merge: upstream
This commit is contained in:
commit
647e76ab36
37 changed files with 493 additions and 130 deletions
|
|
@ -34,7 +34,6 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<script lang="ts" setup>
|
||||
import { onMounted, shallowRef, watch } from 'vue';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import { soundConfigStore } from '@/scripts/sound.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
|
||||
const props = withDefaults(defineProps<{
|
||||
|
|
|
|||
|
|
@ -54,19 +54,28 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkInstanceTicker v-if="showTicker" :instance="appearNote.user.instance"/>
|
||||
<div style="container-type: inline-size;">
|
||||
<p v-if="appearNote.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'" :i="$i"/>
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="appearNote" style="margin: 4px 0;" v-on:click.stop/>
|
||||
</p>
|
||||
<div v-show="appearNote.cw == null || showContent" :class="[{ [$style.contentCollapsed]: collapsed }]" >
|
||||
<div :class="$style.text">
|
||||
<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<MkA v-if="appearNote.replyId" :class="$style.replyIcon" :to="`/notes/${appearNote.replyId}`"><i class="ph-arrow-bend-left-up ph-bold pg-lg"></i></MkA>
|
||||
<Mfm v-if="appearNote.text" :parsedNodes="parsed" :text="appearNote.text" :author="appearNote.user" :nyaize="'account'" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm
|
||||
v-if="appearNote.text"
|
||||
:parsedNodes="parsed"
|
||||
:text="appearNote.text"
|
||||
:author="appearNote.user"
|
||||
:nyaize="'account'"
|
||||
:emojiUrls="appearNote.emojis"
|
||||
:enableEmojiMenu="true"
|
||||
:enableEmojiMenuReaction="true"
|
||||
/>
|
||||
<div v-if="translating || translation" :class="$style.translation">
|
||||
<MkLoading v-if="translating" mini/>
|
||||
<div v-else>
|
||||
<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
|
@ -275,6 +284,13 @@ const keymap = {
|
|||
's': () => showContent.value !== showContent.value,
|
||||
};
|
||||
|
||||
provide('react', (reaction: string) => {
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: appearNote.id,
|
||||
reaction: reaction,
|
||||
});
|
||||
});
|
||||
|
||||
if (props.mock) {
|
||||
watch(() => props.note, (to) => {
|
||||
note = deepClone(to);
|
||||
|
|
|
|||
|
|
@ -68,19 +68,28 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</header>
|
||||
<div :class="$style.noteContent">
|
||||
<p v-if="appearNote.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'" :i="$i"/>
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="appearNote"/>
|
||||
</p>
|
||||
<div v-show="appearNote.cw == null || showContent">
|
||||
<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<MkA v-if="appearNote.replyId" :class="$style.noteReplyTarget" :to="`/notes/${appearNote.replyId}`"><i class="ph-arrow-bend-left-up ph-bold pg-lg"></i></MkA>
|
||||
<Mfm v-if="appearNote.text" :parsedNodes="parsed" :text="appearNote.text" :author="appearNote.user" :nyaize="'account'" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm
|
||||
v-if="appearNote.text"
|
||||
:parsedNodes="parsed"
|
||||
:text="appearNote.text"
|
||||
:author="appearNote.user"
|
||||
:nyaize="'account'"
|
||||
:emojiUrls="appearNote.emojis"
|
||||
:enableEmojiMenu="true"
|
||||
:enableEmojiMenuReaction="true"
|
||||
/>
|
||||
<a v-if="appearNote.renote != null" :class="$style.rn">RN:</a>
|
||||
<div v-if="translating || translation" :class="$style.translation">
|
||||
<MkLoading v-if="translating" mini/>
|
||||
<div v-else>
|
||||
<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
|
||||
</div>
|
||||
</div>
|
||||
<div v-if="appearNote.files.length > 0">
|
||||
|
|
@ -209,7 +218,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed, inject, onMounted, ref, shallowRef, watch } from 'vue';
|
||||
import { computed, inject, onMounted, provide, ref, shallowRef, watch } from 'vue';
|
||||
import * as mfm from 'mfm-js';
|
||||
import * as Misskey from 'misskey-js';
|
||||
import MkNoteSub from '@/components/MkNoteSub.vue';
|
||||
|
|
@ -335,6 +344,13 @@ const keymap = {
|
|||
's': () => showContent.value !== showContent.value,
|
||||
};
|
||||
|
||||
provide('react', (reaction: string) => {
|
||||
