div>
|
||||
<div :class="$style.description">
|
||||
<Mfm v-if="user.description" :class="$style.mfm" :text="user.description" :author="user" :i="$i"/>
|
||||
<Mfm v-if="user.description" :class="$style.mfm" :text="user.description" :author="user"/>
|
||||
<div v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</div>
|
||||
</div>
|
||||
<div :class="$style.status">
|
||||
|
|
|
|||
|
|
@ -13,7 +13,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
<div :class="$style.description">
|
||||
<div v-if="user.description" :class="$style.mfm">
|
||||
<Mfm :text="user.description" :author="user" :i="$i"/>
|
||||
<Mfm :text="user.description" :author="user"/>
|
||||
</div>
|
||||
<span v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</span>
|
||||
</div>
|
||||
|
|
|
|||
|
|
@ -46,24 +46,32 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
<template v-else-if="page === 1">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<MkSpacer :marginMin="20" :marginMax="28">
|
||||
<XProfile/>
|
||||
<div class="_buttonsCenter" style="margin-top: 16px;">
|
||||
<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<XProfile/>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 2">
|
||||
<div style="height: 100cqh; overflow: auto;">
|
||||
<MkSpacer :marginMin="20" :marginMax="28">
|
||||
<XPrivacy/>
|
||||
<div class="_buttonsCenter" style="margin-top: 16px;">
|
||||
<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
<div :class="$style.pageRoot">
|
||||
<MkSpacer :marginMin="20" :marginMax="28" :class="$style.pageMain">
|
||||
<XPrivacy/>
|
||||
</MkSpacer>
|
||||
<div :class="$style.pageFooter">
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate data-cy-user-setup-continue @click="page++">{{ i18n.ts.continue }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</div>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="page === 3">
|
||||
|
|
@ -102,16 +110,13 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div class="_gaps" style="text-align: center;">
|
||||
<i class="ti ti-check" style="display: block; margin: auto; font-size: 3em; color: var(--accent);"></i>
|
||||
<div style="font-size: 120%;">{{ i18n.ts._initialAccountSetting.initialAccountSettingCompleted }}</div>
|
||||
<I18n :src="i18n.ts._initialAccountSetting.ifYouNeedLearnMore" tag="div" style="padding: 0 16px;">
|
||||
<template #name>{{ instance.name ?? host }}</template>
|
||||
<template #link>
|
||||
<a href="https://misskey-hub.net/help.html" target="_blank" class="_link">{{ i18n.ts.help }}</a>
|
||||
</template>
|
||||
</I18n>
|
||||
<div>{{ i18n.t('_initialAccountSetting.haveFun', { name: instance.name ?? host }) }}</div>
|
||||
<div>{{ i18n.t('_initialAccountSetting.youCanContinueTutorial', { name: instance.name ?? host }) }}</div>
|
||||
<div class="_buttonsCenter" style="margin-top: 16px;">
|
||||
<MkButton rounded primary gradate data-cy-user-setup-continue @click="launchTutorial()">{{ i18n.ts._initialAccountSetting.startTutorial }} <i class="ti ti-arrow-right"></i></MkButton>
|
||||
</div>
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton rounded data-cy-user-setup-back @click="page--"><i class="ti ti-arrow-left"></i> {{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton primary rounded gradate data-cy-user-setup-continue @click="close(false)">{{ i18n.ts.close }}</MkButton>
|
||||
<MkButton rounded primary data-cy-user-setup-continue @click="setupComplete()">{{ i18n.ts.close }}</MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
|
|
@ -123,7 +128,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { ref, shallowRef, watch } from 'vue';
|
||||
import { ref, shallowRef, watch, nextTick, defineAsyncComponent } from 'vue';
|
||||
import MkModalWindow from '@/components/MkModalWindow.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import XProfile from '@/components/MkUserSetupDialog.Profile.vue';
|
||||
|
|
@ -143,6 +148,7 @@ const emit = defineEmits<{
|
|||
|
||||
const dialog = shallowRef<InstanceType<typeof MkModalWindow>>();
|
||||
|
||||
// eslint-disable-next-line vue/no-setup-props-destructure
|
||||
const page = ref(defaultStore.state.accountSetupWizard);
|
||||
|
||||
watch(page, () => {
|
||||
|
|
@ -158,10 +164,24 @@ async function close(skip: boolean) {
|
|||
if (canceled) return;
|
||||
}
|
||||
|
||||
dialog.value.close();
|
||||
dialog.value?.close();
|
||||
defaultStore.set('accountSetupWizard', -1);
|
||||
}
|
||||
|
||||
function setupComplete() {
|
||||
defaultStore.set('accountSetupWizard', -1);
|
||||
dialog.value?.close();
|
||||
}
|
||||
|
||||
function launchTutorial() {
|
||||
setupComplete();
|
||||
nextTick(() => {
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkTutorialDialog.vue')), {
|
||||
initialPage: 1,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
}
|
||||
|
||||
async function later(later: boolean) {
|
||||
if (later) {
|
||||
const { canceled } = await os.confirm({
|
||||
|
|
@ -171,7 +191,7 @@ async function later(later: boolean) {
|
|||
if (canceled) return;
|
||||
}
|
||||
|
||||
dialog.value.close();
|
||||
dialog.value?.close();
|
||||
defaultStore.set('accountSetupWizard', 0);
|
||||
}
|
||||
</script>
|
||||
|
|
@ -214,10 +234,21 @@ async function later(later: boolean) {
|
|||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.pageRoot {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
min-height: 100%;
|
||||
}
|
||||
|
||||
.pageMain {
|
||||
flex-grow: 1;
|
||||
}
|
||||
|
||||
.pageFooter {
|
||||
position: sticky;
|
||||
bottom: 0;
|
||||
left: 0;
|
||||
flex-shrink: 0;
|
||||
padding: 12px;
|
||||
border-top: solid 0.5px var(--divider);
|
||||
-webkit-backdrop-filter: blur(15px);
|
||||
|
|
|
|||
|
|
@ -9,7 +9,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div :class="[$style.label, $style.item]">
|
||||
{{ i18n.ts.visibility }}
|
||||
</div>
|
||||
<button key="public" class="_button" :class="[$style.item, { [$style.active]: v === 'public' }]" data-index="1" @click="choose('public')">
|
||||
<button key="public" :disabled="isSilenced" class="_button" :class="[$style.item, { [$style.active]: v === 'public' }]" data-index="1" @click="choose('public')">
|
||||
<div :class="$style.icon"><i class="ti ti-world"></i></div>
|
||||
<div :class="$style.body">
|
||||
<span :class="$style.itemTitle">{{ i18n.ts._visibility.public }}</span>
|
||||
|
|
@ -51,6 +51,7 @@ const modal = $shallowRef<InstanceType<typeof MkModal>>();
|
|||
|
||||
const props = withDefaults(defineProps<{
|
||||
currentVisibility: typeof Misskey.noteVisibilities[number];
|
||||
isSilenced: boolean;
|
||||
localOnly: boolean;
|
||||
src?: HTMLElement;
|
||||
}>(), {
|
||||
|
|
|
|||
|
|
@ -17,7 +17,6 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<script lang="ts" setup>
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { toUnicode } from 'punycode/';
|
||||
import MkCondensedLine from './MkCondensedLine.vue';
|
||||
import { host as hostRaw } from '@/config.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
|
||||
|
|
|
|||
|
|
@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<component :is="link ? MkA : 'span'" v-user-preview="preview ? user.id : undefined" v-bind="bound" class="_noSelect" :class="[$style.root, { [$style.animation]: animation, [$style.cat]: user.isCat, [$style.square]: squareAvatars }]" :style="{ color }" :title="acct(user)" @click="onClick">
|
||||
<MkImgWithBlurhash :class="$style.inner" :src="url" :hash="user?.avatarBlurhash" :cover="true" :onlyAvgColor="true"/>
|
||||
<MkImgWithBlurhash :class="$style.inner" :src="url" :hash="user.avatarBlurhash" :cover="true" :onlyAvgColor="true"/>
|
||||
<MkUserOnlineIndicator v-if="indicator" :class="$style.indicator" :user="user"/>
|
||||
<div v-if="user.isCat" :class="[$style.ears]">
|
||||
<div :class="$style.earLeft">
|
||||
|
|
@ -23,6 +23,16 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
</div>
|
||||
</div>
|
||||
<img
|
||||
v-if="showDecoration && (decoration || user.avatarDecorations.length > 0)"
|
||||
:class="[$style.decoration]"
|
||||
:src="decoration?.url ?? user.avatarDecorations[0].url"
|
||||
:style="{
|
||||
rotate: getDecorationAngle(),
|
||||
scale: getDecorationScale(),
|
||||
}"
|
||||
alt=""
|
||||
>
|
||||
</component>
|
||||
</template>
|
||||
|
||||
|
|
@ -47,22 +57,33 @@ const props = withDefaults(defineProps<{
|
|||
link?: boolean;
|
||||
preview?: boolean;
|
||||
indicator?: boolean;
|
||||
decoration?: {
|
||||
url: string;
|
||||
angle?: number;
|
||||
flipH?: boolean;
|
||||
flipV?: boolean;
|
||||
};
|
||||
forceShowDecoration?: boolean;
|
||||
}>(), {
|
||||
target: null,
|
||||
link: false,
|
||||
preview: false,
|
||||
indicator: false,
|
||||
decoration: undefined,
|
||||
forceShowDecoration: false,
|
||||
});
|
||||
|
||||
const emit = defineEmits<{
|
||||
(ev: 'click', v: MouseEvent): void;
|
||||
}>();
|
||||
|
||||
const showDecoration = props.forceShowDecoration || defaultStore.state.showAvatarDecorations;
|
||||
|
||||
const bound = $computed(() => props.link
|
||||
? { to: userPage(props.user), target: props.target }
|
||||
: {});
|
||||
|
||||
const url = $computed(() => defaultStore.state.disableShowingAnimatedImages
|
||||
const url = $computed(() => (defaultStore.state.disableShowingAnimatedImages || defaultStore.state.enableDataSaverMode)
|
||||
? getStaticImageUrl(props.user.avatarUrl)
|
||||
: props.user.avatarUrl);
|
||||
|
||||
|
|
@ -71,6 +92,30 @@ function onClick(ev: MouseEvent): void {
|
|||
emit('click', ev);
|
||||
}
|
||||
|
||||
function getDecorationAngle() {
|
||||
let angle;
|
||||
if (props.decoration) {
|
||||
angle = props.decoration.angle ?? 0;
|
||||
} else if (props.user.avatarDecorations.length > 0) {
|
||||
angle = props.user.avatarDecorations[0].angle ?? 0;
|
||||
} else {
|
||||
angle = 0;
|
||||
}
|
||||
return angle === 0 ? undefined : `${angle * 360}deg`;
|
||||
}
|
||||
|
||||
function getDecorationScale() {
|
||||
let scaleX;
|
||||
if (props.decoration) {
|
||||
scaleX = props.decoration.flipH ? -1 : 1;
|
||||
} else if (props.user.avatarDecorations.length > 0) {
|
||||
scaleX = props.user.avatarDecorations[0].flipH ? -1 : 1;
|
||||
} else {
|
||||
scaleX = 1;
|
||||
}
|
||||
return scaleX === 1 ? undefined : `${scaleX} 1`;
|
||||
}
|
||||
|
||||
let color = $ref<string | undefined>();
|
||||
|
||||
watch(() => props.user.avatarBlurhash, () => {
|
||||
|
|
@ -134,7 +179,7 @@ watch(() => props.user.avatarBlurhash, () => {
|
|||
|
||||
.indicator {
|
||||
position: absolute;
|
||||
z-index: 1;
|
||||
z-index: 2;
|
||||
bottom: 0;
|
||||
left: 0;
|
||||
width: 20%;
|
||||
|
|
@ -278,4 +323,13 @@ watch(() => props.user.avatarBlurhash, () => {
|
|||
}
|
||||
}
|
||||
}
|
||||
|
||||
.decoration {
|
||||
position: absolute;
|
||||
z-index: 1;
|
||||
top: -50%;
|
||||
left: -50%;
|
||||
width: 200%;
|
||||
pointer-events: none;
|
||||
}
|
||||
</style>
|
||||
|
|
|
|||
|
|
@ -18,10 +18,10 @@ interface Props {
|
|||
|
||||
const contentSymbol = Symbol();
|
||||
const observer = new ResizeObserver((entries) => {
|
||||
const results: {
|
||||
container: HTMLSpanElement;
|
||||
transform: string;
|
||||
}[] = [];
|
||||
const results: {
|
||||
container: HTMLSpanElement;
|
||||
transform: string;
|
||||
}[] = [];
|
||||
for (const entry of entries) {
|
||||
const content = (entry.target[contentSymbol] ? entry.target : entry.target.firstElementChild) as HTMLSpanElement;
|
||||
const props: Required<Props> = content[contentSymbol];
|
||||
|
|
|
|||
|
|
@ -5,14 +5,27 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<span v-if="errored">:{{ customEmojiName }}:</span>
|
||||
<img v-else :class="[$style.root, { [$style.normal]: normal, [$style.noStyle]: noStyle }]" :src="url" :alt="alt" :title="alt" decoding="async" @error="errored = true" @load="errored = false"/>
|
||||
<img
|
||||
v-else
|
||||
:class="[$style.root, { [$style.normal]: normal, [$style.noStyle]: noStyle }]"
|
||||
:src="url"
|
||||
:alt="alt"
|
||||
:title="alt"
|
||||
decoding="async"
|
||||
@error="errored = true"
|
||||
@load="errored = false"
|
||||
@click="onClick"
|
||||
/>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed } from 'vue';