os.api('notes/reactions/create', {
|
||||
noteId: appearNote.id,
|
||||
reaction: reaction,
|
||||
});
|
||||
});
|
||||
|
||||
let tab = $ref('replies');
|
||||
let reactionTabType = $ref(null);
|
||||
|
||||
|
|
|
|||
|
|
@ -10,7 +10,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkNoteHeader :class="$style.header" :note="note" :mini="true"/>
|
||||
<div>
|
||||
<p v-if="note.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'" :i="$i" :emojiUrls="note.emojis"/>
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'" :emojiUrls="note.emojis"/>
|
||||
<MkCwButton v-model="showContent" :note="note"/>
|
||||
</p>
|
||||
<div v-show="note.cw == null || showContent">
|
||||
|
|
|
|||
|
|
@ -12,7 +12,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkNoteHeader :class="$style.header" :note="note" :mini="true"/>
|
||||
<div :class="$style.content">
|
||||
<p v-if="note.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'" :i="$i"/>
|
||||
<Mfm v-if="note.cw != ''" style="margin-right: 8px;" :text="note.cw" :author="note.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="note"/>
|
||||
</p>
|
||||
<div v-show="note.cw == null || showContent">
|
||||
|
|
|
|||
|
|
@ -166,7 +166,7 @@ defineExpose({
|
|||
|
||||
<style lang="scss" module>
|
||||
.root {
|
||||
overscroll-behavior: none;
|
||||
overscroll-behavior: contain;
|
||||
|
||||
min-height: 100%;
|
||||
background: var(--bg);
|
||||
|
|
|
|||
|
|
@ -23,16 +23,17 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { onMounted, onUnmounted } from 'vue';
|
||||
import { onMounted, onUnmounted, watch } from 'vue';
|
||||
import { deviceKind } from '@/scripts/device-kind.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
import { getScrollContainer } from '@/scripts/scroll.js';
|
||||
|
||||
const SCROLL_STOP = 10;
|
||||
const MAX_PULL_DISTANCE = Infinity;
|
||||
const FIRE_THRESHOLD = 230;
|
||||
const RELEASE_TRANSITION_DURATION = 200;
|
||||
const PULL_BRAKE_BASE = 2;
|
||||
const PULL_BRAKE_FACTOR = 200;
|
||||
const PULL_BRAKE_BASE = 1.5;
|
||||
const PULL_BRAKE_FACTOR = 170;
|
||||
|
||||
let isPullStart = $ref(false);
|
||||
let isPullEnd = $ref(false);
|
||||
|
|
@ -57,18 +58,6 @@ const emit = defineEmits<{
|
|||
(ev: 'refresh'): void;
|
||||
}>();
|
||||
|
||||
function getScrollableParentElement(node) {
|
||||
if (node == null) {
|
||||
return null;
|
||||
}
|
||||
|
||||
if (node.scrollHeight > node.clientHeight) {
|
||||
return node;
|
||||
} else {
|
||||
return getScrollableParentElement(node.parentNode);
|
||||
}
|
||||
}
|
||||
|
||||
function getScreenY(event) {
|
||||
if (supportPointerDesktop) {
|
||||
return event.screenY;
|
||||
|
|
@ -138,12 +127,9 @@ function moveEnd() {
|
|||
}
|
||||
}
|
||||
|
||||
function moving(event) {
|
||||
function moving(event: TouchEvent | PointerEvent) {
|
||||
if (!isPullStart || isRefreshing || disabled) return;
|
||||
|
||||
if (!scrollEl) {
|
||||
scrollEl = getScrollableParentElement(rootEl);
|
||||
}
|
||||
if ((scrollEl?.scrollTop ?? 0) > (supportPointerDesktop ? SCROLL_STOP : SCROLL_STOP + pullDistance)) {
|
||||
pullDistance = 0;
|
||||
isPullEnd = false;
|
||||
|
|
@ -159,6 +145,10 @@ function moving(event) {
|
|||
const moveHeight = moveScreenY - startScreenY!;
|
||||
pullDistance = Math.min(Math.max(moveHeight, 0), MAX_PULL_DISTANCE);
|
||||
|
||||
if (pullDistance > 0) {
|
||||
if (event.cancelable) event.preventDefault();
|
||||
}
|
||||
|
||||
isPullEnd = pullDistance >= FIRE_THRESHOLD;
|
||||
}
|
||||
|
||||
|
|
@ -178,24 +168,48 @@ function setDisabled(value) {
|
|||
disabled = value;
|
||||
}
|
||||
|
||||
onMounted(() => {
|
||||
// マウス操作でpull to refreshするのは不便そう
|
||||
//supportPointerDesktop = !!window.PointerEvent && deviceKind === 'desktop';
|
||||
function onScrollContainerScroll() {
|
||||
const scrollPos = scrollEl!.scrollTop;
|
||||
|
||||
if (supportPointerDesktop) {
|
||||
rootEl.addEventListener('pointerdown', moveStart);
|
||||
// ポインターの場合、ポップアップ系の動作をするとdownだけ発火されてupが発火されないため
|
||||
window.addEventListener('pointerup', moveEnd);
|
||||
rootEl.addEventListener('pointermove', moving, { passive: true });
|
||||
// When at the top of the page, disable vertical overscroll so passive touch listeners can take over.
|
||||
if (scrollPos === 0) {
|
||||
scrollEl!.style.touchAction = 'pan-x pan-down pinch-zoom';
|
||||
registerEventListenersForReadyToPull();
|
||||
} else {
|
||||
rootEl.addEventListener('touchstart', moveStart);
|
||||
rootEl.addEventListener('touchend', moveEnd);
|
||||
rootEl.addEventListener('touchmove', moving, { passive: true });
|
||||
scrollEl!.style.touchAction = 'auto';
|
||||
unregisterEventListenersForReadyToPull();
|
||||
}
|
||||
}
|
||||
|
||||
function registerEventListenersForReadyToPull() {
|
||||
if (rootEl == null) return;
|
||||
rootEl.addEventListener('touchstart', moveStart, { passive: true });
|
||||
rootEl.addEventListener('touchmove', moving, { passive: false }); // passive: falseにしないとpreventDefaultが使えない
|
||||
}
|
||||
|
||||
function unregisterEventListenersForReadyToPull() {
|
||||
if (rootEl == null) return;
|
||||
rootEl.removeEventListener('touchstart', moveStart);
|
||||
rootEl.removeEventListener('touchmove', moving);
|
||||
}
|
||||
|
||||
onMounted(() => {
|
||||
if (rootEl == null) return;
|
||||
|
||||
scrollEl = getScrollContainer(rootEl);
|
||||
if (scrollEl == null) return;
|
||||
|
||||
scrollEl.addEventListener('scroll', onScrollContainerScroll, { passive: true });
|
||||
|
||||
rootEl.addEventListener('touchend', moveEnd, { passive: true });
|
||||
|
||||
registerEventListenersForReadyToPull();
|
||||
});
|
||||
|
||||
onUnmounted(() => {
|
||||
if (supportPointerDesktop) window.removeEventListener('pointerup', moveEnd);
|
||||
if (scrollEl) scrollEl.removeEventListener('scroll', onScrollContainerScroll);
|
||||
|
||||
unregisterEventListenersForReadyToPull();
|
||||
});
|
||||
|
||||
defineExpose({
|
||||
|
|
|
|||
|
|
@ -9,12 +9,12 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-if="note.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<span v-if="note.deletedAt" style="opacity: 0.5">({{ i18n.ts.deleted }})</span>
|
||||
<MkA v-if="note.replyId" :class="$style.reply" :to="`/notes/${note.replyId}`" v-on:click.stop><i class="ph-arrow-bend-left-up ph-bold pg-lg"></i></MkA>
|
||||
<Mfm v-if="note.text" :text="note.text" :author="note.user" :nyaize="'account'" :i="$i" :emojiUrls="note.emojis"/>
|
||||
<Mfm v-if="note.text" :text="note.text" :author="note.user" :nyaize="'account'" :emojiUrls="note.emojis"/>
|
||||
<div v-if="note.text && translating || note.text && translation" :class="$style.translation">
|
||||
<MkLoading v-if="translating" mini/>
|
||||
<div v-else>
|
||||
<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
|
||||
<Mfm :text="translation.text" :author="note.user" :nyaize="'account'" :i="$i" :emojiUrls="note.emojis"/>
|
||||
<Mfm :text="translation.text" :author="note.user" :nyaize="'account'" :emojiUrls="note.emojis"/>
|
||||
</div>
|
||||
</div>
|
||||
<MkA v-if="note.renoteId" :class="$style.rp" :to="`/notes/${note.renoteId}`" v-on:click.stop>RN: ...</MkA>
|
||||
|
|
|
|||
|
|
@ -6,7 +6,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<template>
|
||||
<div class="_gaps">
|
||||
<div style="text-align: center; padding: 0 16px;">{{ i18n.ts._initialTutorial._postNote.description1 }}</div>
|
||||
<MkPostForm :class="$style.exampleRoot" :mock="true"/>
|
||||
<MkPostForm :class="$style.exampleRoot" :mock="true" :autofocus="false"/>
|
||||
<MkFormSection>
|
||||
<template #label>{{ i18n.ts.visibility }}</template>
|
||||
<div class="_gaps">
|
||||
|
|
|
|||
|
|
@ -11,6 +11,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<MkPostForm
|
||||
:class="$style.exampleRoot"