|
||||
import { computed, inject } from 'vue';
|
||||
import { getProxiedImageUrl, getStaticImageUrl } from '@/scripts/media-proxy.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
import { customEmojisMap } from '@/custom-emojis.js';
|
||||
import * as os from '@/os.js';
|
||||
import copyToClipboard from '@/scripts/copy-to-clipboard.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
|
||||
const props = defineProps<{
|
||||
name: string;
|
||||
|
|
@ -21,8 +34,12 @@ const props = defineProps<{
|
|||
host?: string | null;
|
||||
url?: string;
|
||||
useOriginalSize?: boolean;
|
||||
menu?: boolean;
|
||||
menuReaction?: boolean;
|
||||
}>();
|
||||
|
||||
const react = inject<((name: string) => void) | null>('react', null);
|
||||
|
||||
const customEmojiName = computed(() => (props.name[0] === ':' ? props.name.substring(1, props.name.length - 1) : props.name).replace('@.', ''));
|
||||
const isLocal = computed(() => !props.host && (customEmojiName.value.endsWith('@.') || !customEmojiName.value.includes('@')));
|
||||
|
||||
|
|
@ -55,6 +72,28 @@ const url = computed(() => {
|
|||
|
||||
const alt = computed(() => `:${customEmojiName.value}:`);
|
||||
let errored = $ref(url.value == null);
|
||||
|
||||
function onClick(ev: MouseEvent) {
|
||||
if (props.menu) {
|
||||
os.popupMenu([{
|
||||
type: 'label',
|
||||
text: `:${props.name}:`,
|
||||
}, {
|
||||
text: i18n.ts.copy,
|
||||
icon: 'ti ti-copy',
|
||||
action: () => {
|
||||
copyToClipboard(`:${props.name}:`);
|
||||
os.success();
|
||||
},
|
||||
}, ...(props.menuReaction && react ? [{
|
||||
text: i18n.ts.doReaction,
|
||||
icon: 'ti ti-plus',
|
||||
action: () => {
|
||||
react(`:${props.name}:`);
|
||||
},
|
||||
}] : [])], ev.currentTarget ?? ev.target);
|
||||
}
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
|
|
@ -4,21 +4,28 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<img v-if="!useOsNativeEmojis" :class="$style.root" :src="url" :alt="props.emoji" decoding="async" @pointerenter="computeTitle"/>
|
||||
<span v-else-if="useOsNativeEmojis" :alt="props.emoji" @pointerenter="computeTitle">{{ props.emoji }}</span>
|
||||
<img v-if="!useOsNativeEmojis" :class="$style.root" :src="url" :alt="props.emoji" decoding="async" @pointerenter="computeTitle" @click="onClick"/>
|
||||
<span v-else-if="useOsNativeEmojis" :alt="props.emoji" @pointerenter="computeTitle" @click="onClick">{{ props.emoji }}</span>
|
||||
<span v-else>{{ emoji }}</span>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed } from 'vue';
|
||||
import { computed, inject } from 'vue';
|
||||
import { char2twemojiFilePath, char2fluentEmojiFilePath } from '@/scripts/emoji-base.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
import { getEmojiName } from '@/scripts/emojilist.js';
|
||||
import * as os from '@/os.js';
|
||||
import copyToClipboard from '@/scripts/copy-to-clipboard.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
|
||||
const props = defineProps<{
|
||||
emoji: string;
|
||||
menu?: boolean;
|
||||
menuReaction?: boolean;
|
||||
}>();
|
||||
|
||||
const react = inject<((name: string) => void) | null>('react', null);
|
||||
|
||||
const char2path = defaultStore.state.emojiStyle === 'twemoji' ? char2twemojiFilePath : char2fluentEmojiFilePath;
|
||||
|
||||
const useOsNativeEmojis = computed(() => defaultStore.state.emojiStyle === 'native');
|
||||
|
|
@ -31,6 +38,28 @@ function computeTitle(event: PointerEvent): void {
|
|||
const title = getEmojiName(props.emoji as string) ?? props.emoji as string;
|
||||
(event.target as HTMLElement).title = title;
|
||||
}
|
||||
|
||||
function onClick(ev: MouseEvent) {
|
||||
if (props.menu) {
|
||||
os.popupMenu([{
|
||||
type: 'label',
|
||||
text: props.emoji,
|
||||
}, {
|
||||
text: i18n.ts.copy,
|
||||
icon: 'ti ti-copy',
|
||||
action: () => {
|
||||
copyToClipboard(props.emoji);
|
||||
os.success();
|
||||
},
|
||||
}, ...(props.menuReaction && react ? [{
|
||||
text: i18n.ts.doReaction,
|
||||
icon: 'ti ti-plus',
|
||||
action: () => {
|
||||
react(props.emoji);
|
||||
},
|
||||
}] : [])], ev.currentTarget ?? ev.target);
|
||||
}
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
32
packages/frontend/src/components/global/MkFooterSpacer.vue
Normal file
32
packages/frontend/src/components/global/MkFooterSpacer.vue
Normal file
|
|
@ -0,0 +1,32 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<div :class="[$style.spacer, defaultStore.reactiveState.darkMode.value ? $style.dark : $style.light]"></div>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { defaultStore } from '@/store.js';
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.spacer {
|
||||
box-sizing: border-box;
|
||||
padding: 32px;
|
||||
margin: 0 auto;
|
||||
height: 300px;
|
||||
background-clip: content-box;
|
||||
background-size: auto auto;
|
||||
background-color: rgba(255, 255, 255, 0);
|
||||
|
||||
&.light {
|
||||
background-image: repeating-linear-gradient(135deg, transparent, transparent 16px, #00000010 16px, #00000010 20px );
|
||||
}
|
||||
|
||||
&.dark {
|
||||
background-image: repeating-linear-gradient(135deg, transparent, transparent 16px, #FFFFFF16 16px, #FFFFFF16 20px );
|
||||
}
|
||||
}
|
||||
</style>
|
||||
|
|
@ -17,7 +17,7 @@ import MkSparkle from '@/components/MkSparkle.vue';
|
|||
import MkA from '@/components/global/MkA.vue';
|
||||
import { host } from '@/config.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
import { nyaize } from '@/scripts/nyaize.js';
|
||||
import { nyaize as doNyaize } from '@/scripts/nyaize.js';
|
||||
|
||||
const QUOTE_STYLE = `
|
||||
display: block;
|
||||
|
|
@ -28,21 +28,29 @@ border-left: solid 3px var(--fg);
|
|||
opacity: 0.7;
|
||||
`.split('\n').join(' ');
|
||||
|
||||
export default function(props: {
|
||||
type MfmProps = {
|
||||
text: string;
|
||||
plain?: boolean;
|
||||
nowrap?: boolean;
|
||||
author?: Misskey.entities.UserLite;
|
||||
i?: Misskey.entities.UserLite;
|
||||
isNote?: boolean;
|
||||
emojiUrls?: string[];
|
||||
rootScale?: number;
|
||||
}) {
|
||||
const isNote = props.isNote !== undefined ? props.isNote : true;
|
||||
nyaize: boolean | 'account';
|
||||
parsedNodes?: mfm.MfmNode[] | null;
|
||||
enableEmojiMenu?: boolean;
|
||||
enableEmojiMenuReaction?: boolean;
|
||||
};
|
||||
|
||||
// eslint-disable-next-line import/no-default-export
|
||||
export default function(props: MfmProps) {
|
||||
const isNote = props.isNote ?? true;
|
||||
const shouldNyaize = props.nyaize ? props.nyaize === 'account' ? props.author?.isCat : false : false;
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/no-unnecessary-condition
|
||||
if (props.text == null || props.text === '') return;
|
||||
|
||||
const ast = (props.plain ? mfm.parseSimple : mfm.parse)(props.text);
|
||||
const rootAst = props.parsedNodes ?? (props.plain ? mfm.parseSimple : mfm.parse)(props.text);
|
||||
|
||||
const validTime = (t: string | null | undefined) => {
|
||||
if (t == null) return null;
|
||||
|
|
@ -55,13 +63,14 @@ export default function(props: {
|
|||
* Gen Vue Elements from MFM AST
|
||||
* @param ast MFM AST
|
||||
* @param scale How times large the text is
|
||||
* @param disableNyaize Whether nyaize is disabled or not
|
||||
*/
|
||||
const genEl = (ast: mfm.MfmNode[], scale: number, disableNyaize = false) => ast.map((token): VNode | string | (VNode | string)[] => {
|
||||
switch (token.type) {
|
||||
case 'text': {
|
||||
let text = token.props.text.replace(/(\r\n|\n|\r)/g, '\n');
|
||||
if (!disableNyaize && props.author?.isCat) {
|
||||
text = nyaize(text);
|
||||
if (!disableNyaize && shouldNyaize) {
|
||||
text = doNyaize(text);
|
||||
}
|
||||
|
||||
if (!props.plain) {
|
||||
|
|
@ -320,6 +329,8 @@ export default function(props: {
|
|||
normal: props.plain,
|
||||
host: null,
|
||||
useOriginalSize: scale >= 2.5,
|
||||
menu: props.enableEmojiMenu,
|
||||
menuReaction: props.enableEmojiMenuReaction,
|
||||
})];
|
||||
} else {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unnecessary-condition
|
||||
|
|
@ -343,6 +354,8 @@ export default function(props: {
|
|||
return [h(MkEmoji, {
|
||||
key: Math.random(),
|
||||
emoji: token.props.emoji,
|
||||
menu: props.enableEmojiMenu,
|
||||
menuReaction: props.enableEmojiMenuReaction,
|
||||
})];
|
||||
}
|
||||
|
||||
|
|
@ -377,5 +390,5 @@ export default function(props: {
|
|||
return h('span', {
|
||||
// https://codeday.me/jp/qa/20190424/690106.html
|
||||
style: props.nowrap ? 'white-space: pre; word-wrap: normal; overflow: hidden; text-overflow: ellipsis;' : 'white-space: pre-wrap;',
|
||||
}, genEl(ast, props.rootScale ?? 1));
|
||||
}, genEl(rootAst, props.rootScale ?? 1));
|
||||
}
|
||||
|
|
|
|||
|
|
@ -134,9 +134,11 @@ async function enter(el: HTMLElement) {
|
|||
|
||||
setTimeout(renderTab, 170);
|
||||
}
|
||||
|
||||
function afterEnter(el: HTMLElement) {
|
||||
//el.style.width = '';
|
||||
}
|
||||
|
||||
async function leave(el: HTMLElement) {
|
||||
const elementWidth = el.getBoundingClientRect().width;
|
||||
el.style.width = elementWidth + 'px';
|
||||
|
|
@ -145,6 +147,7 @@ async function leave(el: HTMLElement) {
|
|||
el.style.width = '0';
|
||||
el.style.paddingLeft = '0';
|
||||
}
|
||||
|
||||
function afterLeave(el: HTMLElement) {
|
||||
el.style.width = '';
|
||||
}
|
||||
|
|
|
|||
|
|
@ -31,23 +31,28 @@ import * as os from '@/os.js';
|
|||
import { useTooltip } from '@/scripts/use-tooltip.js';
|
||||
import { safeURIDecode } from '@/scripts/safe-uri-decode.js';
|
||||
|
||||
const props = defineProps<{
|
||||
const props = withDefaults(defineProps<{
|
||||
url: string;
|
||||
rel?: string;
|
||||
}>();
|
||||
showUrlPreview?: boolean;
|
||||
}>(), {
|
||||
showUrlPreview: true,
|
||||
});
|
||||
|
||||
const self = props.url.startsWith(local);
|
||||
const url = new URL(props.url);
|
||||
if (!['http:', 'https:'].includes(url.protocol)) throw new Error('invalid url');
|
||||
const el = ref();
|
||||
|
||||
useTooltip(el, (showing) => {
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkUrlPreviewPopup.vue')), {
|
||||
showing,
|
||||
url: props.url,
|
||||
source: el.value,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
if (props.showUrlPreview) {
|
||||
useTooltip(el, (showing) => {
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkUrlPreviewPopup.vue')), {
|
||||
showing,
|
||||
url: props.url,
|
||||
source: el.value,
|
||||
}, {}, 'closed');
|
||||
});
|
||||
}
|
||||
|
||||
const schema = url.protocol;
|
||||
const hostname = decodePunycode(url.hostname);
|
||||
|
|
|
|||
|
|
@ -5,7 +5,7 @@
|
|||
|
||||
import { App } from 'vue';
|
||||
|
||||
import Mfm from './global/MkMisskeyFlavoredMarkdown.ts';
|
||||
import Mfm from './global/MkMisskeyFlavoredMarkdown.js';
|
||||
import MkA from './global/MkA.vue';
|
||||
import MkAcct from './global/MkAcct.vue';
|
||||
import MkAvatar from './global/MkAvatar.vue';
|
||||
|
|
@ -16,13 +16,14 @@ import MkUserName from './global/MkUserName.vue';
|
|||
import MkEllipsis from './global/MkEllipsis.vue';
|
||||
import MkTime from './global/MkTime.vue';
|
||||
import MkUrl from './global/MkUrl.vue';
|
||||
import I18n from './global/i18n';
|
||||
import I18n from './global/i18n.js';
|
||||
import RouterView from './global/RouterView.vue';
|
||||
import MkLoading from './global/MkLoading.vue';
|
||||
import MkError from './global/MkError.vue';
|
||||
import MkAd from './global/MkAd.vue';
|
||||
import MkPageHeader from './global/MkPageHeader.vue';
|
||||
import MkSpacer from './global/MkSpacer.vue';
|
||||
import MkFooterSpacer from './global/MkFooterSpacer.vue';
|
||||
import MkStickyContainer from './global/MkStickyContainer.vue';
|
||||
|
||||
export default function(app: App) {
|
||||
|
|
@ -50,6 +51,7 @@ export const components = {
|
|||
MkAd: MkAd,
|
||||
MkPageHeader: MkPageHeader,
|
||||
MkSpacer: MkSpacer,
|
||||
MkFooterSpacer: MkFooterSpacer,
|
||||
MkStickyContainer: MkStickyContainer,
|
||||
};
|
||||
|
||||
|
|
@ -73,6 +75,7 @@ declare module '@vue/runtime-core' {
|
|||
MkAd: typeof MkAd;
|
||||
MkPageHeader: typeof MkPageHeader;
|
||||
MkSpacer: typeof MkSpacer;
|
||||