|
||||
:mock="true"
|
||||
:autofocus="false"
|
||||
:initialNote="exampleNote"
|
||||
@fileChangeSensitive="doSucceeded"
|
||||
></MkPostForm>
|
||||
|
|
|
|||
|
|
@ -14,7 +14,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<span v-if="$i && $i.id !== user.id && user.isFollowed" :class="$style.followed">{{ i18n.ts.followsYou }}</span>
|
||||
<div :class="$style.description">
|
||||
<div v-if="user.description" :class="$style.mfm">
|
||||
<Mfm :text="user.description" :author="user" :i="$i"/>
|
||||
<Mfm :text="user.description" :author="user"/>
|
||||
</div>
|
||||
<span v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</span>
|
||||
</div>
|
||||
|
|
|
|||
|
|
@ -28,7 +28,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
<div :class="$style.username"><MkAcct :user="user"/></div>
|
||||
</div>
|
||||
<div :class="$style.description">
|
||||
<Mfm v-if="user.description" :class="$style.mfm" :text="user.description" :author="user" :i="$i"/>
|
||||
<Mfm v-if="user.description" :class="$style.mfm" :text="user.description" :author="user"/>
|
||||
<div v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</div>
|
||||
</div>
|
||||
<div :class="$style.status">
|
||||
|
|
|
|||
|
|
@ -13,7 +13,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
</div>
|
||||
<div :class="$style.description">
|
||||
<div v-if="user.description" :class="$style.mfm">
|
||||
<Mfm :text="user.description" :author="user" :i="$i"/>
|
||||
<Mfm :text="user.description" :author="user"/>
|
||||
</div>
|
||||
<span v-else style="opacity: 0.7;">{{ i18n.ts.noAccountDescription }}</span>
|
||||
</div>
|
||||
|
|
|
|||
|
|
@ -29,19 +29,19 @@
|
|||
</header>
|
||||
<div :class="$style.noteContent">
|
||||
<p v-if="appearNote.cw != null" :class="$style.cw">
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'" :i="$i"/>
|
||||
<Mfm v-if="appearNote.cw != ''" style="margin-right: 8px;" :text="appearNote.cw" :author="appearNote.user" :nyaize="'account'"/>
|
||||
<MkCwButton v-model="showContent" :note="appearNote"/>
|
||||
</p>
|
||||
<div v-show="appearNote.cw == null || showContent">
|
||||
<span v-if="appearNote.isHidden" style="opacity: 0.5">({{ i18n.ts.private }})</span>
|
||||
<MkA v-if="appearNote.replyId" :class="$style.noteReplyTarget" :to="`/notes/${appearNote.replyId}`"><i class="ph-arrow-bend-left-up ph-bold pg-lg"></i></MkA>
|
||||
<Mfm v-if="appearNote.text" :text="appearNote.text" :author="appearNote.user" :nyaize="'account'" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm v-if="appearNote.text" :text="appearNote.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
|
||||
<a v-if="appearNote.renote != null" :class="$style.rn">RN:</a>
|
||||
<div v-if="translating || translation" :class="$style.translation">
|
||||
<MkLoading v-if="translating" mini/>
|
||||
<div v-else>
|
||||
<b>{{ i18n.t('translatedFrom', { x: translation.sourceLang }) }}: </b>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :i="$i" :emojiUrls="appearNote.emojis"/>
|
||||
<Mfm :text="translation.text" :author="appearNote.user" :nyaize="'account'" :emojiUrls="appearNote.emojis"/>
|
||||
</div>
|
||||
</div>
|
||||
<div v-if="appearNote.files.length > 0">
|
||||
|
|
|
|||
|
|
@ -5,14 +5,27 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<span v-if="errored">:{{ customEmojiName }}:</span>
|
||||
<img v-else :class="[$style.root, { [$style.normal]: normal, [$style.noStyle]: noStyle }]" :src="url" :alt="alt" :title="alt" decoding="async" @error="errored = true" @load="errored = false"/>