MkFooterSpacer: typeof MkFooterSpacer;
|
||||
MkStickyContainer: typeof MkStickyContainer;
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<div class="_gaps">
|
||||
<Mfm :text="block.text" :isNote="false" :i="$i"/>
|
||||
<Mfm :text="block.text" :isNote="false"/>
|
||||
<MkUrlPreview v-for="url in urls" :key="url" :url="url"/>
|
||||
</div>
|
||||
</template>
|
||||
|
|
|
|||
|
|
@ -66,6 +66,7 @@ export const ROLE_POLICIES = [
|
|||
'inviteLimitCycle',
|
||||
'inviteExpirationTime',
|
||||
'canManageCustomEmojis',
|
||||
'canManageAvatarDecorations',
|
||||
'canSearchNotes',
|
||||
'canUseTranslator',
|
||||
'canHideAds',
|
||||
|
|
|
|||
|
|
@ -1045,7 +1045,7 @@
|
|||
["⌛", "hourglass", 6],
|
||||
["📡", "satellite", 6],
|
||||
["🔋", "battery", 6],
|
||||
["🪫", "battery", 6],
|
||||
["🪫", "low_battery", 6],
|
||||
["🔌", "electric_plug", 6],
|
||||
["💡", "bulb", 6],
|
||||
["🔦", "flashlight", 6],
|
||||
|
|
@ -1061,7 +1061,7 @@
|
|||
["💰", "moneybag", 6],
|
||||
["🪙", "coin", 6],
|
||||
["💳", "credit_card", 6],
|
||||
["🪫", "identification_card", 6],
|
||||
["🪪", "identification_card", 6],
|
||||
["💎", "gem", 6],
|
||||
["⚖", "balance_scale", 6],
|
||||
["🧰", "toolbox", 6],
|
||||
|
|
|
|||
|
|
@ -6,7 +6,7 @@
|
|||
import { computed, reactive } from 'vue';
|
||||
import { $i } from '@/account.js';
|
||||
import { miLocalStorage } from '@/local-storage.js';
|
||||
import { openInstanceMenu } from '@/ui/_common_/common.js';
|
||||
import { openInstanceMenu, openToolsMenu } from '@/ui/_common_/common.js';
|
||||
import { lookup } from '@/scripts/lookup.js';
|
||||
import * as os from '@/os.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
|
|
@ -19,6 +19,15 @@ export const navbarItemDef = reactive({
|
|||
icon: 'ti ti-bell',
|
||||
show: computed(() => $i != null),
|
||||
indicated: computed(() => $i != null && $i.hasUnreadNotification),
|
||||
indicateValue: computed(() => {
|
||||
if (!$i || $i.unreadNotificationsCount === 0) return '';
|
||||
|
||||
if ($i.unreadNotificationsCount > 99) {
|
||||
return '99+';
|
||||
} else {
|
||||
return $i.unreadNotificationsCount.toString();
|
||||
}
|
||||
}),
|
||||
to: '/my/notifications',
|
||||
},
|
||||
drive: {
|
||||
|
|
@ -142,6 +151,13 @@ export const navbarItemDef = reactive({
|
|||
openInstanceMenu(ev);
|
||||
},
|
||||
},
|
||||
tools: {
|
||||
title: i18n.ts.tools,
|
||||
icon: 'ti ti-tool',
|
||||
action: (ev) => {
|
||||
openToolsMenu(ev);
|
||||
},
|
||||
},
|
||||
reload: {
|
||||
title: i18n.ts.reload,
|
||||
icon: 'ti ti-refresh',
|
||||
|
|
|
|||
|
|
@ -28,7 +28,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkButton primary rounded inline @click="iLoveMisskey">I <Mfm text="$[jelly ❤]"/> #Misskey</MkButton>
|
||||
</div>
|
||||
<FormSection>
|
||||
<div class="_formLinks">
|
||||
<div class="_gaps_s">
|
||||
<FormLink to="https://github.com/Misskey-art/misskey" external>
|
||||
<template #icon><i class="ti ti-code"></i></template>
|
||||
{{ i18n.ts._aboutMisskey.source }}
|
||||
|
|
@ -52,7 +52,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
</FormSection>
|
||||
<FormSection>
|
||||
<template #label>{{ i18n.ts._aboutMisskey.contributors }}</template>
|
||||
<template #label>{{ i18n.ts._aboutMisskey.projectMembers }}</template>
|
||||
<div :class="$style.contributors">
|
||||
<a href="https://github.com/syuilo" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/4439005?v=4" :class="$style.contributorAvatar">
|
||||
|
|
@ -66,20 +66,47 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<img src="https://avatars.githubusercontent.com/u/20679825?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@acid-chicken</span>
|
||||
</a>
|
||||
<a href="https://github.com/rinsuki" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/6533808?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@rinsuki</span>
|
||||
<a href="https://github.com/kakkokari-gtyih" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/67428053?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@kakkokari-gtyih</span>
|
||||
</a>
|
||||
<a href="https://github.com/taichanNE30" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/40626578?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@taichanNE30</span>
|
||||
</a>
|
||||
</div>
|
||||
</FormSection>
|
||||
<FormSection>
|
||||
<template #label>{{ i18n.ts._aboutMisskey.contributors }}</template>
|
||||
<div :class="$style.contributors" style="margin-bottom: 8px;">
|
||||
<a href="https://github.com/mei23" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/30769358?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@mei23</span>
|
||||
</a>
|
||||
<a href="https://github.com/rinsuki" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/6533808?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@rinsuki</span>
|
||||
</a>
|
||||
<a href="https://github.com/robflop" target="_blank" :class="$style.contributor">
|
||||
<img src="https://avatars.githubusercontent.com/u/8159402?v=4" :class="$style.contributorAvatar">
|
||||
<span :class="$style.contributorUsername">@robflop</span>
|
||||
</a>
|
||||
</div>
|
||||
<template #caption><MkLink url="https://github.com/misskey-dev/misskey/graphs/contributors">{{ i18n.ts._aboutMisskey.allContributors }}</MkLink></template>
|
||||
<MkLink url="https://github.com/misskey-dev/misskey/graphs/contributors">{{ i18n.ts._aboutMisskey.allContributors }}</MkLink>
|
||||
</FormSection>
|
||||
<FormSection>
|
||||
<template #label>Special thanks</template>
|
||||
<div style="display:grid;grid-template-columns:repeat(auto-fill, minmax(130px, 1fr));grid-gap:24px;align-items:center;">
|
||||
<div>
|
||||
<a style="display: inline-block;" class="masknetwork" title="Mask Network" href="https://mask.io/" target="_blank"><img style="width: 100%;" src="https://misskey-hub.net/sponsors/masknetwork.png" alt="Mask Network"></a>
|
||||
</div>
|
||||
<div>
|
||||
<a style="display: inline-block;" class="xserver" title="XServer" href="https://www.xserver.ne.jp/" target="_blank"><img style="width: 100%;" src="https://misskey-hub.net/sponsors/xserver.png" alt="XServer"></a>
|
||||
</div>
|
||||
<div>
|
||||
<a style="display: inline-block;" class="skeb" title="Skeb" href="https://skeb.jp/" target="_blank"><img style="width: 100%;" src="https://misskey-hub.net/sponsors/skeb.svg" alt="Skeb"></a>
|
||||
</div>
|
||||
</div>
|
||||
</FormSection>
|
||||
<FormSection>
|
||||
<template #label><Mfm text="$[jelly ❤]"/> {{ i18n.ts._aboutMisskey.patrons }}</template>
|
||||
|
|
@ -94,20 +121,6 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
<p>{{ i18n.ts._aboutMisskey.morePatrons }}</p>
|
||||
</FormSection>
|
||||
<FormSection>
|
||||
<template #label>Special thanks</template>
|
||||
<div class="_gaps" style="text-align: center;">
|
||||
<div>
|
||||
<a style="display: inline-block;" class="masknetwork" title="Mask Network" href="https://mask.io/" target="_blank"><img width="180" src="https://misskey-hub.net/sponsors/masknetwork.png" alt="Mask Network"></a>
|
||||
</div>
|
||||
<div>
|
||||
<a style="display: inline-block;" class="skeb" title="Skeb" href="https://skeb.jp/" target="_blank"><img width="180" src="https://misskey-hub.net/sponsors/skeb.svg" alt="Skeb"></a>
|
||||
</div>
|
||||
<div>
|
||||
<a style="display: inline-block;" class="dcadvirth" title="DC Advirth" href="https://www.dotchain.ltd/advirth" target="_blank"><img width="100" src="https://misskey-hub.net/sponsors/dcadvirth.png" alt="DC Advirth"></a>
|
||||
</div>
|
||||
</div>
|
||||
</FormSection>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</div>
|
||||
|
|
@ -299,6 +312,7 @@ const patrons = [
|
|||
'美少女JKぐーちゃん',
|
||||
'てば',
|
||||
'たっくん',
|
||||
'SHO SEKIGUCHI',
|
||||
];
|
||||
|
||||
let thereIsTreasure = $ref($i && !claimedAchievements.includes('foundTreasure'));
|
||||
|
|
|
|||
|
|
@ -8,7 +8,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkButton v-if="$i && ($i.isModerator || $i.policies.canManageCustomEmojis)" primary link to="/custom-emojis-manager">{{ i18n.ts.manageCustomEmojis }}</MkButton>
|
||||
|
||||
<div class="query">
|
||||
<MkInput v-model="q" class="" :placeholder="i18n.ts.search">
|
||||
<MkInput v-model="q" class="" :placeholder="i18n.ts.search" autocapitalize="off">
|
||||
<template #prefix><i class="ti ti-search"></i></template>
|
||||
</MkInput>
|
||||
|
||||
|
|
|
|||
|
|
@ -4,7 +4,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<div>
|
||||
<div class="_gaps">
|
||||
<div>
|
||||
<MkInput v-model="host" :debounce="true" class="">
|
||||
<template #prefix><i class="ti ti-search"></i></template>
|
||||
|
|
|
|||
|
|
@ -47,7 +47,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</MkKeyValue>
|
||||
</FormSplit>
|
||||
<FormLink v-if="instance.impressumUrl" :to="instance.impressumUrl" external>{{ i18n.ts.impressum }}</FormLink>
|
||||
<div class="_formLinks">
|
||||
<div class="_gaps_s">
|
||||
<MkFolder v-if="instance.serverRules.length > 0">
|
||||
<template #label>{{ i18n.ts.serverRules }}</template>
|
||||
|
||||
|
|
@ -79,7 +79,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<FormSection>
|
||||
<template #label>Well-known resources</template>
|
||||
<div class="_formLinks">
|
||||
<div class="_gaps_s">
|
||||
<FormLink :to="`/.well-known/host-meta`" external>host-meta</FormLink>
|
||||
<FormLink :to="`/.well-known/host-meta.json`" external>host-meta.json</FormLink>
|
||||
<FormLink :to="`/.well-known/nodeinfo`" external>nodeinfo</FormLink>
|
||||
|
|
|
|||
|
|
@ -6,7 +6,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template>
|
||||
<MkStickyContainer>
|
||||
<template #header>
|
||||
<XHeader :actions="headerActions" :tabs="headerTabs" />
|
||||
<XHeader :actions="headerActions" :tabs="headerTabs"/>
|
||||
</template>
|
||||
<MkSpacer :contentMax="900">
|
||||
<MkSwitch :modelValue="publishing" @update:modelValue="onChangePublishing">
|
||||
|
|
@ -14,11 +14,11 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</MkSwitch>
|
||||
<div>
|
||||
<div v-for="ad in ads" class="_panel _gaps_m" :class="$style.ad">
|
||||
<MkAd v-if="ad.url" :specify="ad" />
|
||||
<MkAd v-if="ad.url" :specify="ad"/>
|
||||
<MkInput v-model="ad.url" type="url">
|
||||
<template #label>URL</template>
|
||||
</MkInput>
|
||||
<MkInput v-model="ad.imageUrl">
|
||||
<MkInput v-model="ad.imageUrl" type="url">
|
||||
<template #label>{{ i18n.ts.imageUrl }}</template>
|
||||
</MkInput>
|
||||
<MkRadios v-model="ad.place">
|
||||
|
|
@ -51,8 +51,10 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span>
|
||||
{{ i18n.ts._ad.timezoneinfo }}
|
||||
<div v-for="(day, index) in daysOfWeek" :key="index">
|
||||
<input :id="`ad${ad.id}-${index}`" type="checkbox" :checked="(ad.dayOfWeek & (1 << index)) !== 0"
|
||||
@change="toggleDayOfWeek(ad, index)">
|
||||
<input
|
||||
:id="`ad${ad.id}-${index}`" type="checkbox" :checked="(ad.dayOfWeek & (1 << index)) !== 0"
|
||||
@change="toggleDayOfWeek(ad, index)"
|
||||
>
|
||||
<label :for="`ad${ad.id}-${index}`">{{ day }}</label>
|
||||
</div>
|
||||
</span>
|
||||
|
|
@ -61,9 +63,13 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #label>{{ i18n.ts.memo }}</template>
|
||||
</MkTextarea>
|
||||
<div class="buttons">
|
||||
<MkButton class="button" inline primary style="margin-right: 12px;" @click="save(ad)"><i
|
||||
class="ti ti-device-floppy"></i> {{ i18n.ts.save }}</MkButton>
|
||||
<MkButton class="button" inline danger @click="remove(ad)"><i class="ti ti-trash"></i> {{ i18n.ts.remove }}
|
||||
<MkButton class="button" inline primary style="margin-right: 12px;" @click="save(ad)">
|
||||
<i
|
||||
class="ti ti-device-floppy"
|
||||
></i> {{ i18n.ts.save }}
|
||||
</MkButton>
|
||||
<MkButton class="button" inline danger @click="remove(ad)">
|
||||
<i class="ti ti-trash"></i> {{ i18n.ts.remove }}
|
||||
</MkButton>
|
||||
</div>
|
||||
</div>
|
||||
|
|
@ -115,6 +121,7 @@ const onChangePublishing = (v) => {
|
|||
publishing = v;
|
||||
refresh();
|
||||
};
|
||||
|
||||
// 選択された曜日(index)のビットフラグを操作する
|
||||
function toggleDayOfWeek(ad, index) {
|
||||
ad.dayOfWeek ^= 1 << index;
|
||||
|
|
@ -187,6 +194,7 @@ function save(ad) {
|
|||
});
|
||||
}
|
||||
}
|
||||
|
||||
function more() {
|
||||
os.api('admin/ad/list', { untilId: ads.reduce((acc, ad) => ad.id != null ? ad : acc).id, publishing: publishing }).then(adsResponse => {
|
||||
ads = ads.concat(adsResponse.map(r => {
|
||||
|
|
|
|||
|
|
@ -8,6 +8,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #header><XHeader :actions="headerActions" :tabs="headerTabs"/></template>
|
||||
<MkSpacer :contentMax="900">
|
||||
<div class="_gaps">
|
||||
<MkInfo>{{ i18n.ts._announcement.shouldNotBeUsedToPresentPermanentInfo }}</MkInfo>
|
||||
<MkInfo v-if="announcements.length > 5" warn>{{ i18n.ts._announcement.tooManyActiveAnnouncementDescription }}</MkInfo>
|
||||
|
||||
<MkFolder v-for="announcement in announcements" :key="announcement.id ?? announcement._id" :defaultOpen="announcement.id == null">
|
||||
|
|
@ -27,7 +28,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkTextarea v-model="announcement.text">
|
||||
<template #label>{{ i18n.ts.text }}</template>
|
||||
</MkTextarea>
|
||||
<MkInput v-model="announcement.imageUrl">
|
||||
<MkInput v-model="announcement.imageUrl" type="url">
|
||||
<template #label>{{ i18n.ts.imageUrl }}</template>
|
||||
</MkInput>
|
||||
<MkRadios v-model="announcement.icon">
|
||||
|
|
@ -43,9 +44,13 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<option value="banner">{{ i18n.ts.banner }}</option>
|
||||
<option value="dialog">{{ i18n.ts.dialog }}</option>
|
||||
</MkRadios>
|
||||
<MkInfo v-if="announcement.display === 'dialog'" warn>{{ i18n.ts._announcement.dialogAnnouncementUxWarn }}</MkInfo>
|
||||
<MkSwitch v-model="announcement.forExistingUsers" :helpText="i18n.ts._announcement.forExistingUsersDescription">
|
||||
{{ i18n.ts._announcement.forExistingUsers }}
|
||||
</MkSwitch>
|
||||
<MkSwitch v-model="announcement.silence" :helpText="i18n.ts._announcement.silenceDescription">
|
||||
{{ i18n.ts._announcement.silence }}
|
||||
</MkSwitch>
|
||||
<MkSwitch v-model="announcement.needConfirmationToRead" :helpText="i18n.ts._announcement.needConfirmationToReadDescription">
|
||||
{{ i18n.ts._announcement.needConfirmationToRead }}
|
||||
</MkSwitch>
|
||||
|
|
@ -95,6 +100,7 @@ function add() {
|
|||
icon: 'info',
|
||||
display: 'normal',
|
||||
forExistingUsers: false,
|
||||
silence: false,
|
||||
needConfirmationToRead: false,
|
||||
});
|
||||
}
|
||||
|
|
|
|||
|
|
@ -10,12 +10,12 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkSpacer :contentMax="700" :marginMin="16" :marginMax="32">
|
||||
<FormSuspense :p="init">
|
||||
<div class="_gaps_m">
|
||||
<MkInput v-model="iconUrl">
|
||||
<MkInput v-model="iconUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts._serverSettings.iconUrl }}</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="app192IconUrl">
|
||||
<MkInput v-model="app192IconUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts._serverSettings.iconUrl }} (App/192px)</template>
|
||||
<template #caption>
|
||||
|
|
@ -26,7 +26,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="app512IconUrl">
|
||||
<MkInput v-model="app512IconUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts._serverSettings.iconUrl }} (App/512px)</template>
|
||||
<template #caption>
|
||||
|
|
@ -37,27 +37,27 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="bannerUrl">
|
||||
<MkInput v-model="bannerUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.bannerUrl }}</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="backgroundImageUrl">
|
||||
<MkInput v-model="backgroundImageUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.backgroundImageUrl }}</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="notFoundImageUrl">
|
||||
<MkInput v-model="notFoundImageUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.notFoundDescription }}</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="infoImageUrl">
|
||||
<MkInput v-model="infoImageUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.nothing }}</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="serverErrorImageUrl">
|
||||
<MkInput v-model="serverErrorImageUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.somethingHappened }}</template>
|
||||
</MkInput>
|
||||
|
|
|
|||
|
|
@ -115,6 +115,11 @@ const menuDef = $computed(() => [{
|
|||
text: i18n.ts.customEmojis,
|
||||
to: '/admin/emojis',
|
||||
active: currentPage?.route.name === 'emojis',
|
||||
}, {
|
||||
icon: 'ti ti-sparkles',
|
||||
text: i18n.ts.avatarDecorations,
|
||||
to: '/admin/avatar-decorations',
|
||||
active: currentPage?.route.name === 'avatarDecorations',
|
||||
}, {
|
||||
icon: 'ti ti-whirl',
|
||||
text: i18n.ts.federation,
|
||||
|
|
|
|||
|
|
@ -20,12 +20,12 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<FormLink to="/admin/server-rules">{{ i18n.ts.serverRules }}</FormLink>
|
||||
|
||||
<MkInput v-model="tosUrl">
|
||||
<MkInput v-model="tosUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.tosUrl }}</template>
|
||||
</MkInput>
|
||||
|
||||
<MkInput v-model="privacyPolicyUrl">
|
||||
<MkInput v-model="privacyPolicyUrl" type="url">
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #label>{{ i18n.ts.privacyPolicyUrl }}</template>
|
||||
</MkInput>
|
||||
|
|
|
|||
|
|
@ -8,9 +8,9 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #label>
|
||||
<b
|
||||
:class="{
|
||||
[$style.logGreen]: ['createRole', 'addCustomEmoji', 'createGlobalAnnouncement', 'createUserAnnouncement', 'createAd', 'createInvitation'].includes(log.type),
|
||||
[$style.logGreen]: ['createRole', 'addCustomEmoji', 'createGlobalAnnouncement', 'createUserAnnouncement', 'createAd', 'createInvitation', 'createAvatarDecoration'].includes(log.type),
|
||||
[$style.logYellow]: ['markSensitiveDriveFile', 'resetPassword'].includes(log.type),
|
||||
[$style.logRed]: ['suspend', 'deleteRole', 'suspendRemoteInstance', 'deleteGlobalAnnouncement', 'deleteUserAnnouncement', 'deleteCustomEmoji', 'deleteNote', 'deleteDriveFile', 'deleteAd'].includes(log.type)
|
||||
[$style.logRed]: ['suspend', 'deleteRole', 'suspendRemoteInstance', 'deleteGlobalAnnouncement', 'deleteUserAnnouncement', 'deleteCustomEmoji', 'deleteNote', 'deleteDriveFile', 'deleteAd', 'deleteAvatarDecoration'].includes(log.type)
|
||||
}"
|
||||
>{{ i18n.ts._moderationLogTypes[log.type] }}</b>
|
||||
<span v-if="log.type === 'updateUserNote'">: @{{ log.info.userUsername }}{{ log.info.userHost ? '@' + log.info.userHost : '' }}</span>
|
||||
|
|
@ -37,6 +37,9 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-else-if="log.type === 'deleteUserAnnouncement'">: @{{ log.info.userUsername }}{{ log.info.userHost ? '@' + log.info.userHost : '' }}</span>
|
||||
<span v-else-if="log.type === 'deleteNote'">: @{{ log.info.noteUserUsername }}{{ log.info.noteUserHost ? '@' + log.info.noteUserHost : '' }}</span>
|
||||
<span v-else-if="log.type === 'deleteDriveFile'">: @{{ log.info.fileUserUsername }}{{ log.info.fileUserHost ? '@' + log.info.fileUserHost : '' }}</span>
|
||||
<span v-else-if="log.type === 'createAvatarDecoration'">: {{ log.info.avatarDecoration.name }}</span>
|
||||
<span v-else-if="log.type === 'updateAvatarDecoration'">: {{ log.info.before.name }}</span>
|
||||
<span v-else-if="log.type === 'deleteAvatarDecoration'">: {{ log.info.avatarDecoration.name }}</span>
|
||||
</template>
|
||||
<template #icon>
|
||||
<MkAvatar :user="log.user" :class="$style.avatar"/>
|
||||
|
|
@ -102,6 +105,11 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<CodeDiff :context="5" :hideHeader="true" :oldString="JSON5.stringify(log.info.before, null, '\t')" :newString="JSON5.stringify(log.info.after, null, '\t')" language="javascript" maxHeight="300px"/>
|
||||
</div>
|
||||
</template>
|
||||
<template v-else-if="log.type === 'updateAvatarDecoration'">
|
||||
<div :class="$style.diff">
|
||||
<CodeDiff :context="5" :hideHeader="true" :oldString="JSON5.stringify(log.info.before, null, '\t')" :newString="JSON5.stringify(log.info.after, null, '\t')" language="javascript" maxHeight="300px"/>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
<details>
|
||||
<summary>raw</summary>
|
||||
|
|
|
|||
|
|
@ -12,7 +12,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkSwitch v-model="useObjectStorage">{{ i18n.ts.useObjectStorage }}</MkSwitch>
|
||||
|
||||
<template v-if="useObjectStorage">
|
||||
<MkInput v-model="objectStorageBaseUrl" :placeholder="'https://example.com'">
|
||||
<MkInput v-model="objectStorageBaseUrl" :placeholder="'https://example.com'" type="url">
|
||||
<template #label>{{ i18n.ts.objectStorageBaseUrl }}</template>
|
||||
<template #caption>{{ i18n.ts.objectStorageBaseUrlDesc }}</template>
|
||||
</MkInput>
|
||||
|
|
|
|||
|
|
@ -21,7 +21,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #label>{{ i18n.ts.color }}</template>
|
||||
</MkColorInput>
|
||||
|
||||
<MkInput v-model="role.iconUrl">
|
||||
<MkInput v-model="role.iconUrl" type="url">
|
||||
<template #label>{{ i18n.ts._role.iconUrl }}</template>
|
||||
</MkInput>
|
||||
|
||||
|
|
@ -259,6 +259,26 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
</MkFolder>
|
||||
|
||||
<MkFolder v-if="matchQuery([i18n.ts._role._options.canManageAvatarDecorations, 'canManageAvatarDecorations'])">
|
||||
<template #label>{{ i18n.ts._role._options.canManageAvatarDecorations }}</template>
|
||||
<template #suffix>
|
||||
<span v-if="role.policies.canManageAvatarDecorations.useDefault" :class="$style.useDefaultLabel">{{ i18n.ts._role.useBaseValue }}</span>
|
||||
<span v-else>{{ role.policies.canManageAvatarDecorations.value ? i18n.ts.yes : i18n.ts.no }}</span>
|
||||
<span :class="$style.priorityIndicator"><i :class="getPriorityIcon(role.policies.canManageAvatarDecorations)"></i></span>
|
||||
</template>
|
||||
<div class="_gaps">
|
||||
<MkSwitch v-model="role.policies.canManageAvatarDecorations.useDefault" :readonly="readonly">
|
||||
<template #label>{{ i18n.ts._role.useBaseValue }}</template>
|
||||
</MkSwitch>
|
||||
<MkSwitch v-model="role.policies.canManageAvatarDecorations.value" :disabled="role.policies.canManageAvatarDecorations.useDefault" :readonly="readonly">
|
||||
<template #label>{{ i18n.ts.enable }}</template>
|
||||
</MkSwitch>
|
||||
<MkRange v-model="role.policies.canManageAvatarDecorations.priority" :min="0" :max="2" :step="1" easing :textConverter="(v) => v === 0 ? i18n.ts._role._priority.low : v === 1 ? i18n.ts._role._priority.middle : v === 2 ? i18n.ts._role._priority.high : ''">
|
||||
<template #label>{{ i18n.ts._role.priority }}</template>
|
||||
</MkRange>
|
||||
</div>
|
||||
</MkFolder>
|
||||
|
||||
<MkFolder v-if="matchQuery([i18n.ts._role._options.canSearchNotes, 'canSearchNotes'])">
|
||||
<template #label>{{ i18n.ts._role._options.canSearchNotes }}</template>
|
||||
<template #suffix>
|
||||
|
|
|
|||
|
|
@ -79,6 +79,14 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</MkInput>
|
||||
</MkFolder>
|
||||
|
||||
<MkFolder v-if="matchQuery([i18n.ts._role._options.canManageAvatarDecorations, 'canManageAvatarDecorations'])">
|
||||
<template #label>{{ i18n.ts._role._options.canManageAvatarDecorations }}</template>
|
||||
<template #suffix>{{ policies.canManageAvatarDecorations ? i18n.ts.yes : i18n.ts.no }}</template>
|
||||
<MkSwitch v-model="policies.canManageAvatarDecorations">
|
||||
<template #label>{{ i18n.ts.enable }}</template>
|
||||
</MkSwitch>
|
||||
</MkFolder>
|
||||
|
||||
<MkFolder v-if="matchQuery([i18n.ts._role._options.canManageCustomEmojis, 'canManageCustomEmojis'])">
|
||||
<template #label>{{ i18n.ts._role._options.canManageCustomEmojis }}</template>
|
||||
<template #suffix>{{ policies.canManageCustomEmojis ? i18n.ts.yes : i18n.ts.no }}</template>
|
||||
|
|
|
|||
|
|
@ -34,7 +34,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</MkInput>
|
||||
</FormSplit>
|
||||
|
||||
<MkInput v-model="impressumUrl">
|
||||
<MkInput v-model="impressumUrl" type="url">
|
||||
<template #label>{{ i18n.ts.impressumUrl }}</template>
|
||||
<template #prefix><i class="ti ti-link"></i></template>
|
||||
<template #caption>{{ i18n.ts.impressumDescription }}</template>
|
||||
|
|
@ -87,9 +87,14 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</FormSection>