|
||||
<img
|
||||
v-else
|
||||
:class="[$style.root, { [$style.normal]: normal, [$style.noStyle]: noStyle }]"
|
||||
:src="url"
|
||||
:alt="alt"
|
||||
:title="alt"
|
||||
decoding="async"
|
||||
@error="errored = true"
|
||||
@load="errored = false"
|
||||
@click="onClick"
|
||||
/>
|
||||
</template>
|
||||
|
||||
<script lang="ts" setup>
|
||||
import { computed } from 'vue';
|
||||
import { computed, inject } from 'vue';
|
||||
import { getProxiedImageUrl, getStaticImageUrl } from '@/scripts/media-proxy.js';
|
||||
import { defaultStore } from '@/store.js';
|
||||
import { customEmojisMap } from '@/custom-emojis.js';
|
||||
import * as os from '@/os.js';
|
||||
import copyToClipboard from '@/scripts/copy-to-clipboard.js';
|
||||
import { i18n } from '@/i18n.js';
|
||||
|
||||
const props = defineProps<{
|
||||
name: string;
|
||||
|
|
@ -21,8 +34,12 @@ const props = defineProps<{
|
|||
host?: string | null;
|
||||
url?: string;
|
||||
useOriginalSize?: boolean;
|
||||
menu?: boolean;
|
||||
menuReaction?: boolean;
|
||||
}>();
|
||||
|
||||
const react = inject<((name: string) => void) | null>('react', null);
|
||||
|
||||
const customEmojiName = computed(() => (props.name[0] === ':' ? props.name.substring(1, props.name.length - 1) : props.name).replace('@.', ''));
|
||||
const isLocal = computed(() => !props.host && (customEmojiName.value.endsWith('@.') || !customEmojiName.value.includes('@')));
|
||||
|
||||
|
|
@ -55,6 +72,28 @@ const url = computed(() => {
|
|||
|
||||
const alt = computed(() => `:${customEmojiName.value}:`);
|
||||
let errored = $ref(url.value == null);
|
||||
|
||||
function onClick(ev: MouseEvent) {
|
||||
if (props.menu) {
|
||||
os.popupMenu([{
|
||||
type: 'label',
|
||||
text: `:${props.name}:`,
|
||||
}, {
|
||||
text: i18n.ts.copy,
|
||||
icon: 'ti ti-copy',
|
||||
action: () => {
|
||||
copyToClipboard(`:${props.name}:`);
|
||||
os.success();
|
||||
},
|
||||
}, ...(props.menuReaction && react ? [{
|
||||
text: i18n.ts.doReaction,
|
||||
icon: 'ti ti-plus',
|
||||
action: () => {
|
||||
react(`:${props.name}:`);
|
||||
},
|
||||
}] : [])], ev.currentTarget ?? ev.target);
|
||||
}
|
||||
}
|
||||
</script>
|
||||
|
||||
<style lang="scss" module>
|
||||
|
|
|
|||
|
|
@ -33,12 +33,13 @@ type MfmProps = {
|
|||
plain?: boolean;
|
||||
nowrap?: boolean;
|
||||
author?: Misskey.entities.UserLite;
|
||||
i?: Misskey.entities.UserLite | null;
|
||||
isNote?: boolean;
|
||||
emojiUrls?: string[];
|
||||
rootScale?: number;
|
||||
nyaize: boolean | 'account';
|
||||
parsedNodes?: mfm.MfmNode[] | null;
|
||||
enableEmojiMenu?: boolean;
|
||||
enableEmojiMenuReaction?: boolean;
|
||||
};
|
||||
|
||||
// eslint-disable-next-line import/no-default-export
|
||||
|
|
@ -328,6 +329,8 @@ export default function(props: MfmProps) {
|
|||
normal: props.plain,
|
||||
host: null,
|
||||
useOriginalSize: scale >= 2.5,
|
||||
menu: props.enableEmojiMenu,
|
||||
menuReaction: props.enableEmojiMenuReaction,
|
||||
})];
|
||||
} else {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unnecessary-condition
|
||||
|
|
|
|||
|
|
@ -5,7 +5,7 @@ SPDX-License-Identifier: AGPL-3.0-only
|
|||
|
||||
<template>
|
||||
<div class="_gaps">
|
||||
<Mfm :text="block.text" :isNote="false" :i="$i"/>
|
||||
<Mfm :text="block.text" :isNote="false"/>
|
||||
<MkUrlPreview v-for="url in urls" :key="url" :url="url"/>
|
||||
</div>
|
||||
</template>
|
||||
|
|
|
|||
Loading…
Add table
Add a link
Reference in a new issue