|
||||
|
||||
<FormSection>
|
||||
<template #label>Timeline caching</template>
|
||||
<template #label>Misskey® Fan-out Timeline Technology™ (FTT)</template>
|
||||
|
||||
<div class="_gaps_m">
|
||||
<MkSwitch v-model="enableFanoutTimeline">
|
||||
<template #label>{{ i18n.ts.enable }}</template>
|
||||
<template #caption>{{ i18n.ts._serverSettings.fanoutTimelineDescription }}</template>
|
||||
</MkSwitch>
|
||||
|
||||
<MkInput v-model="perLocalUserUserTimelineCacheMax" type="number">
|
||||
<template #label>perLocalUserUserTimelineCacheMax</template>
|
||||
</MkInput>
|
||||
|
|
@ -165,6 +170,7 @@ let cacheRemoteSensitiveFiles: boolean = $ref(false);
|
|||
let enableServiceWorker: boolean = $ref(false);
|
||||
let swPublicKey: any = $ref(null);
|
||||
let swPrivateKey: any = $ref(null);
|
||||
let enableFanoutTimeline: boolean = $ref(false);
|
||||
let perLocalUserUserTimelineCacheMax: number = $ref(0);
|
||||
let perRemoteUserUserTimelineCacheMax: number = $ref(0);
|
||||
let perUserHomeTimelineCacheMax: number = $ref(0);
|
||||
|
|
@ -185,6 +191,7 @@ async function init(): Promise<void> {
|
|||
enableServiceWorker = meta.enableServiceWorker;
|
||||
swPublicKey = meta.swPublickey;
|
||||
swPrivateKey = meta.swPrivateKey;
|
||||
enableFanoutTimeline = meta.enableFanoutTimeline;
|
||||
perLocalUserUserTimelineCacheMax = meta.perLocalUserUserTimelineCacheMax;
|
||||
perRemoteUserUserTimelineCacheMax = meta.perRemoteUserUserTimelineCacheMax;
|
||||
perUserHomeTimelineCacheMax = meta.perUserHomeTimelineCacheMax;
|
||||
|
|
@ -206,6 +213,7 @@ async function save(): void {
|
|||
enableServiceWorker,
|
||||
swPublicKey,
|
||||
swPrivateKey,
|
||||
enableFanoutTimeline,
|
||||
perLocalUserUserTimelineCacheMax,
|
||||
perRemoteUserUserTimelineCacheMax,
|
||||
perUserHomeTimelineCacheMax,
|
||||
|
|
|
|||
|
|
@ -13,7 +13,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<section v-for="announcement in items" :key="announcement.id" class="_panel" :class="$style.announcement">
|
||||
<div v-if="announcement.forYou" :class="$style.forYou"><i class="ti ti-pin"></i> {{ i18n.ts.forYou }}</div>
|
||||
<div :class="$style.header">
|
||||
<span v-if="$i && !announcement.isRead" style="margin-right: 0.5em;">🆕</span>
|
||||
<span v-if="$i && !announcement.silence && !announcement.isRead" style="margin-right: 0.5em;">🆕</span>
|
||||
<span style="margin-right: 0.5em;">
|
||||
<i v-if="announcement.icon === 'info'" class="ti ti-info-circle"></i>
|
||||
<i v-else-if="announcement.icon === 'warning'" class="ti ti-alert-triangle" style="color: var(--warn);"></i>
|
||||
|
|
@ -29,7 +29,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkTime :time="announcement.updatedAt ?? announcement.createdAt" mode="detail"/>
|
||||
</div>
|
||||
</div>
|
||||
<div v-if="tab !== 'past' && $i && !announcement.isRead" :class="$style.footer">
|
||||
<div v-if="tab !== 'past' && $i && !announcement.silence && !announcement.isRead" :class="$style.footer">
|
||||
<MkButton primary @click="read(announcement)"><i class="ti ti-check"></i> {{ i18n.ts.gotIt }}</MkButton>
|
||||
</div>
|
||||
</section>
|
||||
|
|
|
|||
102
packages/frontend/src/pages/avatar-decorations.vue
Normal file
102
packages/frontend/src/pages/avatar-decorations.vue
Normal file
|
|
@ -0,0 +1,102 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<MkStickyContainer>
|
||||
<template #header><MkPageHeader v-model:tab="tab" :actions="headerActions" :tabs="headerTabs"/></template>
|
||||
<MkSpacer :contentMax="900">
|
||||
<div class="_gaps">
|
||||
<MkFolder v-for="avatarDecoration in avatarDecorations" :key="avatarDecoration.id ?? avatarDecoration._id" :defaultOpen="avatarDecoration.id == null">
|
||||
<template #label>{{ avatarDecoration.name }}</template>
|
||||
<template #caption>{{ avatarDecoration.description }}</template>
|
||||
|
||||
<div class="_gaps_m">
|
||||
<MkInput v-model="avatarDecoration.name">
|
||||
<template #label>{{ i18n.ts.name }}</template>
|
||||
</MkInput>
|
||||
<MkTextarea v-model="avatarDecoration.description">
|
||||
<template #label>{{ i18n.ts.description }}</template>
|
||||
</MkTextarea>
|
||||
<MkInput v-model="avatarDecoration.url">
|
||||
<template #label>{{ i18n.ts.imageUrl }}</template>
|
||||
</MkInput>
|
||||
<div class="buttons _buttons">
|
||||
<MkButton class="button" inline primary @click="save(avatarDecoration)"><i class="ti ti-device-floppy"></i> {{ i18n.ts.save }}</MkButton>
|
||||
<MkButton v-if="avatarDecoration.id != null" class="button" inline danger @click="del(avatarDecoration)"><i class="ti ti-trash"></i> {{ i18n.ts.delete }}</MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</MkFolder>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</MkStickyContainer>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { } from 'vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import MkInput from '@/components/MkInput.vue';
|
||||
import MkTextarea from '@/components/MkTextarea.vue';
|
||||
import MkSwitch from '@/components/MkSwitch.vue';
|
||||
import MkRadios from '@/components/MkRadios.vue';
|
||||
import MkInfo from '@/components/MkInfo.vue';
|
||||
import * as os from '@/os.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { definePageMetadata } from '@/scripts/page-metadata.js';
|
||||
import MkFolder from '@/components/MkFolder.vue';
|
||||
|
||||
let avatarDecorations: any[] = $ref([]);
|
||||
|
||||
function add() {
|
||||
avatarDecorations.unshift({
|
||||
_id: Math.random().toString(36),
|
||||
id: null,
|
||||
name: '',
|
||||
description: '',
|
||||
url: '',
|
||||
});
|
||||
}
|
||||
|
||||
function del(avatarDecoration) {
|
||||
os.confirm({
|
||||
type: 'warning',
|
||||
text: i18n.t('deleteAreYouSure', { x: avatarDecoration.name }),
|
||||
}).then(({ canceled }) => {
|
||||
if (canceled) return;
|
||||
avatarDecorations = avatarDecorations.filter(x => x !== avatarDecoration);
|
||||
os.api('admin/avatar-decorations/delete', avatarDecoration);
|
||||
});
|
||||
}
|
||||
|
||||
async function save(avatarDecoration) {
|
||||
if (avatarDecoration.id == null) {
|
||||
await os.apiWithDialog('admin/avatar-decorations/create', avatarDecoration);
|
||||
load();
|
||||
} else {
|
||||
os.apiWithDialog('admin/avatar-decorations/update', avatarDecoration);
|
||||
}
|
||||
}
|
||||
|
||||
function load() {
|
||||
os.api('admin/avatar-decorations/list').then(_avatarDecorations => {
|
||||
avatarDecorations = _avatarDecorations;
|
||||
});
|
||||
}
|
||||
|
||||
load();
|
||||
|
||||
const headerActions = $computed(() => [{
|
||||
asFullButton: true,
|
||||
icon: 'ti ti-plus',
|
||||
text: i18n.ts.add,
|
||||
handler: add,
|
||||
}]);
|
||||
|
||||
const headerTabs = $computed(() => []);
|
||||
|
||||
definePageMetadata({
|
||||
title: i18n.ts.avatarDecorations,
|
||||
icon: 'ti ti-sparkles',
|
||||
});
|
||||
</script>
|
||||
|
|
@ -24,6 +24,10 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #label>{{ i18n.ts.sensitive }}</template>
|
||||
</MkSwitch>
|
||||
|
||||
<MkSwitch v-model="allowRenoteToExternal">
|
||||
<template #label>{{ i18n.ts._channel.allowRenoteToExternal }}</template>
|
||||
</MkSwitch>
|
||||
|
||||
<div>
|
||||
<MkButton v-if="bannerId == null" @click="setBannerImage"><i class="ti ti-plus"></i> {{ i18n.ts._channel.setBanner }}</MkButton>
|
||||
<div v-else-if="bannerUrl">
|
||||
|
|
@ -76,7 +80,7 @@ import { useRouter } from '@/router.js';
|
|||
import { definePageMetadata } from '@/scripts/page-metadata.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import MkFolder from '@/components/MkFolder.vue';
|
||||
import MkSwitch from "@/components/MkSwitch.vue";
|
||||
import MkSwitch from '@/components/MkSwitch.vue';
|
||||
|
||||
const Sortable = defineAsyncComponent(() => import('vuedraggable').then(x => x.default));
|
||||
|
||||
|
|
@ -93,6 +97,7 @@ let bannerUrl = $ref<string | null>(null);
|
|||
let bannerId = $ref<string | null>(null);
|
||||
let color = $ref('#000');
|
||||
let isSensitive = $ref(false);
|
||||
let allowRenoteToExternal = $ref(true);
|
||||
const pinnedNotes = ref([]);
|
||||
|
||||
watch(() => bannerId, async () => {
|
||||
|
|
@ -121,6 +126,7 @@ async function fetchChannel() {
|
|||
id,
|
||||
}));
|
||||
color = channel.color;
|
||||
allowRenoteToExternal = channel.allowRenoteToExternal;
|
||||
}
|
||||
|
||||
fetchChannel();
|
||||
|
|
@ -150,16 +156,14 @@ function save() {
|
|||
pinnedNoteIds: pinnedNotes.value.map(x => x.id),
|
||||
color: color,
|
||||
isSensitive: isSensitive,
|
||||
allowRenoteToExternal: allowRenoteToExternal,
|
||||
};
|
||||
|
||||
if (props.channelId) {
|
||||
params.channelId = props.channelId;
|
||||
os.api('channels/update', params).then(() => {
|
||||
os.success();
|
||||
});
|
||||
os.apiWithDialog('channels/update', params);
|
||||
} else {
|
||||
os.api('channels/create', params).then(created => {
|
||||
os.success();
|
||||
os.apiWithDialog('channels/create', params).then(created => {
|
||||
router.push(`/channels/${created.id}`);
|
||||
});
|
||||
}
|
||||
|
|
|
|||
|
|
@ -21,7 +21,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div :class="$style.bannerFade"></div>
|
||||
</div>
|
||||
<div v-if="channel.description" :class="$style.description">
|
||||
<Mfm :text="channel.description" :isNote="false" :i="$i"/>
|
||||
<Mfm :text="channel.description" :isNote="false"/>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
|
|
|
|||
|
|
@ -10,7 +10,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div v-if="clip" class="_gaps">
|
||||
<div class="_panel">
|
||||
<div v-if="clip.description" :class="$style.description">
|
||||
<Mfm :text="clip.description" :isNote="false" :i="$i"/>
|
||||
<Mfm :text="clip.description" :isNote="false"/>
|
||||
</div>
|
||||
<MkButton v-if="favorited" v-tooltip="i18n.ts.unfavorite" asLike rounded primary @click="unfavorite()"><i class="ti ti-heart"></i><span v-if="clip.favoritedCount > 0" style="margin-left: 6px;">{{ clip.favoritedCount }}</span></MkButton>
|
||||
<MkButton v-else v-tooltip="i18n.ts.favorite" asLike rounded @click="favorite()"><i class="ti ti-heart"></i><span v-if="clip.favoritedCount > 0" style="margin-left: 6px;">{{ clip.favoritedCount }}</span></MkButton>
|
||||
|
|
|
|||
|
|
@ -10,7 +10,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkSpacer :contentMax="900">
|
||||
<div class="ogwlenmc">
|
||||
<div v-if="tab === 'local'" class="local">
|
||||
<MkInput v-model="query" :debounce="true" type="search">
|
||||
<MkInput v-model="query" :debounce="true" type="search" autocapitalize="off">
|
||||
<template #prefix><i class="ti ti-search"></i></template>
|
||||
<template #label>{{ i18n.ts.search }}</template>
|
||||
</MkInput>
|
||||
|
|
@ -44,7 +44,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<div v-else-if="tab === 'remote'" class="remote">
|
||||
<FormSplit>
|
||||
<MkInput v-model="queryRemote" :debounce="true" type="search">
|
||||
<MkInput v-model="queryRemote" :debounce="true" type="search" autocapitalize="off">
|
||||
<template #prefix><i class="ti ti-search"></i></template>
|
||||
<template #label>{{ i18n.ts.search }}</template>
|
||||
</MkInput>
|
||||
|
|
|
|||
|
|
@ -56,6 +56,10 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #key>{{ i18n.ts._fileViewer.size }}</template>
|
||||
<template #value>{{ bytes(file.size) }}</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue :class="$style.fileMetaDataChildren" :copy="file.url">
|
||||
<template #key>URL</template>
|
||||
<template #value>{{ file.url }}</template>
|
||||
</MkKeyValue>
|
||||
</div>
|
||||
</div>
|
||||
<div v-else class="_fullinfo">
|
||||
|
|
|
|||
|
|
@ -31,13 +31,13 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
</div>
|
||||
<MkButton rounded style="margin: 0 auto;" @click="changeImage">{{ i18n.ts.selectFile }}</MkButton>
|
||||
<MkInput v-model="name" pattern="[a-z0-9_]">
|
||||
<MkInput v-model="name" pattern="[a-z0-9_]" autocapitalize="off">
|
||||
<template #label>{{ i18n.ts.name }}</template>
|
||||
</MkInput>
|
||||
<MkInput v-model="category" :datalist="customEmojiCategories">
|
||||
<template #label>{{ i18n.ts.category }}</template>
|
||||
</MkInput>
|
||||
<MkInput v-model="aliases">
|
||||
<MkInput v-model="aliases" autocapitalize="off">
|
||||
<template #label>{{ i18n.ts.tags }}</template>
|
||||
<template #caption>{{ i18n.ts.setMultipleBySeparatingWithSpace }}</template>
|
||||
</MkInput>
|
||||
|
|
|
|||
|
|
@ -36,7 +36,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #icon><i class="ti ti-code"></i></template>
|
||||
<template #label>{{ i18n.ts._play.viewSource }}</template>
|
||||
|
||||
<MkCode :code="flash.script" :inline="false" class="_monospace"/>
|
||||
<MkCode :code="flash.script" lang="is" :inline="false" class="_monospace"/>
|
||||
</MkFolder>
|
||||
<div :class="$style.footer">
|
||||
<Mfm :text="`By @${flash.user.username}`"/>
|
||||
|
|
|
|||
360
packages/frontend/src/pages/install-extentions.vue
Normal file
360
packages/frontend/src/pages/install-extentions.vue
Normal file
|
|
@ -0,0 +1,360 @@
|
|||
<!--
|
||||
SPDX-FileCopyrightText: syuilo and other misskey contributors
|
||||
SPDX-License-Identifier: AGPL-3.0-only
|
||||
-->
|
||||
|
||||
<template>
|
||||
<MkStickyContainer>
|
||||
<template #header><MkPageHeader :actions="headerActions" :tabs="headerTabs"/></template>
|
||||
<MkSpacer :contentMax="500">
|
||||
<MkLoading v-if="uiPhase === 'fetching'"/>
|
||||
<div v-else-if="uiPhase === 'confirm' && data" class="_gaps_m" :class="$style.extInstallerRoot">
|
||||
<div :class="$style.extInstallerIconWrapper">
|
||||
<i v-if="data.type === 'plugin'" class="ti ti-plug"></i>
|
||||
<i v-else-if="data.type === 'theme'" class="ti ti-palette"></i>
|
||||
<i v-else class="ti ti-download"></i>
|
||||
</div>
|
||||
<h2 :class="$style.extInstallerTitle">{{ i18n.ts._externalResourceInstaller[`_${data.type}`].title }}</h2>
|
||||
<div :class="$style.extInstallerNormDesc">{{ i18n.ts._externalResourceInstaller.checkVendorBeforeInstall }}</div>
|
||||
<MkInfo v-if="data.type === 'plugin'" :warn="true">{{ i18n.ts._plugin.installWarn }}</MkInfo>
|
||||
<FormSection>
|
||||
<template #label>{{ i18n.ts._externalResourceInstaller[`_${data.type}`].metaTitle }}</template>
|
||||
<div class="_gaps_s">
|
||||
<FormSplit>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts.name }}</template>
|
||||
<template #value>{{ data.meta?.name }}</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts.author }}</template>
|
||||
<template #value>{{ data.meta?.author }}</template>
|
||||
</MkKeyValue>
|
||||
</FormSplit>
|
||||
<MkKeyValue v-if="data.type === 'plugin'">
|
||||
<template #key>{{ i18n.ts.description }}</template>
|
||||
<template #value>{{ data.meta?.description }}</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue v-if="data.type === 'plugin'">
|
||||
<template #key>{{ i18n.ts.version }}</template>
|
||||
<template #value>{{ data.meta?.version }}</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue v-if="data.type === 'plugin'">
|
||||
<template #key>{{ i18n.ts.permission }}</template>
|
||||
<template #value>
|
||||
<ul :class="$style.extInstallerKVList">
|
||||
<li v-for="permission in data.meta?.permissions" :key="permission">{{ i18n.ts._permissions[permission] }}</li>
|
||||
</ul>
|
||||
</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue v-if="data.type === 'theme' && data.meta?.base">
|
||||
<template #key>{{ i18n.ts._externalResourceInstaller._meta.base }}</template>
|
||||
<template #value>{{ i18n.ts[data.meta.base] }}</template>
|
||||
</MkKeyValue>
|
||||
<MkFolder>
|
||||
<template #icon><i class="ti ti-code"></i></template>
|
||||
<template #label>{{ i18n.ts._plugin.viewSource }}</template>
|
||||
|
||||
<MkCode :code="data.raw ?? ''"/>
|
||||
</MkFolder>
|
||||
</div>
|
||||
</FormSection>
|
||||
<FormSection>
|
||||
<template #label>{{ i18n.ts._externalResourceInstaller._vendorInfo.title }}</template>
|
||||
<div class="_gaps_s">
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts._externalResourceInstaller._vendorInfo.endpoint }}</template>
|
||||
<template #value><MkUrl :url="url ?? ''" :showUrlPreview="false"></MkUrl></template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts._externalResourceInstaller._vendorInfo.hashVerify }}</template>
|
||||
<template #value>
|
||||
<!--この画面が出ている時点でハッシュの検証には成功している-->
|
||||
<i class="ti ti-check" style="color: var(--accent)"></i>
|
||||
</template>
|
||||
</MkKeyValue>
|
||||
</div>
|
||||
</FormSection>
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton primary @click="install()"><i class="ti ti-check"></i> {{ i18n.ts.install }}</MkButton>
|
||||
</div>
|
||||
</div>
|
||||
<div v-else-if="uiPhase === 'error'" class="_gaps_m" :class="[$style.extInstallerRoot, $style.error]">
|
||||
<div :class="$style.extInstallerIconWrapper">
|
||||
<i class="ti ti-circle-x"></i>
|
||||
</div>
|
||||
<h2 :class="$style.extInstallerTitle">{{ errorKV?.title }}</h2>
|
||||
<div :class="$style.extInstallerNormDesc">{{ errorKV?.description }}</div>
|
||||
<div class="_buttonsCenter">
|
||||
<MkButton @click="goBack()">{{ i18n.ts.goBack }}</MkButton>
|
||||
<MkButton @click="goToMisskey()">{{ i18n.ts.goToMisskey }}</MkButton>
|
||||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</MkStickyContainer>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { ref, computed, onActivated, onDeactivated, nextTick } from 'vue';
|
||||
import MkLoading from '@/components/global/MkLoading.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import FormSection from '@/components/form/section.vue';
|
||||
import FormSplit from '@/components/form/split.vue';
|
||||
import MkCode from '@/components/MkCode.vue';
|
||||
import MkUrl from '@/components/global/MkUrl.vue';
|
||||
import MkInfo from '@/components/MkInfo.vue';
|
||||
import MkFolder from '@/components/MkFolder.vue';
|
||||
import MkKeyValue from '@/components/MkKeyValue.vue';
|
||||
import * as os from '@/os.js';
|
||||
import { AiScriptPluginMeta, parsePluginMeta, installPlugin } from '@/scripts/install-plugin.js';
|
||||
import { parseThemeCode, installTheme } from '@/scripts/install-theme.js';
|
||||
import { unisonReload } from '@/scripts/unison-reload.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { definePageMetadata } from '@/scripts/page-metadata.js';
|
||||
|
||||
const uiPhase = ref<'fetching' | 'confirm' | 'error'>('fetching');
|
||||
const errorKV = ref<{
|
||||
title?: string;
|
||||
description?: string;
|
||||
}>({
|
||||
title: '',
|
||||
description: '',
|
||||
});
|
||||
|
||||
const url = ref<string | null>(null);
|
||||
const hash = ref<string | null>(null);
|
||||
|
||||
const data = ref<{
|
||||
type: 'plugin' | 'theme';
|
||||
raw: string;
|
||||
meta?: {
|
||||
// Plugin & Theme Common
|
||||
name: string;
|
||||
author: string;
|
||||
|
||||
// Plugin
|
||||
description?: string;
|
||||
version?: string;
|
||||
permissions?: string[];
|
||||
config?: Record<string, any>;
|
||||
|
||||
// Theme
|
||||
base?: 'light' | 'dark';
|
||||
};
|
||||
} | null>(null);
|
||||
|
||||
function goBack(): void {
|
||||
history.back();
|
||||
}
|
||||
|
||||
function goToMisskey(): void {
|
||||
location.href = '/';
|
||||
}
|
||||
|
||||
async function fetch() {
|
||||
if (!url.value || !hash.value) {
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._invalidParams.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._invalidParams.description,
|
||||
};
|
||||
uiPhase.value = 'error';
|
||||
return;
|
||||
}
|
||||
const res = await os.api('fetch-external-resources', {
|
||||
url: url.value,
|
||||
hash: hash.value,
|
||||
}).catch((err) => {
|
||||
switch (err.id) {
|
||||
case 'bb774091-7a15-4a70-9dc5-6ac8cf125856':
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._failedToFetch.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._failedToFetch.parseErrorDescription,
|
||||
};
|
||||
uiPhase.value = 'error';
|
||||
break;
|
||||
case '693ba8ba-b486-40df-a174-72f8279b56a4':
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._hashUnmatched.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._hashUnmatched.description,
|
||||
};
|
||||
uiPhase.value = 'error';
|
||||
break;
|
||||
default:
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._failedToFetch.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._failedToFetch.fetchErrorDescription,
|
||||
};
|
||||
uiPhase.value = 'error';
|
||||
break;
|
||||
}
|
||||
throw new Error(err.code);
|
||||
});
|
||||
|
||||
if (!res) {
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._failedToFetch.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._failedToFetch.fetchErrorDescription,
|
||||
};
|
||||
uiPhase.value = 'error';
|
||||
return;
|
||||
}
|
||||
|
||||
switch (res.type) {
|
||||
case 'plugin':
|
||||
try {
|
||||
const meta = await parsePluginMeta(res.data);
|
||||
data.value = {
|
||||
type: 'plugin',
|
||||
meta,
|
||||
raw: res.data,
|
||||
};
|
||||
} catch (err) {
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._pluginParseFailed.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._pluginParseFailed.description,
|
||||
};
|
||||
console.error(err);
|
||||
uiPhase.value = 'error';
|
||||
return;
|
||||
}
|
||||
break;
|
||||
|
||||
case 'theme':
|
||||
try {
|
||||
const metaRaw = parseThemeCode(res.data);
|
||||
// eslint-disable-next-line @typescript-eslint/no-unused-vars
|
||||
const { id, props, desc: description, ...meta } = metaRaw;
|
||||
data.value = {
|
||||
type: 'theme',
|
||||
meta: {
|
||||
description,
|
||||
...meta,
|
||||
},
|
||||
raw: res.data,
|
||||
};
|
||||
} catch (err) {
|
||||
switch (err.message.toLowerCase()) {
|
||||
case 'this theme is already installed':
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._themeParseFailed.title,
|
||||
description: i18n.ts._theme.alreadyInstalled,
|
||||
};
|
||||
break;
|
||||
|
||||
default:
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._themeParseFailed.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._themeParseFailed.description,
|
||||
};
|
||||
break;
|
||||
}
|
||||
console.error(err);
|
||||
uiPhase.value = 'error';
|
||||
return;
|
||||
}
|
||||
break;
|
||||
|
||||
default:
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._resourceTypeNotSupported.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._resourceTypeNotSupported.description,
|
||||
};
|
||||
uiPhase.value = 'error';
|
||||
return;
|
||||
}
|
||||
|
||||
uiPhase.value = 'confirm';
|
||||
}
|
||||
|
||||
async function install() {
|
||||
if (!data.value) return;
|
||||
|
||||
switch (data.value.type) {
|
||||
case 'plugin':
|
||||
if (!data.value.meta) return;
|
||||
try {
|
||||
await installPlugin(data.value.raw, data.value.meta as AiScriptPluginMeta);
|
||||
os.success();
|
||||
nextTick(() => {
|
||||
unisonReload('/');
|
||||
});
|
||||
} catch (err) {
|
||||
errorKV.value = {
|
||||
title: i18n.ts._externalResourceInstaller._errors._pluginInstallFailed.title,
|
||||
description: i18n.ts._externalResourceInstaller._errors._pluginInstallFailed.description,
|
||||
};
|
||||
console.error(err);
|
||||
uiPhase.value = 'error';
|
||||
}
|
||||
break;
|
||||
case 'theme':
|
||||
if (!data.value.meta) return;
|
||||
await installTheme(data.value.raw);
|
||||
os.success();
|
||||
nextTick(() => {
|
||||
location.href = '/settings/theme';
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
onActivated(() => {
|
||||
const urlParams = new URLSearchParams(window.location.search);
|
||||
url.value = urlParams.get('url');
|
||||
hash.value = urlParams.get('hash');
|
||||
fetch();
|
||||
});
|
||||
|
||||
onDeactivated(() => {
|
||||
uiPhase.value = 'fetching';
|
||||
});
|
||||
|
||||
const headerActions = computed(() => []);
|
||||
|
||||
const headerTabs = computed(() => []);
|
||||
|
||||
definePageMetadata({
|
||||
title: i18n.ts._externalResourceInstaller.title,
|
||||
icon: 'ti ti-download',
|
||||
});
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
.extInstallerRoot {
|
||||
border-radius: var(--radius);
|
||||
background: var(--panel);
|
||||
padding: 1.5rem;
|
||||
}
|
||||
|
||||
.extInstallerIconWrapper {
|
||||
width: 48px;
|
||||
height: 48px;
|
||||
font-size: 24px;
|
||||
line-height: 48px;
|
||||
text-align: center;
|
||||
border-radius: 50%;
|
||||
margin-left: auto;
|
||||
margin-right: auto;
|
||||
|
||||
background-color: var(--accentedBg);
|
||||
color: var(--accent);
|
||||
}
|
||||
|
||||
.error .extInstallerIconWrapper {
|
||||
background-color: rgba(255, 42, 42, .15);
|
||||
color: #ff2a2a;
|
||||
}
|
||||
|
||||
.extInstallerTitle {
|
||||
font-size: 1.2rem;
|
||||
text-align: center;
|
||||
margin: 0;
|
||||
}
|
||||
|
||||
.extInstallerNormDesc {
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
.extInstallerKVList {
|
||||
margin-top: 0;
|
||||
margin-bottom: 0;
|
||||
}
|
||||
</style>
|
||||
|
|
@ -36,8 +36,8 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div class="_gaps_s">
|
||||
<MkSwitch v-model="suspended" :disabled="!instance" @update:modelValue="toggleSuspend">{{ i18n.ts.stopActivityDelivery }}</MkSwitch>
|
||||
<MkSwitch v-model="isBlocked" :disabled="!meta || !instance" @update:modelValue="toggleBlock">{{ i18n.ts.blockThisInstance }}</MkSwitch>
|
||||
<MkSwitch v-model="isSilenced" :disabled="!meta || !instance" @update:modelValue="toggleSilenced">{{ i18n.ts.silenceThisInstance }}</MkSwitch>
|
||||
<MkButton @click="refreshMetadata"><i class="ti ti-refresh"></i> Refresh metadata</MkButton>
|
||||
<MkSwitch v-model="isSilenced" :disabled="!meta || !instance" @update:modelValue="toggleSilenced">{{ i18n.ts.silenceThisInstance }}</MkSwitch>
|
||||
<MkButton @click="refreshMetadata"><i class="ti ti-refresh"></i> Refresh metadata</MkButton>
|
||||
</div>
|
||||
</FormSection>
|
||||
|
||||
|
|
@ -171,8 +171,8 @@ async function fetch(): Promise<void> {
|
|||
});
|
||||
suspended = instance.isSuspended;
|
||||
isBlocked = instance.isBlocked;
|
||||
isSilenced = instance.isSilenced;
|
||||
faviconUrl = getProxiedImageUrlNullable(instance.faviconUrl, 'preview') ?? getProxiedImageUrlNullable(instance.iconUrl, 'preview');
|
||||
isSilenced = instance.isSilenced;
|
||||
faviconUrl = getProxiedImageUrlNullable(instance.faviconUrl, 'preview') ?? getProxiedImageUrlNullable(instance.iconUrl, 'preview');
|
||||
}
|
||||
|
||||
async function toggleBlock(): Promise<void> {
|
||||
|
|
@ -183,14 +183,16 @@ async function toggleBlock(): Promise<void> {
|
|||
blockedHosts: isBlocked ? meta.blockedHosts.concat([host]) : meta.blockedHosts.filter(x => x !== host),
|
||||
});
|
||||
}
|
||||
|
||||
async function toggleSilenced(): Promise<void> {
|
||||
if (!meta) throw new Error('No meta?');
|
||||
if (!instance) throw new Error('No instance?');
|
||||
const { host } = instance;
|
||||
await os.api('admin/update-meta', {
|
||||
silencedHosts: isSilenced ? meta.silencedHosts.concat([host]) : meta.silencedHosts.filter(x => x !== host),
|
||||
});
|
||||
if (!meta) throw new Error('No meta?');
|
||||
if (!instance) throw new Error('No instance?');
|
||||
const { host } = instance;
|
||||
await os.api('admin/update-meta', {
|
||||
silencedHosts: isSilenced ? meta.silencedHosts.concat([host]) : meta.silencedHosts.filter(x => x !== host),
|
||||
});
|
||||
}
|
||||
|
||||
async function toggleSuspend(): Promise<void> {
|
||||
if (!instance) throw new Error('No instance?');
|
||||
await os.api('admin/federation/update-instance', {
|
||||
|
|
|
|||
|
|
@ -11,7 +11,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<FormSplit>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts._registry.domain }}</template>
|
||||
<template #value>{{ i18n.ts.system }}</template>
|
||||
<template #value>{{ props.domain === '@' ? i18n.ts.system : props.domain.toUpperCase() }}</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts._registry.scope }}</template>
|
||||
|
|
@ -23,8 +23,8 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<FormSection v-if="keys">
|
||||
<template #label>{{ i18n.ts.keys }}</template>
|
||||
<div class="_formLinks">
|
||||
<FormLink v-for="key in keys" :to="`/registry/value/system/${scope.join('/')}/${key[0]}`" class="_monospace">{{ key[0] }}<template #suffix>{{ key[1].toUpperCase() }}</template></FormLink>
|
||||
<div class="_gaps_s">
|
||||
<FormLink v-for="key in keys" :to="`/registry/value/${props.domain}/${scope.join('/')}/${key[0]}`" class="_monospace">{{ key[0] }}<template #suffix>{{ key[1].toUpperCase() }}</template></FormLink>
|
||||
</div>
|
||||
</FormSection>
|
||||
</div>
|
||||
|
|
@ -46,15 +46,17 @@ import FormSplit from '@/components/form/split.vue';
|
|||
|
||||
const props = defineProps<{
|
||||
path: string;
|
||||
domain: string;
|
||||
}>();
|
||||
|
||||
const scope = $computed(() => props.path.split('/'));
|
||||
const scope = $computed(() => props.path ? props.path.split('/') : []);
|
||||
|
||||
let keys = $ref(null);
|
||||
|
||||
function fetchKeys() {
|
||||
os.api('i/registry/keys-with-type', {
|
||||
scope: scope,
|
||||
domain: props.domain === '@' ? null : props.domain,
|
||||
}).then(res => {
|
||||
keys = Object.entries(res).sort((a, b) => a[0].localeCompare(b[0]));
|
||||
});
|
||||
|
|
|
|||
|
|
@ -14,7 +14,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<FormSplit>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts._registry.domain }}</template>
|
||||
<template #value>{{ i18n.ts.system }}</template>
|
||||
<template #value>{{ props.domain === '@' ? i18n.ts.system : props.domain.toUpperCase() }}</template>
|
||||
</MkKeyValue>
|
||||
<MkKeyValue>
|
||||
<template #key>{{ i18n.ts._registry.scope }}</template>
|
||||
|
|
@ -58,6 +58,7 @@ import FormInfo from '@/components/MkInfo.vue';
|
|||
|
||||
const props = defineProps<{
|
||||
path: string;
|
||||
domain: string;
|
||||
}>();
|
||||
|
||||
const scope = $computed(() => props.path.split('/').slice(0, -1));
|
||||
|
|
@ -70,6 +71,7 @@ function fetchValue() {
|
|||
os.api('i/registry/get-detail', {
|
||||
scope,
|
||||
key,
|
||||
domain: props.domain === '@' ? null : props.domain,
|
||||
}).then(res => {
|
||||
value = res;
|
||||
valueForEditor = JSON5.stringify(res.value, null, '\t');
|
||||
|
|
@ -95,6 +97,7 @@ async function save() {
|
|||
scope,
|
||||
key,
|
||||
value: JSON5.parse(valueForEditor),
|
||||
domain: props.domain === '@' ? null : props.domain,
|
||||
});
|
||||
});
|
||||
}
|
||||
|
|
@ -108,6 +111,7 @@ function del() {
|
|||
os.apiWithDialog('i/registry/remove', {
|
||||
scope,
|
||||
key,
|
||||
domain: props.domain === '@' ? null : props.domain,
|
||||
});
|
||||
});
|
||||
}
|
||||
|
|
|
|||
|
|
@ -9,12 +9,14 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkSpacer :contentMax="600" :marginMin="16">
|
||||
<MkButton primary @click="createKey">{{ i18n.ts._registry.createKey }}</MkButton>
|
||||
|
||||
<FormSection v-if="scopes">
|
||||
<template #label>{{ i18n.ts.system }}</template>
|
||||
<div class="_formLinks">
|
||||
<FormLink v-for="scope in scopes" :to="`/registry/keys/system/${scope.join('/')}`" class="_monospace">{{ scope.join('/') }}</FormLink>
|
||||
</div>
|
||||
</FormSection>
|
||||
<div v-if="scopesWithDomain" class="_gaps_m">
|
||||
<FormSection v-for="domain in scopesWithDomain" :key="domain.domain">
|
||||
<template #label>{{ domain.domain ? domain.domain.toUpperCase() : i18n.ts.system }}</template>
|
||||
<div class="_gaps_s">
|
||||
<FormLink v-for="scope in domain.scopes" :to="`/registry/keys/${domain.domain ?? '@'}/${scope.join('/')}`" class="_monospace">{{ scope.length === 0 ? '(root)' : scope.join('/') }}</FormLink>
|
||||
</div>
|
||||
</FormSection>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</MkStickyContainer>
|
||||
</template>
|
||||
|
|
@ -28,11 +30,11 @@ import FormLink from '@/components/form/link.vue';
|
|||
import FormSection from '@/components/form/section.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
|
||||
let scopes = $ref(null);
|
||||
let scopesWithDomain = $ref(null);
|
||||
|
||||
function fetchScopes() {
|
||||
os.api('i/registry/scopes').then(res => {
|
||||
scopes = res.slice().sort((a, b) => a.join('/').localeCompare(b.join('/')));
|
||||
os.api('i/registry/scopes-with-domain').then(res => {
|
||||
scopesWithDomain = res;
|
||||
});
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -4,46 +4,46 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
-->
|
||||
|
||||
<template>
|
||||
<MkSpacer :contentMax="800">
|
||||
<div :class="$style.root">
|
||||
<div :class="$style.editor" class="_panel">
|
||||
<PrismEditor v-model="code" class="_monospace" :class="$style.code" :highlight="highlighter" :lineNumbers="false"/>
|
||||
<MkButton style="position: absolute; top: 8px; right: 8px;" primary @click="run()"><i class="ti ti-player-play"></i></MkButton>
|
||||
</div>
|
||||
<MkStickyContainer>
|
||||
<template #header><MkPageHeader/></template>
|
||||
|
||||
<MkContainer v-if="root && components.length > 1" :key="uiKey" :foldable="true">
|
||||
<template #header>UI</template>
|
||||
<div :class="$style.ui">
|
||||
<MkAsUi :component="root" :components="components" size="small"/>
|
||||
<MkSpacer :contentMax="800">
|
||||
<div :class="$style.root">
|
||||
<div class="_gaps_s">
|
||||
<div :class="$style.editor" class="_panel">
|
||||
<MkCodeEditor v-model="code" lang="aiscript"/>
|
||||
</div>
|
||||
<MkButton primary @click="run()"><i class="ti ti-player-play"></i></MkButton>
|
||||
</div>
|
||||
</MkContainer>
|
||||
|
||||
<MkContainer :foldable="true" class="">
|
||||
<template #header>{{ i18n.ts.output }}</template>
|
||||
<div :class="$style.logs">
|
||||
<div v-for="log in logs" :key="log.id" class="log" :class="{ print: log.print }">{{ log.text }}</div>
|
||||
<MkContainer v-if="root && components.length > 1" :key="uiKey" :foldable="true">
|
||||
<template #header>UI</template>
|
||||
<div :class="$style.ui">
|
||||
<MkAsUi :component="root" :components="components" size="small"/>
|
||||
</div>
|
||||
</MkContainer>
|
||||
|
||||
<MkContainer :foldable="true" class="">
|
||||
<template #header>{{ i18n.ts.output }}</template>
|
||||
<div :class="$style.logs">
|
||||
<div v-for="log in logs" :key="log.id" class="log" :class="{ print: log.print }">{{ log.text }}</div>
|
||||
</div>
|
||||
</MkContainer>
|
||||
|
||||
<div class="">
|
||||
{{ i18n.ts.scratchpadDescription }}
|
||||
</div>
|
||||
</MkContainer>
|
||||
|
||||
<div class="">
|
||||
{{ i18n.ts.scratchpadDescription }}
|
||||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
</MkSpacer>
|
||||
</MkStickyContainer>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { onDeactivated, onUnmounted, Ref, ref, watch } from 'vue';
|
||||
import 'prismjs';
|
||||
import { highlight, languages } from 'prismjs/components/prism-core';
|
||||
import 'prismjs/components/prism-clike';
|
||||
import 'prismjs/components/prism-javascript';
|
||||
import 'prismjs/themes/prism-okaidia.css';
|
||||
import { PrismEditor } from 'vue-prism-editor';
|
||||
import 'vue-prism-editor/dist/prismeditor.min.css';
|
||||
import { Interpreter, Parser, utils } from '@syuilo/aiscript';
|
||||
import MkContainer from '@/components/MkContainer.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import MkCodeEditor from '@/components/MkCodeEditor.vue';
|
||||
import { createAiScriptEnv } from '@/scripts/aiscript/api.js';
|
||||
import * as os from '@/os.js';
|
||||
import { $i } from '@/account.js';
|
||||
|
|
@ -152,10 +152,6 @@ async function run() {
|
|||
}
|
||||
}
|
||||
|
||||
function highlighter(code) {
|
||||
return highlight(code, languages.js, 'javascript');
|
||||
}
|
||||
|
||||
onDeactivated(() => {
|
||||
if (aiscript) aiscript.abort();
|
||||
});
|
||||
|
|
|
|||
|
|
@ -29,7 +29,6 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div class="_gaps_s">
|
||||
<MkSwitch v-model="showFixedPostForm">{{ i18n.ts.showFixedPostForm }}</MkSwitch>
|
||||
<MkSwitch v-model="showFixedPostFormInChannel">{{ i18n.ts.showFixedPostFormInChannel }}</MkSwitch>
|
||||
<MkSwitch v-model="defaultWithReplies">{{ i18n.ts.withRepliesByDefaultForNewlyFollowed }}</MkSwitch>
|
||||
<MkFolder>
|
||||
<template #label>{{ i18n.ts.pinnedList }}</template>
|
||||
<!-- 複数ピン止め管理できるようにしたいけどめんどいので一旦ひとつのみ -->
|
||||
|
|
@ -51,7 +50,6 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkSwitch v-if="advancedMfm" v-model="animatedMfm">{{ i18n.ts.enableAnimatedMfm }}</MkSwitch>
|
||||
<MkSwitch v-model="showGapBetweenNotesInTimeline">{{ i18n.ts.showGapBetweenNotesInTimeline }}</MkSwitch>
|
||||
<MkSwitch v-model="loadRawImages">{{ i18n.ts.loadRawImages }}</MkSwitch>
|
||||
<MkSwitch v-model="useReactionPickerForContextMenu">{{ i18n.ts.useReactionPickerForContextMenu }}</MkSwitch>
|
||||
<MkRadios v-model="reactionsDisplaySize">
|
||||
<template #label>{{ i18n.ts.reactionsDisplaySize }}</template>
|
||||
<option value="small">{{ i18n.ts.small }}</option>
|
||||
|
|
@ -88,6 +86,8 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template #label>{{ i18n.ts.notificationDisplay }}</template>
|
||||
|
||||
<div class="_gaps_m">
|
||||
<MkSwitch v-model="useGroupedNotifications">{{ i18n.ts.useGroupedNotifications }}</MkSwitch>
|
||||
|
||||
<MkRadios v-model="notificationPosition">
|
||||
<template #label>{{ i18n.ts.position }}</template>
|
||||
<option value="leftTop"><i class="ti ti-align-box-left-top"></i> {{ i18n.ts.leftTop }}</option>
|
||||
|
|
@ -117,6 +117,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkSwitch v-model="disableShowingAnimatedImages">{{ i18n.ts.disableShowingAnimatedImages }}</MkSwitch>
|
||||
<MkSwitch v-model="highlightSensitiveMedia">{{ i18n.ts.highlightSensitiveMedia }}</MkSwitch>
|
||||
<MkSwitch v-model="squareAvatars">{{ i18n.ts.squareAvatars }}</MkSwitch>
|
||||
<MkSwitch v-model="showAvatarDecorations">{{ i18n.ts.showAvatarDecorations }}</MkSwitch>
|
||||
<MkSwitch v-model="useSystemFont">{{ i18n.ts.useSystemFont }}</MkSwitch>
|
||||
<MkSwitch v-model="disableDrawer">{{ i18n.ts.disableDrawer }}</MkSwitch>
|
||||
<MkSwitch v-model="forceShowAds">{{ i18n.ts.forceShowAds }}</MkSwitch>
|
||||
|
|
@ -148,8 +149,10 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div class="_gaps_m">
|
||||
<div class="_gaps_s">
|
||||
<MkSwitch v-model="imageNewTab">{{ i18n.ts.openImageInNewTab }}</MkSwitch>
|
||||
<MkSwitch v-model="useReactionPickerForContextMenu">{{ i18n.ts.useReactionPickerForContextMenu }}</MkSwitch>
|
||||
<MkSwitch v-model="enableInfiniteScroll">{{ i18n.ts.enableInfiniteScroll }}</MkSwitch>
|
||||
<MkSwitch v-model="keepScreenOn">{{ i18n.ts.keepScreenOn }}</MkSwitch>
|
||||
<MkSwitch v-model="disableStreamingTimeline">{{ i18n.ts.disableStreamingTimeline }}</MkSwitch>
|
||||
</div>
|
||||
<MkSelect v-model="serverDisconnectedBehavior">
|
||||
<template #label>{{ i18n.ts.whenServerDisconnected }}</template>
|
||||
|
|
@ -201,7 +204,7 @@ import { unisonReload } from '@/scripts/unison-reload.js';
|
|||
import { i18n } from '@/i18n.js';
|
||||
import { definePageMetadata } from '@/scripts/page-metadata.js';
|
||||
import { miLocalStorage } from '@/local-storage.js';
|
||||
import { globalEvents } from '@/events';
|
||||
import { globalEvents } from '@/events.js';
|
||||
import { claimAchievement } from '@/scripts/achievements.js';
|
||||
|
||||
const lang = ref(miLocalStorage.getItem('lang'));
|
||||
|
|
@ -246,11 +249,13 @@ const instanceTicker = computed(defaultStore.makeGetterSetter('instanceTicker'))
|
|||
const enableInfiniteScroll = computed(defaultStore.makeGetterSetter('enableInfiniteScroll'));
|
||||
const useReactionPickerForContextMenu = computed(defaultStore.makeGetterSetter('useReactionPickerForContextMenu'));
|
||||
const squareAvatars = computed(defaultStore.makeGetterSetter('squareAvatars'));
|
||||
const showAvatarDecorations = computed(defaultStore.makeGetterSetter('showAvatarDecorations'));
|
||||
const mediaListWithOneImageAppearance = computed(defaultStore.makeGetterSetter('mediaListWithOneImageAppearance'));
|
||||
const notificationPosition = computed(defaultStore.makeGetterSetter('notificationPosition'));
|
||||
const notificationStackAxis = computed(defaultStore.makeGetterSetter('notificationStackAxis'));
|
||||
const keepScreenOn = computed(defaultStore.makeGetterSetter('keepScreenOn'));
|
||||
const defaultWithReplies = computed(defaultStore.makeGetterSetter('defaultWithReplies'));
|
||||
const disableStreamingTimeline = computed(defaultStore.makeGetterSetter('disableStreamingTimeline'));
|
||||
const useGroupedNotifications = computed(defaultStore.makeGetterSetter('useGroupedNotifications'));
|
||||
|
||||
watch(lang, () => {
|
||||
miLocalStorage.setItem('lang', lang.value as string);
|
||||
|
|
@ -287,6 +292,7 @@ watch([
|
|||
reactionsDisplaySize,
|
||||
highlightSensitiveMedia,
|
||||
keepScreenOn,
|
||||
disableStreamingTimeline,
|
||||
], async () => {
|
||||
await reloadAsk();
|
||||
});
|
||||
|
|
@ -296,12 +302,14 @@ const emojiIndexLangs = ['en-US'];
|
|||
function downloadEmojiIndex(lang: string) {
|
||||
async function main() {
|
||||
const currentIndexes = defaultStore.state.additionalUnicodeEmojiIndexes;
|
||||
|
||||
function download() {
|
||||
switch (lang) {
|
||||
case 'en-US': return import('../../unicode-emoji-indexes/en-US.json').then(x => x.default);
|
||||
default: throw new Error('unrecognized lang: ' + lang);
|
||||
}
|
||||
}
|
||||
|
||||
currentIndexes[lang] = await download();
|
||||
await defaultStore.set('additionalUnicodeEmojiIndexes', currentIndexes);
|
||||
}
|
||||
|
|
@ -338,6 +346,7 @@ function removePinnedList() {
|
|||
|
||||
let smashCount = 0;
|
||||
let smashTimer: number | null = null;
|
||||
|
||||
function testNotification(): void {
|
||||
const notification: Misskey.entities.Notification = {
|
||||
id: Math.random().toString(),
|
||||
|
|
|
|||
|
|
@ -23,6 +23,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
</div>
|
||||
</MkSpacer>
|
||||
<MkFooterSpacer/>
|
||||
</mkstickycontainer>
|
||||
</template>
|
||||
|
||||
|
|
|
|||
|
|
@ -74,11 +74,11 @@ let sendReadMessage = $computed(() => pushRegistrationInServer?.sendReadMessage
|
|||
const userLists = await os.api('users/lists/list');
|
||||
|
||||
async function readAllUnreadNotes() {
|
||||
await os.api('i/read-all-unread-notes');
|
||||
await os.apiWithDialog('i/read-all-unread-notes');
|
||||
}
|
||||
|
||||
async function readAllNotifications() {
|
||||
await os.api('notifications/mark-all-as-read');
|
||||
await os.apiWithDialog('notifications/mark-all-as-read');
|
||||
}
|
||||
|
||||
async function updateReceiveConfig(type, value) {
|
||||
|
|
|
|||
|
|
@ -73,6 +73,14 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<FormSection>
|
||||
<FormLink to="/registry"><template #icon><i class="ti ti-adjustments"></i></template>{{ i18n.ts.registry }}</FormLink>
|
||||
</FormSection>
|
||||
|
||||
<FormSection>
|
||||
<div class="_gaps_s">
|
||||
<MkSwitch v-model="defaultWithReplies">{{ i18n.ts.withRepliesByDefaultForNewlyFollowed }}</MkSwitch>
|
||||
<MkButton danger @click="updateRepliesAll(true)"><i class="ti ti-messages"></i> {{ i18n.ts.showRepliesToOthersInTimelineAll }}</MkButton>
|
||||
<MkButton danger @click="updateRepliesAll(false)"><i class="ti ti-messages-off"></i> {{ i18n.ts.hideRepliesToOthersInTimelineAll }}</MkButton>
|
||||
</div>
|
||||
</FormSection>
|
||||
</div>
|
||||
</template>
|
||||
|
||||
|
|
@ -95,6 +103,7 @@ import FormSection from '@/components/form/section.vue';
|
|||
const reportError = computed(defaultStore.makeGetterSetter('reportError'));
|
||||
const enableCondensedLineForAcct = computed(defaultStore.makeGetterSetter('enableCondensedLineForAcct'));
|
||||
const devMode = computed(defaultStore.makeGetterSetter('devMode'));
|
||||
const defaultWithReplies = computed(defaultStore.makeGetterSetter('defaultWithReplies'));
|
||||
|
||||
function onChangeInjectFeaturedNote(v) {
|
||||
os.api('i/update', {
|
||||
|
|
@ -138,6 +147,15 @@ async function reloadAsk() {
|
|||
unisonReload();
|
||||
}
|
||||
|
||||
async function updateRepliesAll(withReplies: boolean) {
|
||||
const { canceled } = os.confirm({
|
||||
type: 'warning',
|
||||
text: withReplies ? i18n.ts.confirmShowRepliesAll : i18n.ts.confirmHideRepliesAll,
|
||||
});
|
||||
if (canceled) return;
|
||||
await os.api('following/update-all', { withReplies });
|
||||
}
|
||||
|
||||
watch([
|
||||
enableCondensedLineForAcct,
|
||||
], async () => {
|
||||
|
|
|
|||
|
|
@ -18,130 +18,35 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { defineAsyncComponent, nextTick, ref } from 'vue';
|
||||
import { compareVersions } from 'compare-versions';
|
||||
import { Interpreter, Parser, utils } from '@syuilo/aiscript';
|
||||
import { v4 as uuid } from 'uuid';
|
||||
import { nextTick, ref } from 'vue';
|
||||
import MkTextarea from '@/components/MkTextarea.vue';
|
||||
import MkButton from '@/components/MkButton.vue';
|
||||
import FormInfo from '@/components/MkInfo.vue';
|
||||
import * as os from '@/os.js';
|
||||
import { ColdDeviceStorage } from '@/store.js';
|
||||
import { installPlugin } from '@/scripts/install-plugin.js';
|
||||
import { unisonReload } from '@/scripts/unison-reload.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { definePageMetadata } from '@/scripts/page-metadata.js';
|
||||
|
||||
const parser = new Parser();
|
||||
const code = ref(null);
|
||||
|
||||
function installPlugin({ id, meta, src, token }) {
|
||||
ColdDeviceStorage.set('plugins', ColdDeviceStorage.get('plugins').concat({
|
||||
...meta,
|
||||
id,
|
||||
active: true,
|
||||
configData: {},
|
||||
token: token,
|
||||
src: src,
|
||||
}));
|
||||
}
|
||||
|
||||
function isSupportedAiScriptVersion(version: string): boolean {
|
||||
try {
|
||||
return (compareVersions(version, '0.12.0') >= 0);
|
||||
} catch (err) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
const code = ref<string | null>(null);
|
||||
|
||||
async function install() {
|
||||
if (code.value == null) return;
|
||||
if (!code.value) return;
|
||||
|
||||
const lv = utils.getLangVersion(code.value);
|
||||
if (lv == null) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: 'No language version annotation found :(',
|
||||
});
|
||||
return;
|
||||
} else if (!isSupportedAiScriptVersion(lv)) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: `aiscript version '${lv}' is not supported :(`,
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
let ast;
|
||||
try {
|
||||
ast = parser.parse(code.value);
|
||||
await installPlugin(code.value);
|
||||
os.success();
|
||||
|
||||
nextTick(() => {
|
||||
unisonReload();
|
||||
});
|
||||
} catch (err) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: 'Syntax error :(',
|
||||
title: 'Install failed',
|
||||
text: err.toString() ?? null,
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
const meta = Interpreter.collectMetadata(ast);
|
||||
if (meta == null) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: 'No metadata found :(',
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
const metadata = meta.get(null);
|
||||
if (metadata == null) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: 'No metadata found :(',
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
const { name, version, author, description, permissions, config } = metadata;
|
||||
if (name == null || version == null || author == null) {
|
||||
os.alert({
|
||||
type: 'error',
|
||||
text: 'Required property not found :(',
|
||||
});
|
||||
return;
|
||||
}
|
||||
|
||||
const token = permissions == null || permissions.length === 0 ? null : await new Promise((res, rej) => {
|
||||
os.popup(defineAsyncComponent(() => import('@/components/MkTokenGenerateWindow.vue')), {
|
||||
title: i18n.ts.tokenRequested,
|
||||
information: i18n.ts.pluginTokenRequestedDescription,
|
||||
initialName: name,
|
||||
initialPermissions: permissions,
|
||||
}, {
|
||||
done: async result => {
|
||||
const { name, permissions } = result;
|
||||
const { token } = await os.api('miauth/gen-token', {
|
||||
session: null,
|
||||
name: name,
|
||||
permission: permissions,
|
||||
});
|
||||
res(token);
|
||||
},
|
||||
}, 'closed');
|
||||
});
|
||||
|
||||
installPlugin({
|
||||
id: uuid(),
|
||||
meta: {
|
||||
name, version, author, description, permissions, config,
|
||||
},
|
||||
token,
|
||||
src: code.value,
|
||||
});
|
||||
|
||||
os.success();
|
||||
|
||||
nextTick(() => {
|
||||
unisonReload();
|
||||
});
|
||||
}
|
||||
|
||||
const headerActions = $computed(() => []);
|
||||
|
|
|
|||
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue